Showing metabocard for Lipoteichoic acid (MMDBc0057094)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 1.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected and Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2022-10-05 15:40:53 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-10-05 15:40:53 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite ID | MMDBc0057094 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Lipoteichoic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Lipoteichoic acid belongs to the class of organic compounds known as acylaminosugars. These are organic compounds containing a sugar linked to a chain through N-acyl group. Based on a literature review very few articles have been published on lipoteichoic acid. This compound has been identified in human blood as reported by (PMID: 31557052 ). Lipoteichoic acid is not a naturally occurring metabolite and is only found in those individuals exposed to this compound or its derivatives. Technically Lipoteichoic acid is part of the human exposome. The exposome can be defined as the collection of all the exposures of an individual in a lifetime and how those exposures relate to health. An individual's exposure begins before birth and includes insults from environmental and occupational sources. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for #<Metabolite:0x00005634c1c7ae88>Mrv1652309112115162D 54 55 0 0 0 0 999 V2000 8.5682 -3.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3700 -3.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5774 -4.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3792 -5.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5866 -5.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3884 -6.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5958 -6.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3976 -7.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6050 -7.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4068 -8.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8031 -9.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3976 -10.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1995 -10.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7939 -11.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5866 -11.1795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5958 -12.2091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1902 -12.7811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9921 -13.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5866 -14.1540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3884 -14.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9829 -15.5269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7847 -16.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9921 -16.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3976 -15.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5958 -15.1837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6050 -16.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0105 -15.6413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7939 -17.3574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3792 -16.8998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1810 -17.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7755 -18.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5774 -19.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7847 -19.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1902 -18.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3884 -17.9295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3976 -18.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5866 -20.1032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.1718 -19.6456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5682 -18.0439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.7663 -17.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1718 -16.6710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5589 -17.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7755 -15.2981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9829 -12.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1810 -11.7515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9737 -11.5227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5682 -12.0947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1718 -10.7218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9645 -10.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1626 -9.6922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9553 -9.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1534 -8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9461 -8.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 8 7 1 4 0 0 0 8 9 2 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 2 0 0 0 0 15 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 21 26 1 0 0 0 0 25 27 1 0 0 0 0 27 28 1 0 0 0 0 24 29 1 0 0 0 0 23 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 31 36 1 0 0 0 0 35 37 1 0 0 0 0 34 38 1 0 0 0 0 33 39 1 0 0 0 0 32 40 1 0 0 0 0 40 41 1 0 0 0 0 41 42 2 0 0 0 0 41 43 1 0 0 0 0 22 44 1 0 0 0 0 18 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 2 0 0 0 0 47 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 1 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 M END 3D MOL for #<Metabolite:0x00005634c1c7ae88>HMDB0254121 RDKit 3D Lipoteichoic acid 124125 0 0 0 0 0 0 0 0999 V2000 -2.2055 4.4589 -4.3821 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9245 3.9976 -3.1504 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1052 2.5081 -3.1080 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8231 2.1158 -1.8283 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0280 0.6406 -1.7356 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7008 0.3142 -0.4148 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9420 -1.1908 -0.3135 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6836 -1.9406 -0.4514 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1249 -2.7556 0.4121 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6036 -3.1312 1.7300 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7615 -2.7915 2.9066 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5672 -1.2983 3.1054 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7972 -1.0063 4.3341 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3968 -1.4428 4.4540 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5723 -0.7726 3.5576 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8308 -0.9861 3.7084 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1862 0.0802 2.5763 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0422 0.7876 1.7285 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9903 2.2747 2.2351 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3443 2.7032 2.1681 