Showing metabocard for PE-NMe(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) (MMDBc0047619)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 1.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected and Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-11-19 15:34:28 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-09-01 01:47:16 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite ID | MMDBc0047619 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | PE-NMe(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | PE-NMe(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) is a monomethylphosphatidylethanolamine. It is a glycerophospholipid, and is formed by sequential methylation of phosphatidylethanolamine as part of a mechanism for biosynthesis of phosphatidylcholine. Monomethylphosphatidylethanolamines are usually found at trace levels in animal or plant tissues. They can have many different combinations of fatty acids of varying lengths and saturation attached at the C-1 and C-2 positions. PE-NMe(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)), in particular, consists of two 5Z,8Z,11Z,14Z-eicosatetraenoyl chain at positions C-1 and C2. Fatty acids containing 16, 18 and 20 carbons are the most common. Phospholipids, are ubiquitous in nature and are key components of the lipid bilayer of cells, as well as being involved in metabolism and signaling. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for #<Metabolite:0x00005634c2abf8b8>PE-NMe(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) Mrv1652309151723572D 57 56 0 0 1 0 999 V2000 29.3976 11.9444 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 29.4018 10.9029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.3643 11.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.6161 10.9919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 30.1970 11.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 31.0560 10.8436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 32.0595 10.8436 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 32.0595 11.6686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 32.0893 10.0186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 32.8845 10.8138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 33.6839 11.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.4494 10.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 35.2016 11.3100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 35.9964 10.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 29.3976 9.6271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 26.9360 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 26.9360 12.2303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 26.2219 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.5077 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.7936 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.0795 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.2545 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.5404 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.8263 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.0013 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.2872 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.5731 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.7481 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.0340 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.3198 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4948 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7807 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0666 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.3525 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6384 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9243 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.7844 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.7844 8.3036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 28.0703 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.3562 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 26.6421 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.9280 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.1030 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.3889 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.6748 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.8498 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.1357 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.4215 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.5965 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.8824 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.1683 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.3434 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.6292 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.9151 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.2010 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.4869 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7727 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 2 3 1 0 0 0 0 2 5 1 0 0 0 0 2 15 1 0 0 0 0 3 4 1 0 0 0 0 4 16 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 7 9 2 0 0 0 0 7 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 15 37 1 0 0 0 0 16 17 2 0 0 0 0 16 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 2 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 2 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 2 0 0 0 0 31 32 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 37 38 2 0 0 0 0 37 39 1 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 41 42 1 0 0 0 0 42 43 2 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 2 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 2 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 2 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 M END 3D MOL for #<Metabolite:0x00005634c2abf8b8>HMDB0112976 RDKit 3D PE-NMe(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) 132131 0 0 0 0 0 0 0 0999 V2000 -2.0832 0.5748 -1.8459 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1271 -0.4522 -1.2810 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2714 -0.1975 -1.8092 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2980 -1.1555 -1.3406 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4984 -1.1802 0.1788 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5416 -2.1561 0.5263 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3655 -3.1717 1.3342 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1131 -3.5092 2.0379 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3253 -3.6289 3.4929 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8027 -2.9044 4.4594 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0963 -1.8039 4.2466 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0942 -0.4914 4.7872 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0072 0.0150 5.5330 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1897 -0.6547 6.0520 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4287 0.1474 5.9652 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5190 -0.0391 5.3390 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8102 -1.2105 4.4577 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2641 -0.5797 3.0982 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1846 0.3383 2.6480 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5887 1.0217 1.3896 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2560 2.0898 1.4994 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2835 0.5759 0.1489 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5635 1.1137 -1.0864 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9824 2.4974 -1.2339 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1198 2.9132 -2.6913 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4417 2.0237 -3.5242 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5516 2.4227 -5.1459 P 0 0 0 0 0 5 0 0 0 0 0 0 4.9516 2.5678 -5.6420 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7196 3.8826 -5.3830 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7380 1.2407 -6.0419 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1205 -0.0421 -5.6499 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4215 -1.1209 -6.4071 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6556 -1.0727 -7.8369 N 0 0 0 0 0 0 0 0 0 0 0 0 1.9184 -2.1817 -8.4406 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5886 2.4927 -0.8916 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0959 3.3939 0.0099 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9448 4.2300 0.4810 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7082 3.5248 0.5103 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4938 4.8560 1.1382 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8406 5.1135 1.7624 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0786 4.2311 2.9137 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0753 3.4239 3.0164 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1377 3.2313 2.0221 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1536 1.7600 1.7229 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2412 1.0119 1.9695 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4598 1.5401 2.5304 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6566 1.4725 1.7268 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8947 1.0290 0.5762 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0275 0.3912 -0.4148 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5668 -0.9606 -0.7433 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9677 -2.0760 -0.6356 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5959 -2.3109 -0.1698 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8244 -3.0635 -1.2732 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4726 -4.3927 -1.5865 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4948 -5.2747 -0.3401 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0584 -5.5064 0.1298 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5741 1.2692 -2.5449 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5616 1.1509 -1.0413 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8966 0.0659 -2.4289 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1945 -0.4026 -0.1792 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4722 -1.4687 -1.6153 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5340 0.8243 -1.4593 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1781 -0.1563 -2.9144 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2553 -0.9034 -1.8295 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0415 -2.1910 -1.6958 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8132 -0.1706 0.4745 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4889 -1.4074 0.5766 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5257 -1.9869 0.0393 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2684 -3.8114 1.4731 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3013 -2.8214 1.7753 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8001 -4.5723 1.6765 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0277 -4.4484 3.8231 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0754 -3.2521 5.4940 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4001 -1.7051 3.1423 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1209 -2.1852 4.6586 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7219 0.2752 4.5090 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9257 1.1160 5.8517 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4598 -1.6109 5.5529 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0001 -0.8301 7.1528 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3803 1.0982 6.5735 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3617 0.7050 5.4206 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9444 -1.8261 4.2527 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6199 -1.8003 4.8957 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5151 -1.3747 2.3957 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1553 0.0306 3.3481 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9719 1.1055 3.4386 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2130 -0.1461 2.4626 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6877 1.1667 -1.1965 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2360 0.4366 -1.8860 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5243 3.2156 -0.6493 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6358 3.9100 -2.7813 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1818 3.0159 -2.9192 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8965 4.2667 -6.2773 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2205 -0.1911 -5.7392 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8787 -0.1390 -4.5729 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3373 -1.1827 -6.1719 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8760 -2.0927 -6.0524 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1959 -0.2029 -8.2077 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0735 -2.2143 -9.5330 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3004 -3.1669 -8.0433 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8515 -2.1563 -8.1975 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3968 2.6796 1.1227 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0546 3.4929 -0.4116 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6913 5.6948 0.4004 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3044 5.0057 1.9160 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6141 5.1234 0.9947 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8382 6.2020 2.1347 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3128 4.2903 3.7529 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1558 2.8096 3.9312 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9586 3.7889 1.0556 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0752 3.5859 2.4598 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2981 1.2552 1.3087 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1625 -0.0798 1.7775 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3799 2.5350 3.0421 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6370 0.8689 3.4964 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5654 1.9232 2.2749 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9722 1.1216 0.2030 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9720 0.3928 -0.2551 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1600 1.0534 -1.3608 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6148 -0.9561 -1.1230 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5334 -3.0157 -0.9236 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5620 -2.8473 0.7840 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0521 -1.3341 -0.0763 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7534 -2.4813 -2.1922 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7939 -3.2984 -0.9002 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4560 -4.3155 -2.0469 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8024 -4.9101 -2.3070 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9695 -6.2456 -0.6343 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0368 -4.7990 0.4968 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4082 -5.3105 -0.7494 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9930 -6.5651 0.4654 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7896 -4.7934 0.9349 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 27 29 1 0 27 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 24 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 1 0 44 45 2 0 45 46 1 0 46 47 1 0 47 48 2 0 48 49 1 0 49 50 1 0 50 51 2 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 1 57 1 0 1 58 1 0 1 59 1 0 2 60 1 0 2 61 1 0 3 62 1 0 3 63 1 0 4 64 1 0 4 65 1 0 5 66 1 0 5 67 1 0 6 68 1 0 7 69 1 0 8 70 1 0 8 71 1 0 9 72 1 0 10 73 1 0 11 74 1 0 11 75 1 0 12 76 1 0 13 77 1 0 14 78 1 0 14 79 1 0 15 80 1 0 16 81 1 0 17 82 1 0 17 83 1 0 18 84 1 0 18 85 1 0 19 86 1 0 19 87 1 0 23 88 1 0 23 89 1 0 24 90 1 0 25 91 1 0 25 92 1 0 29 93 1 0 31 94 1 0 31 95 1 0 32 96 1 0 32 97 1 0 33 98 1 0 34 99 1 0 34100 1 0 34101 1 0 38102 1 0 38103 1 0 39104 1 0 39105 1 0 40106 1 0 40107 1 0 41108 1 0 42109 1 0 43110 1 0 43111 1 0 44112 1 0 45113 1 0 46114 1 0 46115 1 0 47116 1 0 48117 1 0 49118 1 0 49119 1 0 50120 1 0 51121 1 0 52122 1 0 52123 1 0 53124 1 0 53125 1 0 54126 1 0 54127 1 0 55128 1 0 55129 1 0 56130 1 0 56131 1 0 56132 1 0 M END 3D SDF for #<Metabolite:0x00005634c2abf8b8>PE-NMe(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) Mrv1652309151723572D 57 56 0 0 1 0 999 V2000 29.3976 11.9444 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 29.4018 10.9029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.3643 11.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.6161 10.9919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 30.1970 11.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 31.0560 10.8436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 32.0595 10.8436 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 32.0595 11.6686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 32.0893 10.0186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 32.8845 10.8138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 33.6839 11.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.4494 10.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 35.2016 11.3100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 35.9964 10.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 29.3976 9.6271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 26.9360 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 26.9360 12.2303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 26.2219 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.5077 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.7936 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.0795 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.2545 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.5404 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.8263 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.0013 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.2872 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.5731 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.7481 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.0340 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.3198 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4948 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7807 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0666 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.3525 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6384 11.