Showing metabocard for 2,3-di-O-(3'R,7'R,11 'R,15 '-tetramethylhexadecyl)-sn-glycerol (MMDBc0006383)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 1.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected and Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-05-14 23:37:10 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2024-04-30 19:33:57 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite ID | MMDBc0006383 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | 2,3-di-O-(3'R,7'R,11 'R,15 '-tetramethylhexadecyl)-sn-glycerol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | 2,3-DI-Phytanyl-glycerol belongs to the class of organic compounds known as acyclic diterpenoids. These are diterpenoids (compounds made of four consecutive isoprene units) that do not contain a cycle. Based on a literature review very few articles have been published on 2,3-DI-Phytanyl-glycerol. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for #<Metabolite:0x00007f46dcf49230>Mrv1533004251505102D 46 45 0 0 0 0 999 V2000 18.3711 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.0855 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.0855 12.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.8000 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.5145 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.2289 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.9434 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.9434 12.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.6579 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.3724 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.0868 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.8013 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.8013 12.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.5158 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 26.2302 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 26.9447 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.6592 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.6592 12.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.3737 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 29.0881 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 29.8026 11.4315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 30.5171 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 31.2315 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 31.2315 10.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 31.9460 10.1940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 31.9460 11.8440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 32.6605 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 33.3749 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.0894 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.0894 10.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.8039 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 35.5184 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 36.2328 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 36.9473 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 36.9473 10.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 37.6618 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 38.3762 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 39.0907 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 39.8052 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 39.8052 10.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 40.5197 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 41.2341 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 41.9486 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 42.6631 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 43.3775 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 42.6631 10.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 7 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 12 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 23 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 29 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 34 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 39 40 1 0 0 0 0 39 41 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 44 46 1 0 0 0 0 M END 3D MOL for #<Metabolite:0x00007f46dcf49230>HMDB0245415 RDKit 3D 2,3-DI-Phytanyl-glycerol 134133 0 0 0 0 0 0 0 0999 V2000 -14.2169 -2.0538 1.5623 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.0593 -2.5312 2.4222 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.9084 -4.0103 2.2846 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7734 -1.7808 2.0206 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.4401 -2.0212 0.6004 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2585 -1.2712 0.1227 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9487 -1.4718 0.7415 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8190 -1.1592 2.2044 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8897 -0.5828 0.0531 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7098 -0.8740 -1.3722 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7301 -0.0991 -2.1716 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3140 -0.1994 -1.7882 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8663 0.2400 -0.4554 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4125 0.2178 -2.9633 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6715 1.5654 -3.4537 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4270 2.7959 -2.7164 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0241 3.2367 -2.4611 