Showing metabocard for 3',4'-Epoxymonoanhydrobacterioruberin (MMDBc0013159)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 1.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected and Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-05-15 04:31:07 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-08-31 06:35:37 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite ID | MMDBc0013159 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | 3',4'-Epoxymonoanhydrobacterioruberin | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | 3',4'-Epoxymonoanhydrobacterioruberin belongs to the class of organic compounds known as sesquaterpenoids. These are terpenoids with at least 7 consecutive isoprene units. 3',4'-Epoxymonoanhydrobacterioruberin is an extremely weak basic (essentially neutral) compound (based on its pKa). | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for #<Metabolite:0x00007fed17d23938>Mrv1652305152106312D 76 76 0 0 1 0 999 V2000 -1.9053 2.9513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1908 4.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6520 -7.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6520 -3.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0809 -10.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2230 -1.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5098 -12.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0796 0.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5111 -13.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3842 -12.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6533 -15.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4783 -14.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6671 2.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3651 1.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6520 -6.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6520 -5.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0809 -8.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2230 -2.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5098 -10.9632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0796 -1.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3664 -6.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9375 -4.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0809 -7.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2230 -3.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7954 -8.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5085 -2.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5098 -10.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2243 -11.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7941 -1.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3651 -1.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4763 2.9513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9388 -12.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9388 -13.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4763 2.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3677 -13.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0822 -13.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1908 3.3638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3664 -7.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9375 -3.9507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7954 -9.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5085 -1.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2243 -12.2007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3651 -0.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6533 -13.8507 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2382 1.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6507 0.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2382 0.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7967 -13.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6533 -14.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9526 2.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2092 -14.1526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8283 -14.6757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5401 2.8408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1743 0.1743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9375 -6.4257 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3664 -4.7757 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3664 -8.9007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9375 -2.3007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7954 -11.3757 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0796 -2.3007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0809 -6.0132 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2230 -5.1882 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7954 -7.2507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5085 -3.9507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5098 -8.4882 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7941 -2.7132 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2243 -9.7257 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9388 -10.9632 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7941 -0.2382 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6507 -1.4757 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6533 -12.2007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2243 -13.8507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6533 -13.0257 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4763 1.3013 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2340 0.7577 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0350 1.1023 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 16 15 2 0 0 0 0 21 15 1 0 0 0 0 22 16 1 0 0 0 0 23 17 2 0 0 0 0 24 18 2 0 0 0 0 25 17 1 0 0 0 0 26 18 1 0 0 0 0 27 19 2 0 0 0 0 28 19 1 0 0 0 0 29 20 2 0 0 0 0 30 20 1 0 0 0 0 33 32 2 0 0 0 0 34 31 1 0 0 0 0 36 35 1 0 0 0 0 37 1 1 0 0 0 0 37 2 1 0 0 0 0 37 31 2 0 0 0 0 38 3 1 0 0 0 0 38 21 2 0 0 0 0 38 23 1 0 0 0 0 39 4 1 0 0 0 0 39 22 2 0 0 0 0 39 24 1 0 0 0 0 40 5 1 0 0 0 0 40 25 2 0 0 0 0 40 27 1 0 0 0 0 41 6 1 0 0 0 0 41 26 2 0 0 0 0 41 29 1 0 0 0 0 42 7 1 0 0 0 0 42 28 2 0 0 0 0 42 32 1 0 0 0 0 43 8 1 0 0 0 0 43 30 2 0 0 0 0 44 33 1 6 0 0 0 44 35 1 0 0 0 0 45 34 1 0 0 0 0 46 43 1 0 0 0 0 47 45 1 0 0 0 0 47 46 1 0 0 0 0 48 9 1 0 0 0 0 48 10 1 0 0 0 0 48 36 1 0 0 0 0 49 11 1 0 0 0 0 49 12 1 0 0 0 0 49 44 1 0 0 0 0 50 13 1 0 0 0 0 50 14 1 0 0 0 0 50 45 1 0 0 0 0 51 48 1 0 0 0 0 52 49 1 0 0 0 0 53 50 1 0 0 0 0 54 46 1 0 0 0 0 54 47 1 0 0 0 0 55 15 1 0 0 0 0 56 16 1 0 0 0 0 57 17 1 0 0 0 0 58 18 1 0 0 0 0 59 19 1 0 0 0 0 60 20 1 0 0 0 0 61 21 1 0 0 0 0 62 22 1 0 0 0 0 63 23 1 0 0 0 0 64 24 1 0 0 0 0 65 25 1 0 0 0 0 66 26 1 0 0 0 0 67 27 1 0 0 0 0 68 28 1 0 0 0 0 69 29 1 0 0 0 0 70 30 1 0 0 0 0 71 32 1 0 0 0 0 72 33 1 0 0 0 0 44 73 1 1 0 0 0 74 45 1 0 0 0 0 75 46 1 0 0 0 0 76 47 1 0 0 0 0 M END 3D SDF for #<Metabolite:0x00007fed17d23938>Mrv1652305152106312D 76 76 0 0 1 0 999 V2000 -1.9053 2.9513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1908 4.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6520 -7.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6520 -3.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0809 -10.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2230 -1.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5098 -12.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0796 0.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5111 -13.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3842 -12.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6533 -15.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4783 -14.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6671 2.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3651 1.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6520 -6.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6520 -5.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0809 -8.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2230 -2.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5098 -10.9632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0796 -1.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3664 -6.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9375 -4.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0809 -7.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2230 -3.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7954 -8.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5085 -2.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5098 -10.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2243 -11.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7941 -1.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3651 -1.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4763 2.9513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9388 -12.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9388 -13.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4763 2.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3677 -13.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0822 -13.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1908 3.3638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3664 -7.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9375 -3.9507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7954 -9.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5085 -1.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2243 -12.2007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3651 -0.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6533 -13.8507 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2382 1.