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9243 11.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.7844 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.7844 8.3036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 28.0703 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.3562 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 26.6421 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.9280 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.1030 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.3889 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.6748 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.8498 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.1357 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.4215 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.5965 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.8824 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.1683 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.3434 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.6292 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.9151 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.2010 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.4869 9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7727 9.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 2 3 1 0 0 0 0 2 5 1 0 0 0 0 2 15 1 0 0 0 0 3 4 1 0 0 0 0 4 16 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 7 9 2 0 0 0 0 7 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 15 37 1 0 0 0 0 16 17 2 0 0 0 0 16 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 2 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 2 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 2 0 0 0 0 31 32 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 37 38 2 0 0 0 0 37 39 1 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 41 42 1 0 0 0 0 42 43 2 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 2 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 2 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 2 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 M END > <DATABASE_ID> MMDBc0047619 > <DATABASE_NAME> MIME > <SMILES> [H]C(COC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC)(COP(O)(=O)OCCNC)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC > <INCHI_IDENTIFIER> InChI=1S/C46H76NO8P/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-45(48)52-42-44(43-54-56(50,51)53-41-40-47-3)55-46(49)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,24-27,30-33,44,47H,4-11,16-17,22-23,28-29,34-43H2,1-3H3,(H,50,51)/b14-12-,15-13-,20-18-,21-19-,26-24-,27-25-,32-30-,33-31- > <INCHI_KEY> MPTMTOMJDUSOGW-UUYLMBBPSA-N > <FORMULA> C46H76NO8P > <MOLECULAR_WEIGHT> 802.087 > <EXACT_MASS> 801.530855409 > <JCHEM_ACCEPTOR_COUNT> 5 > <JCHEM_ATOM_COUNT> 132 > <JCHEM_AVERAGE_POLARIZABILITY> 94.50437422889709 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 2 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> {2,3-bis[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyloxy]propoxy}[2-(methylamino)ethoxy]phosphinic acid > <ALOGPS_LOGP> 8.36 > <JCHEM_LOGP> 11.33577357410723 > <ALOGPS_LOGS> -7.11 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 0 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA_STRONGEST_ACIDIC> 1.8561780131735546 > <JCHEM_PKA_STRONGEST_BASIC> 10.045225536699881 > <JCHEM_POLAR_SURFACE_AREA> 120.38999999999999 > <JCHEM_REFRACTIVITY> 241.51930000000007 > <JCHEM_ROTATABLE_BOND_COUNT> 40 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 6.27e-05 g/l > <JCHEM_TRADITIONAL_IUPAC> 2,3-bis[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyloxy]propoxy(2-(methylamino)ethoxy)phosphinic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for #<Metabolite:0x00005634c2abf8b8>HMDB0112976 RDKit 3D PE-NMe(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) 132131 0 0 0 0 0 0 0 0999 V2000 -2.0832 0.5748 -1.8459 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1271 -0.4522 -1.2810 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2714 -0.1975 -1.8092 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2980 -1.1555 -1.3406 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4984 -1.1802 0.1788 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5416 -2.1561 0.5263 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3655 -3.1717 1.3342 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1131 -3.5092 2.0379 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3253 -3.6289 3.4929 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8027 -2.9044 4.4594 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0963 -1.8039 4.2466 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0942 -0.4914 4.7872 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0072 0.0150 5.5330 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1897 -0.6547 6.0520 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4287 0.1474 5.9652 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5190 -0.0391 5.3390 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8102 -1.2105 4.4577 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2641 -0.5797 3.0982 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1846 0.3383 2.6480 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5887 1.0217 1.3896 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2560 2.0898 1.4994 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2835 0.5759 0.1489 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5635 1.1137 -1.0864 