| Description | Shikimic acid, more commonly known as its anionic form shikimate, is an important biochemical intermediate in plants and microorganisms. Its name comes from the Japanese flower shikimi (シキミ, Illicium anisatum), from which it was first isolated. Shikimic acid is a precursor for: the aromatic amino acids phenylalanine and tyrosine; indole, indole derivatives and tryptophan; many alkaloids and other aromatic metabolites; tannins; and lignin. In pharmaceutical industry, shikimic acid from chinese star anise is used as a base material for production of Tamiflu (oseltamivir). Although shikimic acid is present in most autotrophic organisms, it is a biosynthetic intermediate and generally found in very low concentrations (Wikipedia ). |
|---|
| Synonyms | | Value | Source |
|---|
| 3,4,5-Trihydroxy-1-cyclohexenecarboxylic acid | ChEBI | | 3alpha,4alpha,5beta-Trihydroxy-1-cyclohexene-1-carboxylic acid | ChEBI | | [3R-(3alpha,4alpha,5beta)]-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid | ChEBI | | L-Shikimic acid | ChEBI | | Shikimate | ChEBI | | 3,4,5-Trihydroxy-1-cyclohexenecarboxylate | Generator | | 3a,4a,5b-Trihydroxy-1-cyclohexene-1-carboxylate | Generator | | 3a,4a,5b-Trihydroxy-1-cyclohexene-1-carboxylic acid | Generator | | 3alpha,4alpha,5beta-Trihydroxy-1-cyclohexene-1-carboxylate | Generator | | 3Α,4α,5β-trihydroxy-1-cyclohexene-1-carboxylate | Generator | | 3Α,4α,5β-trihydroxy-1-cyclohexene-1-carboxylic acid | Generator | | [3R-(3a,4a,5b)]-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylate | Generator | | [3R-(3a,4a,5b)]-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid | Generator | | [3R-(3alpha,4alpha,5beta)]-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylate | Generator | | [3R-(3Α,4α,5β)]-3,4,5-trihydroxy-1-cyclohexene-1-carboxylate | Generator | | [3R-(3Α,4α,5β)]-3,4,5-trihydroxy-1-cyclohexene-1-carboxylic acid | Generator | | L-Shikimate | Generator | | Acid, shikimic | MeSH | | (-)-Shikimate | HMDB | | (-)-Shikimic acid | HMDB | | Skikimate | HMDB | | Skikimic acid | HMDB | | (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid | PhytoBank | | (-)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid | PhytoBank | | Shikimic acid | PhytoBank |
|
|---|
| InChI Identifier | InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/t4-,5-,6-/m1/s1 |
|---|