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6507 0.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2382 0.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7967 -13.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6533 -14.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9526 2.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2092 -14.1526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8283 -14.6757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5401 2.8408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1743 0.1743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9375 -6.4257 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3664 -4.7757 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3664 -8.9007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9375 -2.3007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7954 -11.3757 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0796 -2.3007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0809 -6.0132 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2230 -5.1882 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7954 -7.2507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5085 -3.9507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5098 -8.4882 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7941 -2.7132 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2243 -9.7257 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9388 -10.9632 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7941 -0.2382 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6507 -1.4757 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6533 -12.2007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2243 -13.8507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6533 -13.0257 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4763 1.3013 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2340 0.7577 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0350 1.1023 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 16 15 2 0 0 0 0 21 15 1 0 0 0 0 22 16 1 0 0 0 0 23 17 2 0 0 0 0 24 18 2 0 0 0 0 25 17 1 0 0 0 0 26 18 1 0 0 0 0 27 19 2 0 0 0 0 28 19 1 0 0 0 0 29 20 2 0 0 0 0 30 20 1 0 0 0 0 33 32 2 0 0 0 0 34 31 1 0 0 0 0 36 35 1 0 0 0 0 37 1 1 0 0 0 0 37 2 1 0 0 0 0 37 31 2 0 0 0 0 38 3 1 0 0 0 0 38 21 2 0 0 0 0 38 23 1 0 0 0 0 39 4 1 0 0 0 0 39 22 2 0 0 0 0 39 24 1 0 0 0 0 40 5 1 0 0 0 0 40 25 2 0 0 0 0 40 27 1 0 0 0 0 41 6 1 0 0 0 0 41 26 2 0 0 0 0 41 29 1 0 0 0 0 42 7 1 0 0 0 0 42 28 2 0 0 0 0 42 32 1 0 0 0 0 43 8 1 0 0 0 0 43 30 2 0 0 0 0 44 33 1 6 0 0 0 44 35 1 0 0 0 0 45 34 1 0 0 0 0 46 43 1 0 0 0 0 47 45 1 0 0 0 0 47 46 1 0 0 0 0 48 9 1 0 0 0 0 48 10 1 0 0 0 0 48 36 1 0 0 0 0 49 11 1 0 0 0 0 49 12 1 0 0 0 0 49 44 1 0 0 0 0 50 13 1 0 0 0 0 50 14 1 0 0 0 0 50 45 1 0 0 0 0 51 48 1 0 0 0 0 52 49 1 0 0 0 0 53 50 1 0 0 0 0 54 46 1 0 0 0 0 54 47 1 0 0 0 0 55 15 1 0 0 0 0 56 16 1 0 0 0 0 57 17 1 0 0 0 0 58 18 1 0 0 0 0 59 19 1 0 0 0 0 60 20 1 0 0 0 0 61 21 1 0 0 0 0 62 22 1 0 0 0 0 63 23 1 0 0 0 0 64 24 1 0 0 0 0 65 25 1 0 0 0 0 66 26 1 0 0 0 0 67 27 1 0 0 0 0 68 28 1 0 0 0 0 69 29 1 0 0 0 0 70 30 1 0 0 0 0 71 32 1 0 0 0 0 72 33 1 0 0 0 0 44 73 1 1 0 0 0 74 45 1 0 0 0 0 75 46 1 0 0 0 0 76 47 1 0 0 0 0 M END > <DATABASE_ID> MMDBc0013159 > <DATABASE_NAME> MIME > <SMILES> [H]/C(=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])\C(\[H])=C(/C)C1([H])OC1([H])C([H])(CC=C(C)C)C(C)(C)O)/C(/[H])=C(\C)/C(/[H])=C(\[H])/C(/[H])=C(\C)/C(/[H])=C(\[H])/C(/[H])=C(\C)/C(/[H])=C(\[H])[C@]([H])(CCC(C)(C)O)C(C)(C)O > <INCHI_IDENTIFIER> InChI=1S/C50H74O4/c1-37(2)31-34-45(50(13,14)53)47-46(54-47)43(8)30-20-29-41(6)26-18-24-39(4)22-16-15-21-38(3)23-17-25-40(5)27-19-28-42(7)32-33-44(49(11,12)52)35-36-48(9,10)51/h15-33,44-47,51-53H,34-36H2,1-14H3/b16-15+,23-17+,24-18+,27-19+,29-20+,33-32+,38-21+,39-22+,40-25+,41-26+,42-28+,43-30+/t44-,45?,46?,47?/m1/s1 > <INCHI_KEY> HKXMBXXNJAICIG-TVOYLSQCSA-N > <FORMULA> C50H74O4 > <MOLECULAR_WEIGHT> 739.138 > <EXACT_MASS> 738.558710863 > <JCHEM_ACCEPTOR_COUNT> 4 > <JCHEM_ATOM_COUNT> 128 > <JCHEM_AVERAGE_POLARIZABILITY> 96.19186720445573 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 3 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> (3S)-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-24-[3-(2-hydroxy-2,6-dimethylhept-5-en-3-yl)oxiran-2-yl]-3,7,11,16,20-pentamethylpentacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaen-1-yl]-2,6-dimethylheptane-2,6-diol > <ALOGPS_LOGP> 8.58 > <JCHEM_LOGP> 10.431087049666669 > <ALOGPS_LOGS> -6.28 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 1 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 18.518142973357126 > <JCHEM_PKA_STRONGEST_ACIDIC> 14.971711733947586 > <JCHEM_PKA_STRONGEST_BASIC> -0.756050777557424 > <JCHEM_POLAR_SURFACE_AREA> 73.22 > <JCHEM_REFRACTIVITY> 248.49540000000005 > <JCHEM_ROTATABLE_BOND_COUNT> 21 