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9824 2.4974 -1.2339 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1198 2.9132 -2.6913 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4417 2.0237 -3.5242 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5516 2.4227 -5.1459 P 0 0 0 0 0 5 0 0 0 0 0 0 4.9516 2.5678 -5.6420 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7196 3.8826 -5.3830 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7380 1.2407 -6.0419 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1205 -0.0421 -5.6499 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4215 -1.1209 -6.4071 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6556 -1.0727 -7.8369 N 0 0 0 0 0 0 0 0 0 0 0 0 1.9184 -2.1817 -8.4406 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5886 2.4927 -0.8916 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0959 3.3939 0.0099 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9448 4.2300 0.4810 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7082 3.5248 0.5103 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4938 4.8560 1.1382 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8406 5.1135 1.7624 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0786 4.2311 2.9137 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0753 3.4239 3.0164 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1377 3.2313 2.0221 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1536 1.7600 1.7229 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2412 1.0119 1.9695 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4598 1.5401 2.5304 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6566 1.4725 1.7268 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8947 1.0290 0.5762 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0275 0.3912 -0.4148 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5668 -0.9606 -0.7433 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9677 -2.0760 -0.6356 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5959 -2.3109 -0.1698 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8244 -3.0635 -1.2732 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4726 -4.3927 -1.5865 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4948 -5.2747 -0.3401 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0584 -5.5064 0.1298 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5741 1.2692 -2.5449 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5616 1.1509 -1.0413 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8966 0.0659 -2.4289 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1945 -0.4026 -0.1792 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4722 -1.4687 -1.6153 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5340 0.8243 -1.4593 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1781 -0.1563 -2.9144 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2553 -0.9034 -1.8295 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0415 -2.1910 -1.6958 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8132 -0.1706 0.4745 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4889 -1.4074 0.5766 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5257 -1.9869 0.0393 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2684 -3.8114 1.4731 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3013 -2.8214 1.7753 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8001 -4.5723 1.6765 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0277 -4.4484 3.8231 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0754 -3.2521 5.4940 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4001 -1.7051 3.1423 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1209 -2.1852 4.6586 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7219 0.2752 4.5090 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9257 1.1160 5.8517 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4598 -1.6109 5.5529 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0001 -0.8301 7.1528 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3803 1.0982 6.5735 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3617 0.7050 5.4206 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9444 -1.8261 4.2527 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6199 -1.8003 4.8957 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5151 -1.3747 2.3957 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1553 0.0306 3.3481 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9719 1.1055 3.4386 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2130 -0.1461 2.4626 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6877 1.1667 -1.1965 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2360 0.4366 -1.8860 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5243 3.2156 -0.6493 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6358 3.9100 -2.7813 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1818 3.0159 -2.9192 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8965 4.2667 -6.2773 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2205 -0.1911 -5.7392 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8787 -0.1390 -4.5729 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3373 -1.1827 -6.1719 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8760 -2.0927 -6.0524 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1959 -0.2029 -8.2077 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0735 -2.2143 -9.5330 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3004 -3.1669 -8.0433 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8515 -2.1563 -8.1975 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3968 2.6796 1.1227 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0546 3.4929 -0.4116 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6913 5.6948 0.4004 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3044 5.0057 1.9160 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6141 5.1234 0.9947 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8382 6.2020 2.1347 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3128 4.2903 3.7529 