Showing metabocard for 2-Hydroxy-3-oxopropanoate (MMDBc0049974)
| Record Information | |
|---|---|
| Version | 1.0 |
| Status | Detected and Quantified |
| Creation Date | 2022-04-29 22:47:24 UTC |
| Update Date | 2025-01-15 22:01:20 UTC |
| Metabolite ID | MMDBc0049974 |
| Metabolite Identification | |
| Common Name | 2-Hydroxy-3-oxopropanoate |
| Description | Tartronate semialdehyde is an intermediate in ascorbate and aldarate as well as glyoxylate and dicarboxylate metabolism. It is generated from 2-dehydro-3-deoxy-D-glucarate and 5-dehydro-4-deoxy-D-glucarate via the enzyme 2-dehydro-3-deoxyglucarate aldolase [EC:4.1.2.20]. |
| Structure |  |
| Synonyms | Not Available |
| Molecular Formula | C3H4O4 |
| Average Mass | 104.0615 |
| Monoisotopic Mass | 104.0109586 |
| IUPAC Name | Not Available |
| Traditional Name | Not Available |
| CAS Registry Number | Not Available |
| SMILES | Not Available |
| InChI Identifier | InChI=1S/C3H4O4/c4-1-2(5)3(6)7/h1-2,5H,(H,6,7) |
| InChI Key | QWBAFPFNGRFSFB-UHFFFAOYSA-N |
| Chemical Taxonomy | |
| Functional Ontology | |
| Physical Properties | |
| Spectra | |
| Biological Properties | |
| Human Proteins and Enzymes | |
| Human Pathways | |
| Metabolic Reactions | |
| Health Effects and Bioactivity | |
| Microbial Sources | |
| Exposure Sources | |
| Host Biospecimen and Location | |
| External Links | |
| References | |