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 3.87e-04 g/l > <JCHEM_TRADITIONAL_IUPAC> (3S)-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-24-[3-(2-hydroxy-2,6-dimethylhept-5-en-3-yl)oxiran-2-yl]-3,7,11,16,20-pentamethylpentacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaen-1-yl]-2,6-dimethylheptane-2,6-diol > <JCHEM_VEBER_RULE> 0 $$$$ PDB for #<Metabolite:0x00007fed17d23938>HEADER PROTEIN 15-MAY-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 15-MAY-21 0 HETATM 1 C UNK 0 -3.556 5.509 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -2.223 7.819 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 10.550 -14.305 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 10.550 -6.605 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 13.218 -18.925 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 7.883 -1.985 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 15.885 -23.545 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 3.882 0.325 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 25.221 -24.315 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 23.117 -23.751 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 19.886 -28.935 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 21.426 -27.395 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 3.112 4.739 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 2.548 2.635 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 10.550 -11.225 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 10.550 -9.685 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 13.218 -15.845 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 7.883 -5.065 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 15.885 -20.465 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 3.882 -2.755 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 11.884 -11.995 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 9.217 -8.915 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 13.218 -14.305 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 7.883 -6.605 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 14.551 -16.615 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 6.549 -4.295 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 15.885 -18.925 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 17.219 -21.235 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 5.216 -1.985 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 2.548 -1.985 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -0.889 5.509 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 18.552 -23.545 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 18.552 -25.085 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 -0.889 3.969 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 21.220 -25.085 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 22.553 -25.855 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 -2.223 6.279 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 11.884 -13.535 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 9.217 -7.375 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 14.551 -18.155 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 6.549 -2.755 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 17.219 -22.775 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 2.548 -0.445 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 19.886 -25.855 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 0.445 3.199 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 1.215 0.325 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 0.445 1.659 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 23.887 -25.085 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 19.886 -27.395 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 1.778 3.969 0.000 0.00 0.00 C+0 HETATM 51 O UNK 0 24.657 -26.418 0.000 0.00 0.00 O+0 HETATM 52 O UNK 0 18.346 -27.395 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 1.008 5.303 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 -0.325 0.325 0.000 0.00 0.00 O+0 HETATM 55 H UNK 0 9.217 -11.995 0.000 0.00 0.00 H+0 HETATM 56 H UNK 0 11.884 -8.915 0.000 0.00 0.00 H+0 HETATM 57 H UNK 0 11.884 -16.615 0.000 0.00 0.00 H+0 HETATM 58 H UNK 0 9.217 -4.295 0.000 0.00 0.00 H+0 HETATM 59 H UNK 0 14.551 -21.235 0.000 0.00 0.00 H+0 HETATM 60 H UNK 0 3.882 -4.295 0.000 0.00 0.00 H+0 HETATM 61 H UNK 0 13.218 -11.225 0.000 0.00 0.00 H+0 HETATM 62 H UNK 0 7.883 -9.685 0.000 0.00 0.00 H+0 HETATM 63 H UNK 0 14.551 -13.535 0.000 0.00 0.00 H+0 HETATM 64 H UNK 0 6.549 -7.375 0.000 0.00 0.00 H+0 HETATM 65 H UNK 0 15.885 -15.845 0.000 0.00 0.00 H+0 HETATM 66 H UNK 0 5.216 -5.065 0.000 0.00 0.00 H+0 HETATM 67 H UNK 0 17.219 -18.155 0.000 0.00 0.00 H+0 HETATM 68 H UNK 0 18.552 -20.465 0.000 0.00 0.00 H+0 HETATM 69 H UNK 0 5.216 -0.445 0.000 0.00 0.00 H+0 HETATM 70 H UNK 0 1.215 -2.755 0.000 0.00 