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3175 3.4276 -3.8008 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2268 2.6142 -1.4072 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8155 3.2566 -1.3238 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1099 3.0500 -2.4512 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3012 1.8059 -2.7947 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4127 1.2302 -1.9759 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6830 -0.1980 -2.4757 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0117 -0.2397 -3.8051 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1110 1.1701 -0.6457 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0626 1.9250 0.0949 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7738 1.7867 1.5568 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9639 0.4552 2.1533 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1902 -0.6767 1.4940 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1525 0.0798 2.9261 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5365 0.1382 2.4101 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0613 1.4864 2.1321 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4511 1.6478 1.6236 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5896 3.2140 1.3419 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5090 1.4492 2.6324 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7142 0.1958 3.3503 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9684 -1.0531 2.5965 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1699 -1.1403 1.7367 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4725 -0.9316 2.4698 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0524 -0.4716 0.4271 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3035 -0.5824 -0.4262 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6773 -2.0326 -0.7194 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9379 -2.0674 -1.5862 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7263 -1.3663 -2.9063 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4210 -3.4679 -1.6871 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.3321 -2.6717 0.6303 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.1893 -0.9741 1.3645 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1521 -2.2324 2.1445 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2923 -2.2893 3.4785 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8390 -4.2815 2.3920 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3018 -4.2940 1.2893 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4436 -4.5092 3.1202 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0151 -2.1750 2.7338 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9460 -0.7202 2.2605 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4262 -3.1049 0.3278 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3231 -1.6237 -0.0041 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1450 -1.4098 -1.0003 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5410 -0.1699 0.1857 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5492 -2.5176 0.5959 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8255 -0.6180 2.3400 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7066 -2.0433 2.8609 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5500 -0.4050 2.5629 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3352 0.4658 0.1441 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0012 -0.5361 0.6940 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5485 -1.9898 -1.4661 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7155 -0.7411 -1.8857 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1083 0.9725 -2.1485 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8185 -0.3875 -3.2589 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1168 -1.3491 -1.7862 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4572 1.0388 0.0348 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8314 -0.6118 0.3061 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7636 0.5287 -0.4491 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3857 -0.0370 -2.6518 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6544 -0.4915 -3.8082 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0535 1.6524 -4.4278 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7265 1.5446 -3.9165 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0280 2.8914 -1.7668 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8713 3.6415 -3.3438 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1559 4.3421 -2.1145 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5985 4.2375 -3.7302 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1408 3.8378 -4.4709 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0149 2.5022 -4.2813 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9919 1.5397 -1.5476 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6633 2.7322 -0.4052 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4362 2.9135 -0.3633 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9769 4.3677 -1.1965 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7288 1.8985 -3.8490 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5340 1.0774 -2.9413 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3600 1.8304 -2.