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1558 2.8096 3.9312 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9586 3.7889 1.0556 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0752 3.5859 2.4598 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2981 1.2552 1.3087 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1625 -0.0798 1.7775 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3799 2.5350 3.0421 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6370 0.8689 3.4964 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5654 1.9232 2.2749 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9722 1.1216 0.2030 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9720 0.3928 -0.2551 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1600 1.0534 -1.3608 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6148 -0.9561 -1.1230 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5334 -3.0157 -0.9236 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5620 -2.8473 0.7840 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0521 -1.3341 -0.0763 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7534 -2.4813 -2.1922 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7939 -3.2984 -0.9002 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4560 -4.3155 -2.0469 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8024 -4.9101 -2.3070 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9695 -6.2456 -0.6343 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0368 -4.7990 0.4968 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4082 -5.3105 -0.7494 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9930 -6.5651 0.4654 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7896 -4.7934 0.9349 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 27 29 1 0 27 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 24 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 1 0 44 45 2 0 45 46 1 0 46 47 1 0 47 48 2 0 48 49 1 0 49 50 1 0 50 51 2 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 1 57 1 0 1 58 1 0 1 59 1 0 2 60 1 0 2 61 1 0 3 62 1 0 3 63 1 0 4 64 1 0 4 65 1 0 5 66 1 0 5 67 1 0 6 68 1 0 7 69 1 0 8 70 1 0 8 71 1 0 9 72 1 0 10 73 1 0 11 74 1 0 11 75 1 0 12 76 1 0 13 77 1 0 14 78 1 0 14 79 1 0 15 80 1 0 16 81 1 0 17 82 1 0 17 83 1 0 18 84 1 0 18 85 1 0 19 86 1 0 19 87 1 0 23 88 1 0 23 89 1 0 24 90 1 0 25 91 1 0 25 92 1 0 29 93 1 0 31 94 1 0 31 95 1 0 32 96 1 0 32 97 1 0 33 98 1 0 34 99 1 0 34100 1 0 34101 1 0 38102 1 0 38103 1 0 39104 1 0 39105 1 0 40106 1 0 40107 1 0 41108 1 0 42109 1 0 43110 1 0 43111 1 0 44112 1 0 45113 1 0 46114 1 0 46115 1 0 47116 1 0 48117 1 0 49118 1 0 49119 1 0 50120 1 0 51121 1 0 52122 1 0 52123 1 0 53124 1 0 53125 1 0 54126 1 0 54127 1 0 55128 1 0 55129 1 0 56130 1 0 56131 1 0 56132 1 0 M END PDB for #<Metabolite:0x00005634c2abf8b8>HEADER PROTEIN 15-SEP-17 NONE TITLE NULL COMPND MOLECULE: PE-NMe(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 15-SEP-17 0 HETATM 1 H UNK 0 54.876 22.296 0.000 0.00 0.00 H+0 HETATM 2 C UNK 0 54.883 20.352 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 52.947 21.185 0.000 0.00 0.00 C+0 HETATM 4 O UNK 0 51.550 20.518 0.000 0.00 0.00 O+0 HETATM 5 C UNK 0 56.368 21.019 0.000 0.00 0.00 C+0 HETATM 6 O UNK 0 57.971 20.241 0.000 0.00 0.00 O+0 HETATM 7 P UNK 0 59.844 20.241 0.000 0.00 0.00 P+0 HETATM 8 O UNK 0 59.844 21.781 0.000 0.00 0.00 O+0 HETATM 9 O UNK 0 59.900 18.701 0.000 0.00 0.00 O+0 HETATM 10 O UNK 0 61.384 20.186 0.000 0.00 0.00 O+0 HETATM 11 C UNK 0 62.877 20.908 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 64.305 20.186 0.000 0.00 0.00 C+0 HETATM 13 N UNK 0 65.710 21.112 0.000 0.00 0.00 N+0 HETATM 14 C UNK 0 67.193 20.144 0.000 0.00 0.00 C+0 HETATM 15 O UNK 0 54.875 17.971 0.000 0.00 0.00 O+0 HETATM 16 C UNK 0 50.280 21.390 0.000 0.00 0.00 C+0 HETATM 17 O UNK 0 50.280 22.830 0.000 0.00 0.00 O+0 HETATM 18 C UNK 0 48.948 20.619 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 47.614 21.390 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 46.281 20.619 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 44.948 21.390 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 43.408 21.390 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 42.075 20.619 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 40.742 21.390 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 39.202 21.390 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 37.869 20.619 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 36.536 21.390 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 34.996 21.390 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 33.663 20.619 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 32.330 21.390 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 30.790 21.390 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 29.457 20.619 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 28.124 21.390 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 26.791 20.619 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 25.458 21.390 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 24.125 20.619 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 53.731 16.940 0.000 0.00 0.00 C+0 HETATM 38 O UNK 0 53.731 15.500 0.000 0.00 0.00 O+0 HETATM 39 C UNK 0 52.398 17.711 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 51.065 16.940 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 49.732 17.711 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 48.399 16.940 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 46.859 16.940 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 45.526 17.711 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 44.193 16.940 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 42.653 16.940 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 41.320 17.711 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 39.987 16.940 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 38.447 16.940 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 37.114 17.711 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 35.781 16.940 