0.00 H+0 HETATM 71 H UNK 0 19.886 -22.775 0.000 0.00 0.00 H+0 HETATM 72 H UNK 0 17.219 -25.855 0.000 0.00 0.00 H+0 HETATM 73 H UNK 0 19.886 -24.315 0.000 0.00 0.00 H+0 HETATM 74 H UNK 0 -0.889 2.429 0.000 0.00 0.00 H+0 HETATM 75 H UNK 0 2.304 1.414 0.000 0.00 0.00 H+0 HETATM 76 H UNK 0 1.932 2.058 0.000 0.00 0.00 H+0 CONECT 1 37 CONECT 2 37 CONECT 3 38 CONECT 4 39 CONECT 5 40 CONECT 6 41 CONECT 7 42 CONECT 8 43 CONECT 9 48 CONECT 10 48 CONECT 11 49 CONECT 12 49 CONECT 13 50 CONECT 14 50 CONECT 15 16 21 55 CONECT 16 15 22 56 CONECT 17 23 25 57 CONECT 18 24 26 58 CONECT 19 27 28 59 CONECT 20 29 30 60 CONECT 21 15 38 61 CONECT 22 16 39 62 CONECT 23 17 38 63 CONECT 24 18 39 64 CONECT 25 17 40 65 CONECT 26 18 41 66 CONECT 27 19 40 67 CONECT 28 19 42 68 CONECT 29 20 41 69 CONECT 30 20 43 70 CONECT 31 34 37 CONECT 32 33 42 71 CONECT 33 32 44 72 CONECT 34 31 45 CONECT 35 36 44 CONECT 36 35 48 CONECT 37 1 2 31 CONECT 38 3 21 23 CONECT 39 4 22 24 CONECT 40 5 25 27 CONECT 41 6 26 29 CONECT 42 7 28 32 CONECT 43 8 30 46 CONECT 44 33 35 49 73 CONECT 45 34 47 50 74 CONECT 46 43 47 54 75 CONECT 47 45 46 54 76 CONECT 48 9 10 36 51 CONECT 49 11 12 44 52 CONECT 50 13 14 45 53 CONECT 51 48 CONECT 52 49 CONECT 53 50 CONECT 54 46 47 CONECT 55 15 CONECT 56 16 CONECT 57 17 CONECT 58 18 CONECT 59 19 CONECT 60 20 CONECT 61 21 CONECT 62 22 CONECT 63 23 CONECT 64 24 CONECT 65 25 CONECT 66 26 CONECT 67 27 CONECT 68 28 CONECT 69 29 CONECT 70 30 CONECT 71 32 CONECT 72 33 CONECT 73 44 CONECT 74 45 CONECT 75 46 CONECT 76 47 MASTER 0 0 0 0 0 0 0 0 76 0 152 0 END SMILES for #<Metabolite:0x00007fed17d23938>[H]/C(=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])\C(\[H])=C(/C)C1([H])OC1([H])C([H])(CC=C(C)C)C(C)(C)O)/C(/[H])=C(\C)/C(/[H])=C(\[H])/C(/[H])=C(\C)/C(/[H])=C(\[H])/C(/[H])=C(\C)/C(/[H])=C(\[H])[C@]([H])(CCC(C)(C)O)C(C)(C)O INCHI for #<Metabolite:0x00007fed17d23938>InChI=1S/C50H74O4/c1-37(2)31-34-45(50(13,14)53)47-46(54-47)43(8)30-20-29-41(6)26-18-24-39(4)22-16-15-21-38(3)23-17-25-40(5)27-19-28-42(7)32-33-44(49(11,12)52)35-36-48(9,10)51/h15-33,44-47,51-53H,34-36H2,1-14H3/b16-15+,23-17+,24-18+,27-19+,29-20+,33-32+,38-21+,39-22+,40-25+,41-26+,42-28+,43-30+/t44-,45?,46?,47?/m1/s1 3D Structure for #<Metabolite:0x00007fed17d23938> | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Formula | C50H74O4 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 739.138 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 738.558710863 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | (3S)-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-24-[3-(2-hydroxy-2,6-dimethylhept-5-en-3-yl)oxiran-2-yl]-3,7,11,16,20-pentamethylpentacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaen-1-yl]-2,6-dimethylheptane-2,6-diol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | (3S)-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-24-[3-(2-hydroxy-2,6-dimethylhept-5-en-3-yl)oxiran-2-yl]-3,7,11,16,20-pentamethylpentacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaen-1-yl]-2,6-dimethylheptane-2,6-diol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | [H]/C(=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])\C(\[H])=C(/C)C1([H])OC1([H])C([H])(CC=C(C)C)C(C)(C)O)/C(/[H])=C(\C)/C(/[H])=C(\[H])/C(/[H])=C(\C)/C(/[H])=C(\[H])/C(/[H])=C(\C)/C(/[H])=C(\[H])[C@]([H])(CCC(C)(C)O)C(C)(C)O | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C50H74O4/c1-37(2)31-34-45(50(13,14)53)47-46(54-47)43(8)30-20-29-41(6)26-18-24-39(4)22-16-15-21-38(3)23-17-25-40(5)27-19-28-42(7)32-33-44(49(11,12)52)35-36-48(9,10)51/h15-33,44-47,51-53H,34-36H2,1-14H3/b16-15+,23-17+,24-18+,27-19+,29-20+,33-32+,38-21+,39-22+,40-25+,41-26+,42-28+,43-30+/t44-,45?,46?,47?/m1/s1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | HKXMBXXNJAICIG-TVOYLSQCSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as sesquaterpenoids. These are terpenoids with at least 7 consecutive isoprene units. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Sesquaterpenoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Sesquaterpenoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteromonocyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Functional Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Expected Solid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Proteins and Enzymes | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Pathways | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolic Reactions | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Health Effects and Bioactivity | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Microbial Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Exposure Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Host Biospecimen and Location | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 78443785 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 139586656 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|