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7290 -0.7912 -2.3718 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4683 -0.7001 -1.8884 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7528 -1.1030 -4.2374 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9173 2.9769 -0.1950 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0458 1.6274 -0.2563 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2769 2.5531 2.1711 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6658 2.1140 1.6383 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1750 0.5876 3.1136 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7715 -1.1869 0.7172 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2003 -0.3070 1.1845 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0156 -1.4446 2.2861 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1845 0.6852 3.9113 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0121 -1.0014 3.3221 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1641 -0.4731 3.0959 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6335 -0.4478 1.4297 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3950 2.0377 1.4495 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9340 2.0729 3.1119 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5873 1.2118 0.6399 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4247 3.6690 2.3218 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5999 3.3929 0.9903 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7778 3.4978 0.6657 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2155 2.2110 3.4786 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4729 1.9376 2.3010 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9739 0.0368 4.1537 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6651 0.4083 4.0036 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0863 -1.3068 1.9563 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9680 -1.8971 3.3601 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2302 -2.2731 1.4682 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3519 -0.8866 1.8328 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5338 -1.6609 3.3004 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3938 0.0717 2.9754 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8553 0.6136 0.4904 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2223 -0.8793 -0.2013 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0061 -0.1626 -1.4356 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1405 0.0271 -0.0777 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9194 -2.5823 0.2060 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8750 -2.4963 -1.3377 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6860 -1.4564 -0.9877 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7214 -1.5873 -3.3508 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8041 -0.2741 -2.7679 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5484 -1.6684 -3.5914 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1518 -3.6516 -0.8494 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5669 -4.1651 -1.5226 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9830 -3.6876 -2.6188 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 23 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 44 46 1 0 1 47 1 0 1 48 1 0 1 49 1 0 2 50 1 0 3 51 1 0 3 52 1 0 3 53 1 0 4 54 1 0 4 55 1 0 5 56 1 0 5 57 1 0 6 58 1 0 6 59 1 0 7 60 1 0 8 61 1 0 8 62 1 0 8 63 1 0 9 64 1 0 9 65 1 0 10 66 1 0 10 67 1 0 11 68 1 0 11 69 1 0 12 70 1 0 13 71 1 0 13 72 1 0 13 73 1 0 14 74 1 0 14 75 1 0 15 76 1 0 15 77 1 0 16 78 1 0 16 79 1 0 17 80 1 0 18 81 1 0 18 82 1 0 18 83 1 0 19 84 1 0 19 85 1 0 20 86 1 0 20 87 1 0 22 88 1 0 22 89 1 0 23 90 1 0 24 91 1 0 24 92 1 0 25 93 1 0 27 94 1 0 27 95 1 0 28 96 1 0 28 97 1 0 29 98 1 0 30 99 1 0 30100 1 0 30101 1 0 31102 1 0 31103 1 0 32104 1 0 32105 1 0 33106 1 0 33107 1 0 34108 1 0 35109 1 0 35110 1 0 35111 1 0 36112 1 0 36113 1 0 37114 1 0 37115 1 0 38116 1 0 38117 1 0 39118 1 0 40119 1 0 40120 1 0 40121 1 0 41122 1 0 41123 1 0 42124 1 0 42125 1 0 43126 1 0 43127 1 0 44128 1 0 45129 1 0 45130 1 0 45131 1 0 46132 1 0 46133 1 0 46134 1 0 M END 3D SDF for #<Metabolite:0x00007f46dcf49230>Mrv1533004251505102D 46 45 0 0 0 0 999 V2000 18.3711 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.0855 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.0855 12.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.8000 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.5145 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.2289 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.9434 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.9434 12.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.6579 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.3724 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.0868 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.8013 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.8013 12.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.5158 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 26.2302 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 26.9447 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.6592 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.6592 12.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.3737 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 29.0881 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 29.8026 11.4315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 30.5171 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 31.2315 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 31.2315 10.