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 34.241 16.940 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 32.908 17.711 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 31.575 16.940 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 30.242 17.711 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 28.909 16.940 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 27.576 17.711 0.000 0.00 0.00 C+0 CONECT 1 2 CONECT 2 1 3 5 15 CONECT 3 2 4 CONECT 4 3 16 CONECT 5 2 6 CONECT 6 5 7 CONECT 7 6 8 9 10 CONECT 8 7 CONECT 9 7 CONECT 10 7 11 CONECT 11 10 12 CONECT 12 11 13 CONECT 13 12 14 CONECT 14 13 CONECT 15 2 37 CONECT 16 4 17 18 CONECT 17 16 CONECT 18 16 19 CONECT 19 18 20 CONECT 20 19 21 CONECT 21 20 22 CONECT 22 21 23 CONECT 23 22 24 CONECT 24 23 25 CONECT 25 24 26 CONECT 26 25 27 CONECT 27 26 28 CONECT 28 27 29 CONECT 29 28 30 CONECT 30 29 31 CONECT 31 30 32 CONECT 32 31 33 CONECT 33 32 34 CONECT 34 33 35 CONECT 35 34 36 CONECT 36 35 CONECT 37 15 38 39 CONECT 38 37 CONECT 39 37 40 CONECT 40 39 41 CONECT 41 40 42 CONECT 42 41 43 CONECT 43 42 44 CONECT 44 43 45 CONECT 45 44 46 CONECT 46 45 47 CONECT 47 46 48 CONECT 48 47 49 CONECT 49 48 50 CONECT 50 49 51 CONECT 51 50 52 CONECT 52 51 53 CONECT 53 52 54 CONECT 54 53 55 CONECT 55 54 56 CONECT 56 55 57 CONECT 57 56 MASTER 0 0 0 0 0 0 0 0 57 0 112 0 END 3D PDB for #<Metabolite:0x00005634c2abf8b8>COMPND HMDB0112976 HETATM 1 C1 UNL 1 -2.083 0.575 -1.846 1.00 0.00 C HETATM 2 C2 UNL 1 -1.127 -0.452 -1.281 1.00 0.00 C HETATM 3 C3 UNL 1 0.271 -0.198 -1.809 1.00 0.00 C HETATM 4 C4 UNL 1 1.298 -1.155 -1.341 1.00 0.00 C HETATM 5 C5 UNL 1 1.498 -1.180 0.179 1.00 0.00 C HETATM 6 C6 UNL 1 2.542 -2.156 0.526 1.00 0.00 C HETATM 7 C7 UNL 1 2.365 -3.172 1.334 1.00 0.00 C HETATM 8 C8 UNL 1 1.113 -3.509 2.038 1.00 0.00 C HETATM 9 C9 UNL 1 1.325 -3.629 3.493 1.00 0.00 C HETATM 10 C10 UNL 1 0.803 -2.904 4.459 1.00 0.00 C HETATM 11 C11 UNL 1 -0.096 -1.804 4.247 1.00 0.00 C HETATM 12 C12 UNL 1 0.094 -0.491 4.787 1.00 0.00 C HETATM 13 C13 UNL 1 1.007 0.015 5.533 1.00 0.00 C HETATM 14 C14 UNL 1 2.190 -0.655 6.052 1.00 0.00 C HETATM 15 C15 UNL 1 3.429 0.147 5.965 1.00 0.00 C HETATM 16 C16 UNL 1 4.519 -0.039 5.339 1.00 0.00 C HETATM 17 C17 UNL 1 4.810 -1.210 4.458 1.00 0.00 C HETATM 18 C18 UNL 1 5.264 -0.580 3.098 1.00 0.00 C HETATM 19 C19 UNL 1 4.185 0.338 2.648 1.00 0.00 C HETATM 20 C20 UNL 1 4.589 1.022 1.390 1.00 0.00 C HETATM 21 O1 UNL 1 5.256 2.090 1.499 1.00 0.00 O HETATM 22 O2 UNL 1 4.284 0.576 0.149 1.00 0.00 O HETATM 23 C21 UNL 1 4.564 1.114 -1.086 1.00 0.00 C HETATM 24 C22 UNL 1 3.982 2.497 -1.234 1.00 0.00 C HETATM 25 C23 UNL 1 4.120 2.913 -2.691 1.00 0.00 C HETATM 26 O3 UNL 1 3.442 2.024 -3.524 1.00 0.00 O HETATM 27 P1 UNL 1 3.552 2.423 -5.146 1.00 0.00 P HETATM 28 O4 UNL 1 4.952 2.568 -5.642 1.00 0.00 O HETATM 29 O5 UNL 1 2.720 3.883 -5.383 1.00 0.00 O HETATM 30 O6 UNL 1 2.738 1.241 -6.042 1.00 0.00 O HETATM 31 C24 UNL 1 3.121 -0.042 -5.650 1.00 0.00 C HETATM 32 C25 UNL 1 2.422 -1.121 -6.407 1.00 0.00 C HETATM 33 N1 UNL 1 2.656 -1.073 -7.837 1.00 0.00 N HETATM 34 C26 UNL 1 1.918 -2.182 -8.441 1.00 0.00 C HETATM 35 O7 UNL 1 2.589 2.493 -0.892 1.00 0.00 O HETATM 36 C27 UNL 1 2.096 3.394 0.010 1.00 0.00 C HETATM 37 O8 UNL 1 2.945 4.230 0.481 1.00 0.00 O HETATM 38 C28 UNL 1 0.708 3.525 0.510 1.00 0.00 C HETATM 39 C29 UNL 1 0.494 4.856 1.138 1.00 0.00 C HETATM 40 C30 UNL 1 -0.841 5.114 1.762 1.00 0.00 C HETATM 41 C31 UNL 1 -1.079 4.231 2.914 1.00 0.00 C HETATM 42 C32 UNL 1 -2.075 3.424 3.016 1.00 0.00 C HETATM 43 C33 UNL 1 -3.138 3.231 2.022 1.00 0.00 C HETATM 44 C34 UNL 1 -3.154 1.760 1.723 1.00 0.00 C HETATM 45 C35 UNL 1 -4.241 1.012 1.970 1.00 0.00 C HETATM 46 C36 UNL 1 -5.460 1.540 2.530 1.00 0.00 C HETATM 47 C37 UNL 1 -6.657 1.472 1.727 1.00 0.00 C HETATM 48 C38 UNL 1 -6.895 1.029 0.576 1.00 0.00 C HETATM 49 C39 UNL 1 -6.027 0.391 -0.415 1.00 0.00 C HETATM 50 C40 UNL 1 -6.567 -0.961 -0.743 1.00 0.00 C HETATM 51 C41 UNL 1 -5.968 -2.076 -0.636 1.00 0.00 C HETATM 52 C42 UNL 1 -4.596 -2.311 -0.170 1.00 0.00 C HETATM 53 C43 UNL 1 -3.824 -3.063 -1.273 1.00 0.00 C HETATM 54 C44 UNL 1 -4.473 -4.393 -1.587 1.00 0.00 C HETATM 55 C45 UNL 1 -4.495 -5.275 -0.340 1.00 0.00 C HETATM 56 C46 UNL 1 -3.058 -5.506 0.130 1.00 0.00 C HETATM 57 H1 UNL 1 -1.574 1.269 -2.545 1.00 0.00 H HETATM 58 H2 UNL 1 -2.562 1.151 -1.041 1.00 0.00 H HETATM 59 H3 UNL 1 -2.897 0.066 -2.429 1.00 0.00 H HETATM 60 H4 UNL 1 -1.194 -0.403 -0.179 1.00 0.00 H HETATM 61 H5 UNL 1 -1.472 -1.469 -1.615 1.00 0.00 H HETATM 62 H6 UNL 1 0.534 0.824 -1.459 1.00 0.00 H HETATM 63 H7 UNL 1 0.178 -0.156 -2.914 1.00 0.00 H HETATM 64 H8 UNL 1 2.255 -0.903 -1.830 1.00 0.00 H HETATM 65 H9 UNL 1 1.041 -2.191 -1.696 1.00 0.00 H HETATM 66 H10 UNL 1 1.813 -0.171 0.475 1.00 0.00 H HETATM 67 H11 UNL 1 0.489 -1.407 0.577 1.00 0.00 H HETATM 68 H12 UNL 1 3.526 -1.987 0.039 1.00 0.00 H HETATM 69 H13 UNL 1 3.268 -3.811 1.473 1.00 0.00 H HETATM 70 H14 UNL 1 0.301 -2.821 1.775 1.00 0.00 H HETATM 71 H15 UNL 1 0.800 -4.572 1.677 1.00 0.00 H HETATM 72 H16 UNL 1 2.028 -4.448 3.823 1.00 0.00 H HETATM 73 H17 UNL 1 1.075 -3.252 5.494 1.00 0.00 H HETATM 74 H18 UNL 1 -0.400 -1.705 3.142 1.00 0.00 H HETATM 75 H19 UNL 1 -1.121 -2.185 4.659 1.00 0.00 H HETATM 76 H20 UNL 1 -0.722 0.275 4.509 1.00 0.00 H HETATM 77 H21 UNL 1 0.926 1.116 5.852 1.00 0.00 H HETATM 78 H22 UNL 1 2.460 -1.611 5.553 1.00 0.00 H HETATM 79 H23 UNL 1 2.000 -0.830 7.153 1.00 0.00 H HETATM 80 H24 UNL 1 3.380 1.098 6.574 1.00 0.00 H HETATM 81 H25 UNL 1 5.362 0.705 5.421 1.00 0.00 H HETATM 82 H26 UNL 1 3.944 -1.826 4.253 1.00 0.00 H HETATM 83 H27 UNL 1 5.620 -1.800 4.896 1.00 0.00 H HETATM 84 H28 UNL 1 5.515 -1.375 2.396 1.00 0.00 H HETATM 85 H29 UNL 1 6.155 0.031 3.348 1.00 0.00 H HETATM 86 H30 UNL 1 3.972 1.105 3.439 1.00 0.00 H HETATM 87 H31 UNL 1 3.213 -0.146 2.463 1.00 0.00 H HETATM 88 H32 UNL 1 5.688 1.167 -1.197 1.00 0.00 H HETATM 89 H33 UNL 1 4.236 0.437 -1.886 1.00 0.00 H HETATM 90 H34 UNL 1 4.524 3.216 -0.649 1.00 0.00 H HETATM 91 H35 UNL 1 3.636 3.910 -2.781 1.00 0.00 H HETATM 92 H36 UNL 1 5.182 3.016 -2.919 1.00 0.00 H HETATM 93 H37 UNL 1 2.897 4.267 -6.277 1.00 0.00 H HETATM 