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 31.9460 10.1940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 31.9460 11.8440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 32.6605 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 33.3749 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.0894 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.0894 10.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.8039 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 35.5184 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 36.2328 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 36.9473 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 36.9473 10.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 37.6618 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 38.3762 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 39.0907 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 39.8052 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 39.8052 10.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 40.5197 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 41.2341 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 41.9486 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 42.6631 11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 43.3775 11.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 42.6631 10.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 7 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 12 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 23 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 29 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 34 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 39 40 1 0 0 0 0 39 41 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 44 46 1 0 0 0 0 M END > <DATABASE_ID> MMDBc0006383 > <DATABASE_NAME> MIME > <SMILES> CC(C)CCCC(C)CCCC(C)CCCC(C)CCOCC(CO)OCCC(C)CCCC(C)CCCC(C)CCCC(C)C > <INCHI_IDENTIFIER> InChI=1S/C43H88O3/c1-35(2)17-11-19-37(5)21-13-23-39(7)25-15-27-41(9)29-31-45-34-43(33-44)46-32-30-42(10)28-16-26-40(8)24-14-22-38(6)20-12-18-36(3)4/h35-44H,11-34H2,1-10H3 > <INCHI_KEY> ISDBCJSGCHUHFI-UHFFFAOYSA-N > <FORMULA> C43H88O3 > <MOLECULAR_WEIGHT> 653.174 > <EXACT_MASS> 652.673346694 > <JCHEM_ACCEPTOR_COUNT> 3 > <JCHEM_ATOM_COUNT> 134 > <JCHEM_AVERAGE_POLARIZABILITY> 88.37474709327833 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 1 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2,3-bis[(3,7,11,15-tetramethylhexadecyl)oxy]propan-1-ol > <ALOGPS_LOGP> 10.10 > <JCHEM_LOGP> 15.060837744666664 > <ALOGPS_LOGS> -8.03 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 0 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA_STRONGEST_ACIDIC> 14.603089442794545 > <JCHEM_PKA_STRONGEST_BASIC> -2.972408677721667 > <JCHEM_POLAR_SURFACE_AREA> 38.69 > <JCHEM_REFRACTIVITY> 204.57850000000005 > <JCHEM_ROTATABLE_BOND_COUNT> 34 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 6.11e-06 g/l > <JCHEM_TRADITIONAL_IUPAC> archaeol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for #<Metabolite:0x00007f46dcf49230>HMDB0245415 RDKit 3D 2,3-DI-Phytanyl-glycerol 134133 0 0 0 0 0 0 0 0999 V2000 -14.2169 -2.0538 1.5623 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.0593 -2.5312 2.4222 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.9084 -4.0103 2.2846 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7734 -1.7808 2.0206 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.4401 -2.0212 0.6004 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2585 -1.2712 0.1227 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9487 -1.4718 0.7415 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8190 -1.1592 2.2044 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8897 -0.5828 0.0531 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7098 -0.8740 -1.3722 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7301 -0.0991 -2.1716 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3140 -0.1994 -1.7882 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8663 0.2400 -0.4554 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4125 0.2178 -2.9633 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6715 1.5654 -3.4537 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4270 2.7959 -2.7164 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0241 3.2367 -2.4611 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3175 3.4276 -3.8008 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2268 2.6142 -1.4072 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8155 3.2566 -1.3238 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1099 3.0500 -2.4512 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3012 1.8059 -2.7947 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4127 1.2302 -1.9759 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6830 -0.1980 -2.4757 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0117 -0.2397 -3.8051 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1110 1.1701 -0.6457 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0626 1.9250 0.0949 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7738 1.7867 1.5568 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9639 0.4552 2.1533 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1902 -0.6767 1.4940 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1525 0.0798 2.9261 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5365 0.1382 2.4101 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0613 1.4864 2.1321 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4511 1.6478 1.6236 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5896 3.2140 1.3419 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5090 1.4492 2.6324 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7142 0.1958 3.3503 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9684 -1.0531 2.5965 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1699 -1.1403 1.7367 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4725 -0.9316 2.4698 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0524 -0.4716 0.4271 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3035 -0.5824 -0.4262 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6773 -2.0326 -0.7194 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9379 -2.0674 -1.5862 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7263 -1.3663 -2.9063 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4210 -3.4679 -1.6871 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.3321 -2.6717 0.6303 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.1893 -0.9741 1.3645 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1521 -2.2324 2.1445 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2923 -2.2893 3.4785 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8390 -4.2815 2.3920 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3018 -4.2940 1.2893 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4436 -4.5092 3.1202 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0151 -2.1750 2.7338 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9460 -0.7202 2.2605 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4262 -3.1049 0.3278 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3231 -1.6237 -0.0041 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1450 -1.4098 -1.0003 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5410 -0.1699 0.1857 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5492 -2.5176 0.5959 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8255 -0.6180 2.3400 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7066 -2.0433 2.8609 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5500 -0.4050 2.5629 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3352 0.4658 0.1441 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0012 -0.5361 0.6940 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5485 -1.9898 -1.4661 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7155 -0.7411 -1.8857 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1083 0.9725 -2.1485 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8185 -0.3875 -3.2589 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1168 -1.3491 -1.7862 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4572 1.0388 0.0348 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8314 -0.6118 0.3061 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7636 0.5287 -0.4491 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3857 -0.0370 -2.6518 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6544 -0.4915 -3.8082 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0535 1.6524 -4.4278 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7265 1.5446 -3.9165 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0280 2.8914 -1.7668 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8713 3.6415 -3.3438 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1559 4.3421 -2.1145 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5985 4.2375 -3.7302 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1408 3.8378 -4.4709 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0149 2.5022 -4.2813 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9919 1.5397 -1.5476 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6633 2.7322 -0.4052 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4362 2.9135 -0.3633 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9769 4.3677 -1.1965 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7288 1.8985 -3.8490 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5340 1.0774 -2.9413 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3600 1.8304 -2.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7290 -0.7912 -2.3718 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4683 -0.7001 -1.8884 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7528 -1.1030 -4.2374 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9173 2.9769 -0.1950 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0458 1.6274 -0.2563 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2769 2.5531 2.1711 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6658 2.1140 1.6383 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1750 0.5876 3.1136 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7715 -1.1869 0.7172 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2003 -0.3070 1.1845 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0156 -1.4446 2.2861 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1845 0.6852 3.9113 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0121 -1.0014 3.3221 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1641 -0.4731 3.0959 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6335 -0.4478 1.4297 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3950 2.0377 1.4495 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9340 2.0729 3.1119 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5873 1.2118 0.6399 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4247 3.6690 2.3218 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5999 3.3929 0.9903 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7778 3.4978 0.6657 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2155 2.2110 3.4786 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4729 