94 H38 UNL 1 4.220 -0.191 -5.739 1.00 0.00 H HETATM 95 H39 UNL 1 2.879 -0.139 -4.573 1.00 0.00 H HETATM 96 H40 UNL 1 1.337 -1.183 -6.172 1.00 0.00 H HETATM 97 H41 UNL 1 2.876 -2.093 -6.052 1.00 0.00 H HETATM 98 H42 UNL 1 2.196 -0.203 -8.208 1.00 0.00 H HETATM 99 H43 UNL 1 2.073 -2.214 -9.533 1.00 0.00 H HETATM 100 H44 UNL 1 2.300 -3.167 -8.043 1.00 0.00 H HETATM 101 H45 UNL 1 0.852 -2.156 -8.198 1.00 0.00 H HETATM 102 H46 UNL 1 0.397 2.680 1.123 1.00 0.00 H HETATM 103 H47 UNL 1 0.055 3.493 -0.412 1.00 0.00 H HETATM 104 H48 UNL 1 0.691 5.695 0.400 1.00 0.00 H HETATM 105 H49 UNL 1 1.304 5.006 1.916 1.00 0.00 H HETATM 106 H50 UNL 1 -1.614 5.123 0.995 1.00 0.00 H HETATM 107 H51 UNL 1 -0.838 6.202 2.135 1.00 0.00 H HETATM 108 H52 UNL 1 -0.313 4.290 3.753 1.00 0.00 H HETATM 109 H53 UNL 1 -2.156 2.810 3.931 1.00 0.00 H HETATM 110 H54 UNL 1 -2.959 3.789 1.056 1.00 0.00 H HETATM 111 H55 UNL 1 -4.075 3.586 2.460 1.00 0.00 H HETATM 112 H56 UNL 1 -2.298 1.255 1.309 1.00 0.00 H HETATM 113 H57 UNL 1 -4.162 -0.080 1.777 1.00 0.00 H HETATM 114 H58 UNL 1 -5.380 2.535 3.042 1.00 0.00 H HETATM 115 H59 UNL 1 -5.637 0.869 3.496 1.00 0.00 H HETATM 116 H60 UNL 1 -7.565 1.923 2.275 1.00 0.00 H HETATM 117 H61 UNL 1 -7.972 1.122 0.203 1.00 0.00 H HETATM 118 H62 UNL 1 -4.972 0.393 -0.255 1.00 0.00 H HETATM 119 H63 UNL 1 -6.160 1.053 -1.361 1.00 0.00 H HETATM 120 H64 UNL 1 -7.615 -0.956 -1.123 1.00 0.00 H HETATM 121 H65 UNL 1 -6.533 -3.016 -0.924 1.00 0.00 H HETATM 122 H66 UNL 1 -4.562 -2.847 0.784 1.00 0.00 H HETATM 123 H67 UNL 1 -4.052 -1.334 -0.076 1.00 0.00 H HETATM 124 H68 UNL 1 -3.753 -2.481 -2.192 1.00 0.00 H HETATM 125 H69 UNL 1 -2.794 -3.298 -0.900 1.00 0.00 H HETATM 126 H70 UNL 1 -5.456 -4.315 -2.047 1.00 0.00 H HETATM 127 H71 UNL 1 -3.802 -4.910 -2.307 1.00 0.00 H HETATM 128 H72 UNL 1 -4.970 -6.246 -0.634 1.00 0.00 H HETATM 129 H73 UNL 1 -5.037 -4.799 0.497 1.00 0.00 H HETATM 130 H74 UNL 1 -2.408 -5.311 -0.749 1.00 0.00 H HETATM 131 H75 UNL 1 -2.993 -6.565 0.465 1.00 0.00 H HETATM 132 H76 UNL 1 -2.790 -4.793 0.935 1.00 0.00 H CONECT 1 2 57 58 59 CONECT 2 3 60 61 CONECT 3 4 62 63 CONECT 4 5 64 65 CONECT 5 6 66 67 CONECT 6 7 7 68 CONECT 7 8 69 CONECT 8 9 70 71 CONECT 9 10 10 72 CONECT 10 11 73 CONECT 11 12 74 75 CONECT 12 13 13 76 CONECT 13 14 77 CONECT 14 15 78 79 CONECT 15 16 16 80 CONECT 16 17 81 CONECT 17 18 82 83 CONECT 18 19 84 85 CONECT 19 20 86 87 CONECT 20 21 21 22 CONECT 22 23 CONECT 23 24 88 89 CONECT 24 25 35 90 CONECT 25 26 91 92 CONECT 26 27 CONECT 27 28 28 29 30 CONECT 29 93 CONECT 30 31 CONECT 31 32 94 95 CONECT 32 33 96 97 CONECT 33 34 98 CONECT 34 99 100 101 CONECT 35 36 CONECT 36 37 37 38 CONECT 38 39 102 103 CONECT 39 40 104 105 CONECT 40 41 106 107 CONECT 41 42 42 108 CONECT 42 43 109 CONECT 43 44 110 111 CONECT 44 45 45 112 CONECT 45 46 113 CONECT 46 47 114 115 CONECT 47 48 48 116 CONECT 48 49 117 CONECT 49 50 118 119 CONECT 50 51 51 120 CONECT 51 52 121 CONECT 52 53 122 123 CONECT 53 54 124 125 CONECT 54 55 126 127 CONECT 55 56 128 129 CONECT 56 130 131 132 END SMILES for #<Metabolite:0x00005634c2abf8b8>[H]C(COC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC)(COP(O)(=O)OCCNC)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC INCHI for #<Metabolite:0x00005634c2abf8b8>InChI=1S/C46H76NO8P/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-45(48)52-42-44(43-54-56(50,51)53-41-40-47-3)55-46(49)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,24-27,30-33,44,47H,4-11,16-17,22-23,28-29,34-43H2,1-3H3,(H,50,51)/b14-12-,15-13-,20-18-,21-19-,26-24-,27-25-,32-30-,33-31- 3D Structure for #<Metabolite:0x00005634c2abf8b8> | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Formula | C46H76NO8P | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 802.087 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 801.530855409 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | {2,3-bis[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyloxy]propoxy}[2-(methylamino)ethoxy]phosphinic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2,3-bis[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyloxy]propoxy(2-(methylamino)ethoxy)phosphinic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | [H]C(COC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC)(COP(O)(=O)OCCNC)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C46H76NO8P/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-45(48)52-42-44(43-54-56(50,51)53-41-40-47-3)55-46(49)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,24-27,30-33,44,47H,4-11,16-17,22-23,28-29,34-43H2,1-3H3,(H,50,51)/b14-12-,15-13-,20-18-,21-19-,26-24-,27-25-,32-30-,33-31- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | MPTMTOMJDUSOGW-UUYLMBBPSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as monomethylphosphatidylethanolamines. These are lipids with a structure containing a glycerol moiety linked at its terminal C3 atom to a N-methylphosphoethanolamine group, and at its C1 and C2 terminal atoms by an acyl group. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Glycerophospholipids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Glycerophosphoethanolamines | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Monomethylphosphatidylethanolamines | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic acyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Functional Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Solid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Proteins and Enzymes | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Pathways | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolic Reactions | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Reactions
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Health Effects and Bioactivity | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Microbial Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Exposure Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Host Biospecimen and Location | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0112976 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131820091 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|