1.9376 2.3010 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9739 0.0368 4.1537 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6651 0.4083 4.0036 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0863 -1.3068 1.9563 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9680 -1.8971 3.3601 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2302 -2.2731 1.4682 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3519 -0.8866 1.8328 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5338 -1.6609 3.3004 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3938 0.0717 2.9754 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8553 0.6136 0.4904 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2223 -0.8793 -0.2013 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0061 -0.1626 -1.4356 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1405 0.0271 -0.0777 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9194 -2.5823 0.2060 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8750 -2.4963 -1.3377 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6860 -1.4564 -0.9877 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7214 -1.5873 -3.3508 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8041 -0.2741 -2.7679 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5484 -1.6684 -3.5914 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1518 -3.6516 -0.8494 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5669 -4.1651 -1.5226 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9830 -3.6876 -2.6188 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 23 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 44 46 1 0 1 47 1 0 1 48 1 0 1 49 1 0 2 50 1 0 3 51 1 0 3 52 1 0 3 53 1 0 4 54 1 0 4 55 1 0 5 56 1 0 5 57 1 0 6 58 1 0 6 59 1 0 7 60 1 0 8 61 1 0 8 62 1 0 8 63 1 0 9 64 1 0 9 65 1 0 10 66 1 0 10 67 1 0 11 68 1 0 11 69 1 0 12 70 1 0 13 71 1 0 13 72 1 0 13 73 1 0 14 74 1 0 14 75 1 0 15 76 1 0 15 77 1 0 16 78 1 0 16 79 1 0 17 80 1 0 18 81 1 0 18 82 1 0 18 83 1 0 19 84 1 0 19 85 1 0 20 86 1 0 20 87 1 0 22 88 1 0 22 89 1 0 23 90 1 0 24 91 1 0 24 92 1 0 25 93 1 0 27 94 1 0 27 95 1 0 28 96 1 0 28 97 1 0 29 98 1 0 30 99 1 0 30100 1 0 30101 1 0 31102 1 0 31103 1 0 32104 1 0 32105 1 0 33106 1 0 33107 1 0 34108 1 0 35109 1 0 35110 1 0 35111 1 0 36112 1 0 36113 1 0 37114 1 0 37115 1 0 38116 1 0 38117 1 0 39118 1 0 40119 1 0 40120 1 0 40121 1 0 41122 1 0 41123 1 0 42124 1 0 42125 1 0 43126 1 0 43127 1 0 44128 1 0 45129 1 0 45130 1 0 45131 1 0 46132 1 0 46133 1 0 46134 1 0 M END PDB for #<Metabolite:0x00007f46dcf49230>HEADER PROTEIN 25-APR-15 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 25-APR-15 0 HETATM 1 C UNK 0 34.293 21.339 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 35.626 22.109 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 35.626 23.649 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 36.960 21.339 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 38.294 22.109 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 39.627 21.339 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 40.961 22.109 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 40.961 23.649 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 42.295 21.339 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 43.628 22.109 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 44.962 21.339 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 46.296 22.109 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 46.296 23.649 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 47.629 21.339 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 48.963 22.109 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 50.297 21.339 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 51.630 22.109 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 51.630 23.649 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 52.964 21.339 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 54.298 22.109 0.000 0.00 0.00 C+0 HETATM 21 O UNK 0 55.632 21.339 0.000 0.00 0.00 O+0 HETATM 22 C UNK 0 56.965 22.109 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 58.299 21.339 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 58.299 19.799 0.000 0.00 0.00 C+0 HETATM 25 O UNK 0 59.633 19.029 0.000 0.00 0.00 O+0 HETATM 26 O UNK 0 59.633 22.109 0.000 0.00 0.00 O+0 HETATM 27 C UNK 0 60.966 21.339 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 62.300 22.109 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 63.634 21.339 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 63.634 19.799 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 64.967 22.109 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 66.301 21.339 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 67.635 22.109 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 68.968 21.339 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 68.968 19.799 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 70.302 22.109 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 71.636 21.339 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 72.969 22.109 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 74.303 21.339 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 74.303 19.799 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 75.637 22.109 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 76.970 21.339 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 78.304 22.109 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 79.638 21.339 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 80.971 22.109 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 79.638 19.799 0.000 0.00 0.00 C+0 CONECT 1 2 CONECT 2 1 3 4 CONECT 3 2 CONECT 4 2 5 CONECT 5 4 6 CONECT 6 5 7 CONECT 7 6 8 9 CONECT 8 7 CONECT 9 7 10 CONECT 10 9 11 CONECT 11 10 12 CONECT 12 11 13 14 CONECT 13 12 CONECT 14 12 15 CONECT 15 14 16 CONECT 16 15 17 CONECT 17 16 18 19 CONECT 18 17 CONECT 19 17 20 CONECT 20 19 21 CONECT 21 20 22 CONECT 22 21 23 CONECT 23 22 24 26 CONECT 24 23 25 CONECT 25 24 CONECT 26 23 27 CONECT 27 26 28 CONECT 28 27 29 CONECT 29 28 30 31 CONECT 30 29 CONECT 31 29 32 CONECT 32 31 33 CONECT 33 32 34 CONECT 34 33 35 36 CONECT 35 34 CONECT 36 34 37 CONECT 37 36 38 CONECT 38 37 39 CONECT 39 38 40 41 CONECT 40 39 CONECT 41 39 42 CONECT 42 41 43 CONECT 43 42 44 CONECT 44 43 45 46 CONECT 45 44 CONECT 46 44 MASTER 0 0 0 0 0 0 0 0 46 0 90 0 END 3D PDB for #<Metabolite:0x00007f46dcf49230>COMPND HMDB0245415 HETATM 1 C1 UNL 1 -14.217 -2.054 1.562 1.00 0.00 C HETATM 2 C2 UNL 1 -13.059 -2.531 2.422 1.00 0.00 C HETATM 3 C3 UNL 1 -12.908 -4.010 2.285 1.00 0.00 C HETATM 4 C4 UNL 1 -11.773 -1.781 2.021 1.00 0.00 C HETATM 5 C5 UNL 1 -11.440 -2.021 0.600 1.00 0.00 C HETATM 6 C6 UNL 1 -10.259 -1.271 0.123 1.00 0.00 C HETATM 7 C7 UNL 1 -8.949 -1.472 0.742 1.00 0.00 C HETATM 8 C8 UNL 1 -8.819 -1.159 2.204 1.00 0.00 C HETATM 9 C9 UNL 1 -7.890 -0.583 0.053 1.00 0.00 C HETATM 10 C10 UNL 1 -7.710 -0.874 -1.372 1.00 0.00 C HETATM 11 C11 UNL 1 -6.730 -0.099 -2.172 1.00 0.00 C HETATM 12 C12 UNL 1 -5.314 -0.199 -1.788 1.00 0.00 C HETATM 13 C13 UNL 1 -4.866 0.240 -0.455 1.00 0.00 C HETATM 14 C14 UNL 1 -4.412 0.218 -2.963 1.00 0.00 C HETATM 15 C15 UNL 1 -4.672 1.565 -3.454 1.00 0.00 C HETATM 16 C16 UNL 1 -4.427 2.796 -2.716 1.00 0.00 C HETATM 17 C17 UNL 1 -3.024 3.237 -2.461 1.00 0.00 C HETATM 18 C18 UNL 1 -2.318 3.428 -3.801 1.00 0.00 C HETATM 19 C19 UNL 1 -2.227 2.614 -1.407 1.00 0.00 C HETATM 20 C20 UNL 1 -0.815 3.257 -1.324 1.00 0.00 C HETATM 21 O1 UNL 1 -0.110 3.050 -2.451 1.00 0.00 O HETATM 22 C21 UNL 1 0.301 1.806 -2.795 1.00 0.00 C HETATM 23 C22 UNL 1 1.413 1.230 -1.976 1.00 0.00 C HETATM 24 C23 UNL 1 1.683 -0.198 -2.476 1.00 0.00 C HETATM 25 O2 UNL 1 2.012 -0.240 -3.805 1.00 0.00 O HETATM 26 O3 UNL 1 1.111 1.170 -0.646 1.00 0.00 O HETATM 27 C24 UNL 1 2.063 1.925 0.095 1.00 0.00 C HETATM 28 C25 UNL 1 1.774 1.787 1.557 1.00 0.00 C HETATM 29 C26 UNL 1 1.964 0.455 2.153 1.00 0.00 C HETATM 30 C27 UNL 1 1.190 -0.677 1.494 1.00 0.00 C HETATM 31 C28 UNL 1 3.152 0.080 2.926 1.00 0.00 C HETATM 32 C29 UNL 1 4.537 0.138 2.410 1.00 0.00 C HETATM 33 C30 UNL 1 5.061 1.486 2.132 1.00 0.00 C HETATM 34 C31 UNL 1 6.451 1.648 1.624 1.00 0.00 C HETATM 35 C32 UNL 1 6.590 3.214 1.342 1.00 0.00 C HETATM 36 C33 UNL 1 7.509 1.449 2.632 1.00 0.00 C HETATM 37 C34 UNL 1 7.714 0.196 3.350 1.00 0.00 C HETATM 38 C35 UNL 1 7.968 -1.053 2.597 1.00 0.00 C HETATM 39 C36 UNL 1 9.170 -1.140 1.737 1.00 0.00 C HETATM 40 C37 UNL 1 10.473 -0.932 2.470 1.00 0.00 C HETATM 41 C38 UNL 1 9.052 -0.472 0.427 1.00 0.00 C HETATM 42 C39 UNL 1 10.303 -0.582 -0.426 1.00 0.00 C HETATM 43 C40 UNL 1 10.677 -2.033 -0.719 1.00 0.00 C HETATM 44 C41 UNL 1 11.938 -2.067 -1.586 1.00 0.00 C HETATM 45 C42 UNL 1 11.726 -1.366 -2.906 1.00 0.00 C HETATM 46 C43 UNL 1 12.421 -3.468 -1.687 1.00 0.00 C HETATM 47 H1 UNL 1 -14.332 -2.672 0.630 1.00 0.00 H HETATM 48 H2 UNL 1 -14.189 -0.974 1.364 1.00 0.00 H HETATM 49 H3 UNL 1 -15.152 -2.232 2.145 1.00 0.00 H HETATM 50 H4 UNL 1 -13.292 -2.289 3.478 1.00 0.00 H HETATM 51 H5 UNL 1 -11.839 -4.281 2.392 1.00 0.00 H HETATM 52 H6 UNL 1 -13.302 -4.294 1.289 1.00 0.00 H HETATM 53 H7 UNL 1 -13.444 -4.509 3.120 1.00 0.00 H HETATM 54 H8 UNL 1 -11.015 -2.175 2.734 1.00 0.00 H HETATM 55 H9 UNL 1 -11.946 -0.720 2.261 1.00 0.00 H HETATM 56 H10 UNL 1 -11.426 -3.105 0.328 1.00 0.00 H HETATM 57 H11 UNL 1 -12.323 -1.624 -0.004 1.00 0.00 H HETATM 58 H12 UNL 1 -10.145 -1.410 -1.000 1.00 0.00 H HETATM 59 H13 UNL 1 -10.541 -0.170 0.186 1.00 0.00 H HETATM 60 H14 UNL 1 -8.549 -2.518 0.596 1.00 0.00 H HETATM 61 H15 UNL 1 -7.826 -0.618 2.340 1.00 0.00 H HETATM 62 H16 UNL 1 -8.707 -2.043 2.861 1.00 0.00 H HETATM 63 H17 UNL 1 -9.550 -0.405 2.563 1.00 0.00 H HETATM 64 H18 UNL 1 -8.335 0.466 0.144 1.00 0.00 H HETATM 65 H19 UNL 1 -7.001 -0.536 0.694 1.00 0.00 H HETATM 66 H20 UNL 1 -7.548 -1.990 -1.466 1.00 0.00 H HETATM 67 H21 UNL 1 -8.715 -0.741 -1.886 1.00 0.00 H HETATM 68 H22 UNL 1 -7.108 0.972 -2.149 1.00 0.00 H HETATM 69 H23 UNL 1 -6.818 -0.388 -3.259 1.00 0.00 H HETATM 70 H24 UNL 1 -5.117 -1.349 -1.786 1.00 0.00 H HETATM 71 H25 UNL 1 -5.457 1.039 0.035 1.00 0.00 H HETATM 72 H26 UNL 1 -4.831 -0.612 0.306 1.00 0.00 H HETATM 73 H27 UNL 1 -3.764 0.529 -0.449 1.00 0.00 H HETATM 74 H28 UNL 1 -3.386 -0.037 -2.652 1.00 0.00 H HETATM 75 H29 UNL 1 -4.654 -0.492 -3.808 1.00 0.00 H HETATM 76 H30 UNL 1 -4.053 1.652 -4.428 1.00 0.00 H HETATM 77 H31 UNL 1 -5.726 1.545 -3.917 1.00 0.00 H HETATM 78 H32 UNL 1 -5.028 2.891 -1.767 1.00 0.00 H HETATM 79 H33 UNL 1 -4.871 3.642 -3.344 1.00 0.00 H HETATM 80 H34 UNL 1 -3.156 4.342 -2.115 1.00 0.00 H HETATM 81 H35 UNL 1 -1.599 4.237 -3.730 1.00 0.00 H HETATM 82 H36 UNL 1 -3.141 3.838 -4.471 1.00 0.00 H HETATM 83 H37 UNL 1 -2.015 2.502 -4.281 1.00 0.00 H HETATM 84 H38 UNL 1 -1.992 1.540 -1.548 1.00 0.00 H HETATM 85 H39 UNL 1 -2.663 2.732 -0.405 1.00 0.00 H HETATM 86 H40 UNL 1 -0.436 2.913 -0.363 1.00 0.00 H HETATM 87 H41 UNL 1 -0.977 4.368 -1.196 1.00 0.00 H HETATM 88 H42 UNL 1 0.729 1.898 -3.849 1.00 0.00 H HETATM 89 H43 UNL 1 -0.534 1.077 -2.941 1.00 0.00 H HETATM 90 H44 UNL 1 2.360 1.830 -2.108 1.00 0.00 H HETATM 91 H45 UNL 1 0.729 -0.791 -2.372 1.00 0.00 H HETATM 92 H46 UNL 1 2.468 -0.700 -1.888 1.00 0.00 H HETATM 93 H47 UNL 1 1.753 -1.103 -4.237 1.00 0.00 H HETATM 94 H48 UNL 1 1.917 2.977 -0.195 1.00 0.00 H HETATM 95 H49 UNL 1 3.046 1.627 -0.256 1.00 0.00 H HETATM 96 H50 UNL 1 2.277 2.553 2.171 1.00 0.00 H HETATM 97 H51 UNL 1 0.666 2.114 1.638 1.00 0.00 H HETATM 98 H52 UNL 1 1.175 0.588 3.114 1.00 0.00 H HETATM 99 H53 UNL 1 1.772 -1.187 0.717 1.00 0.00 H HETATM 100 H54 UNL 1 0.200 -0.307 1.185 1.00 0.00 H HETATM 101 H55 UNL 1 1.016 -1.445 2.286 1.00 0.00 H HETATM 102 H56 UNL 1 3.185 0.685 3.911 1.00 0.00 H HETATM 103 H57 UNL 1 3.012 -1.001 3.322 1.00 0.00 H HETATM 104 H58 UNL 1 5.164 -0.473 3.096 1.00 0.00 H HETATM 105 H59 UNL 1 4.634 -0.448 1.430 1.00 0.00 H HETATM 106 H60 UNL 1 4.395 2.038 1.450 1.00 0.00 H HETATM 107 H61 UNL 1 4.934 2.073 3.112 1.00 0.00 H HETATM 108 H62 UNL 1 6.587 1.212 0.640 1.00 0.00 H HETATM 109 H63 UNL 1 6.425 3.669 2.322 1.00 0.00 H HETATM 110 H64 UNL 1 7.600 3.393 0.990 1.00 0.00 H HETATM 111 H65 UNL 1 5.778 3.498 0.666 1.00 0.00 H HETATM 112 H66 UNL 1 7.215 2.211 3.479 1.00 0.00 H HETATM 113 H67 UNL 1 8.473 1.938 2.301 1.00 0.00 H HETATM 114 H68 UNL 1 6.974 0.037 4.154 1.00 0.00 H HETATM 115 H69 UNL 1 8.665 0.408 4.004 1.00 0.00 H HETATM 116 H70 UNL 1 7.086 -1.307 1.956 1.00 0.00 H HETATM 117 H71 UNL 1 7.968 -1.897 3.360 1.00 0.00 H HETATM 118 H72 UNL 1 9.230 -2.273 1.468 1.00 0.00 H HETATM 119 H73 UNL 1 11.352 -0.887 1.833 1.00 0.00 H HETATM 120 H74 UNL 1 10.534 -1.661 3.300 1.00 0.00 H HETATM 121 H75 UNL 1 10.394 0.072 2.975 1.00 0.00 H HETATM 122 H76 UNL 1 8.855 0.614 0.490 1.00 0.00 H HETATM 123 H77 UNL 1 8.222 -0.879 -0.201 1.00 0.00 H HETATM 124 H78 UNL 1 10.006 -0.163 -1.436 1.00 0.00 H HETATM 125 H79 UNL 1 11.140 0.027 -0.078 1.00 0.00 H HETATM 126 H80 UNL 1 10.919 -2.582 0.206 1.00 0.00 H HETATM 127 H81 UNL 1 9.875 -2.496 -1.338 1.00 0.00 H HETATM 128 H82 UNL 1 12.686 -1.456 -0.988 1.00 0.00 H HETATM 129 H83 UNL 1 10.721 -1.587 -3.351 1.00 0.00 H HETATM 130 H84 UNL 1 11.804 -0.274 -2.768 1.00 0.00 H HETATM 131 H85 UNL 1 12.548 -1.668 -3.591 1.00 0.00 H HETATM 132 H86 UNL 1 13.152 -3.652 -0.849 1.00 0.00 H HETATM 133 H87 UNL 1 11.567 -4.165 -1.523 1.00 0.00 H HETATM 134 H88 UNL 1 12.983 -3.688 -2.619 1.00 0.00 H CONECT 1 2 47 48 49 CONECT 2 3 4 50 CONECT 3 51 52 53 CONECT 4 5 54 55 CONECT 5 6 56 57 CONECT 6 7 58 59 CONECT 7 8 9 60 CONECT 8 61 62 63 CONECT 9 10 64 65 CONECT 10 11 66 67 CONECT 11 12 68 69 CONECT 12 13 14 70 CONECT 13 71 72 73 CONECT 14 15 74 75 CONECT 15 16 76 77 CONECT 16 17 78 79 CONECT 17 18 19 80 CONECT 18 81 82 83 CONECT 19 20 84 85 CONECT 20 21 86 87 CONECT 21 22 CONECT 22 23 88 89 CONECT 23 24 26 90 CONECT 24 25 91 92 CONECT 25 93 CONECT 26 27 CONECT 27 28 94 95 CONECT 28 29 96 97 CONECT 29 30 31 98 CONECT 30 99 100 101 CONECT 31 32 102 103 CONECT 32 33 104 105 CONECT 33 34 106 107 CONECT 34 35 36 108 CONECT 35 109 110 111 CONECT 36 37 112 113 CONECT 37 38 114 115 CONECT 38 39 116 117 CONECT 39 40 41 118 CONECT 40 119 120 121 CONECT 41 42 122 123 CONECT 42 43 124 125 CONECT 43 44 126 127 CONECT 44 45 46 128 CONECT 45 129 130 131 CONECT 46 132 133 134 END SMILES for #<Metabolite:0x00007f46dcf49230>CC(C)CCCC(C)CCCC(C)CCCC(C)CCOCC(CO)OCCC(C)CCCC(C)CCCC(C)CCCC(C)C INCHI for #<Metabolite:0x00007f46dcf49230>InChI=1S/C43H88O3/c1-35(2)17-11-19-37(5)21-13-23-39(7)25-15-27-41(9)29-31-45-34-43(33-44)46-32-30-42(10)28-16-26-40(8)24-14-22-38(6)20-12-18-36(3)4/h35-44H,11-34H2,1-10H3 3D Structure for #<Metabolite:0x00007f46dcf49230> | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Formula | C43H88O3 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 653.174 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 652.673346694 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2,3-bis[(3,7,11,15-tetramethylhexadecyl)oxy]propan-1-ol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | archaeol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCOCC(CO)OCCC(C)CCCC(C)CCCC(C)CCCC(C)C | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C43H88O3/c1-35(2)17-11-19-37(5)21-13-23-39(7)25-15-27-41(9)29-31-45-34-43(33-44)46-32-30-42(10)28-16-26-40(8)24-14-22-38(6)20-12-18-36(3)4/h35-44H,11-34H2,1-10H3 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | ISDBCJSGCHUHFI-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as acyclic diterpenoids. These are diterpenoids (compounds made of four consecutive isoprene units) that do not contain a cycle. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Diterpenoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Acyclic diterpenoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic acyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Functional Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Expected Solid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Proteins and Enzymes | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Pathways | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolic Reactions | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Health Effects and Bioactivity | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Microbial Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Exposure Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Host Biospecimen and Location | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0245415 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 369565 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Archaeol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 417493 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|