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8336 3.9459 2.4215 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0390 4.8505 2.7473 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2860 4.2763 2.3211 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5702 5.7380 2.2505 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9344 6.4190 1.0485 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2803 7.9008 1.0447 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6368 8.5226 -0.1661 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1243 8.3738 -0.1732 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7946 0.7812 0.2877 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8501 -0.2559 -0.5269 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1696 -1.3948 -0.4527 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4044 -1.6206 -1.7908 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4849 -0.9297 -2.6456 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0132 -1.2249 -4.0463 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7621 -0.6347 -5.0333 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9400 -1.1293 -2.4051 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5660 -1.6886 -3.5652 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3963 -1.9417 -1.2908 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3453 -2.9525 -1.5843 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0582 -3.3196 -0.4844 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4462 -3.2239 -0.7572 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0231 -3.0922 0.5234 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4585 -2.7344 0.5202 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6662 -4.2744 1.3974 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7409 -4.8344 2.1338 N 0 0 0 0 0 0 0 0 0 0 0 0 5.1498 -5.3641 0.4330 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1538 -5.6321 -0.5061 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8892 -4.8568 -0.2362 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7211 -5.5111 -1.4917 N 0 0 0 0 0 0 0 0 0 0 0 0 2.6142 -6.2823 -1.9095 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5489 -6.9068 -3.2666 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6427 -6.4629 -1.1461 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2028 -2.5694 -0.5156 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5266 -2.9206 0.7536 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4964 5.2571 -4.1019 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5805 3.5827 -4.7295 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8766 4.8077 -5.1931 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9363 4.5026 -3.1602 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3746 4.3522 -2.2601 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2070 1.9263 -3.3206 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8324 2.2535 -3.9364 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8337 2.6048 -1.8284 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1848 2.4309 -0.9817 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5594 0.2121 -2.6102 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0064 0.1851 -1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6510 0.8231 -0.2649 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9285 0.5426 0.3660 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3383 -1.3552 0.6990 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6859 -1.4793 -1.0510 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1265 -1.8150 -1.4119 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1697 -3.2380 0.0958 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6602 -2.8204 1.9278 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6793 -4.2694 1.7244 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3050 -3.1711 3.8135 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8205 -3.3323 2.8377 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5903 -0.8862 3.2491 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1655 -0.8077 2.2223 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3420 -1.3462 5.2526 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7952 0.1270 4.4568 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2770 -2.5593 4.4460 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0639 -1.1706 5.5056 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1075 0.5093 1.9574 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3268 2.2539 3.2833 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6910 2.8967 1.6556 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8092 3.6874 1.5649 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7311 3.9276 3.3085 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6756 5.9058 2.1129 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2919 6.3014 3.1662 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3078 5.9952 0.1055 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8496 6.3358 1.1692 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3878 8.0393 0.9919 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8848 8.4329 1.9288 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8912 9.6014 -0.2806 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9976 8.0404 -1.1152 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2000 7.3375 -0.3443 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2714 9.0025 -0.9919 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2944 8.8035 0.7743 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4710 1.6519 -0.1162 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2577 1.2728 0.1632 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5424 -1.5990 0.3045 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1948 0.1531 -2.4721 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0395 -0.8372 -4.1975 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0757 -2.3082 -4.2609 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5198 0.2933 -5.2535 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4168 -0.1189 -2.3549 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4358 -1.2454 -3.7490 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8557 -1.4208 -0.4056 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8555 -2.8486 0.4558 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4321 -2.2212 0.9611 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9287 -2.6959 -0.4592 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0151 -3.4201 1.2025 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5472 -1.7251 1.0276 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8479 -4.0411 2.1066 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0013 -4.3283 2.9819 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4997 -5.2771 1.6004 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8970 -6.2385 1.0483 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0135 -6.5349 -0.8765 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0649 -5.0511 0.4599 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5228 -5.4106 -2.1898 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4874 -6.9365 -3.6485 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9889 -7.9148 -3.2663 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1620 -6.2557 -3.9410 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7534 -3.3601 -1.0924 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7405 -2.1665 1.3179 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 2 3 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 2 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 18 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 50 52 2 0 38 53 1 0 53 54 1 0 53 31 1 0 48 40 1 0 1 55 1 0 1 56 1 0 1 57 1 0 2 58 1 0 2 59 1 0 3 60 1 0 3 61 1 0 4 62 1 0 4 63 1 0 5 64 1 0 5 65 1 0 6 66 1 0 6 67 1 0 7 68 1 0 7 69 1 0 8 70 1 0 9 71 1 0 10 72 1 0 10 73 1 0 11 74 1 0 11 75 1 0 12 76 1 0 12 77 1 0 13 78 1 0 13 79 1 0 14 80 1 0 14 81 1 0 18 82 1 0 19 83 1 0 19 84 1 0 23 85 1 0 23 86 1 0 24 87 1 0 24 88 1 0 25 89 1 0 25 90 1 0 26 91 1 0 26 92 1 0 27 93 1 0 27 94 1 0 28 95 1 0 28 96 1 0 28 97 1 0 29 98 1 0 29 99 1 0 31100 1 0 33101 1 0 34102 1 0 34103 1 0 35104 1 0 36105 1 0 37106 1 0 38107 1 0 40108 1 0 42109 1 0 43110 1 0 43111 1 0 43112 1 0 44113 1 0 45114 1 0 45115 1 0 46116 1 0 47117 1 0 48118 1 0 49119 1 0 51120 1 0 51121 1 0 51122 1 0 53123 1 0 54124 1 0 M END 3D SDF for #<Metabolite:0x00005634c1c7ae88>Mrv1652309112115162D 54 55 0 0 0 0 999 V2000 8.5682 -3.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3700 -3.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5774 -4.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3792 -5.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5866 -5.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3884 -6.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5958 -6.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3976 -7.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6050 -7.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4068 -8.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8031 -9.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3976 -10.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1995 -10.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7939 -11.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5866 -11.1795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5958 -12.2091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1902 -12.7811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9921 -13.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5866 -14.1540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3884 -14.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9829 -15.5269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7847 -16.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9921 -16.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3976 -15.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5958 -15.1837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6050 -16.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0105 -15.6413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7939 -17.3574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3792 -16.8998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1810 -17.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7755 -18.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5774 -19.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7847 -19.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1902 -18.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3884 -17.9295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3976 -18.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5866 -20.1032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.1718 -19.6456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5682 -18.0439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.7663 -17.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1718 -16.6710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5589 -17.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7755 -15.2981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9829 -12.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1810 -11.7515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9737 -11.5227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5682 -12.0947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1718 -10.7218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9645 -10.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1626 -9.6922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9553 -9.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1534 -8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9461 -8.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 8 7 1 4 0 0 0 8 9 2 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 2 0 0 0 0 15 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 21 26 1 0 0 0 0 25 27 1 0 0 0 0 27 28 1 0 0 0 0 24 29 1 0 0 0 0 23 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 31 36 1 0 0 0 0 35 37 1 0 0 0 0 34 38 1 0 0 0 0 33 39 1 0 0 0 0 32 40 1 0 0 0 0 40 41 1 0 0 0 0 41 42 2 0 0 0 0 41 43 1 0 0 0 0 22 44 1 0 0 0 0 18 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 2 0 0 0 0 47 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 1 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 M END > <DATABASE_ID> MMDBc0057094 > <DATABASE_NAME> MIME > <SMILES> CCCCCCCC=CCCCCCC(=O)OC(COC1OC(CO)C(O)C(OC2OC(C)C(N)C(O)C2NC(C)=O)C1O)COC(=O)CCCCCC > <INCHI_IDENTIFIER> InChI=1S/C39H70N2O13/c1-5-7-9-11-12-13-14-15-16-17-18-20-22-31(45)52-28(24-49-30(44)21-19-10-8-6-2)25-50-39-36(48)37(34(46)29(23-42)53-39)54-38-33(41-27(4)43)35(47)32(40)26(3)51-38/h14-15,26,28-29,32-39,42,46-48H,5-13,16-25,40H2,1-4H3,(H,41,43) > <INCHI_KEY> PANDRCFROUDETH-UHFFFAOYSA-N > <FORMULA> C39H70N2O13 > <MOLECULAR_WEIGHT> 774.99 > <EXACT_MASS> 774.487790322 > <JCHEM_ACCEPTOR_COUNT> 12 > <JCHEM_ATOM_COUNT> 124 > <JCHEM_AVERAGE_POLARIZABILITY> 88.50612727663975 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 6 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 1-({4-[(5-amino-3-acetamido-4-hydroxy-6-methyloxan-2-yl)oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl}oxy)-3-(heptanoyloxy)propan-2-yl pentadec-7-enoate > <ALOGPS_LOGP> 4.11 > <JCHEM_LOGP> 4.305807160333334 > <ALOGPS_LOGS> -4.54 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 2 > <JCHEM_PHYSIOLOGICAL_CHARGE> 1 > <JCHEM_PKA> 12.521382244317536 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.981406628677197 > <JCHEM_PKA_STRONGEST_BASIC> 8.792464119308761 > <JCHEM_POLAR_SURFACE_AREA> 225.55999999999997 > <JCHEM_REFRACTIVITY> 198.84720000000007 > <JCHEM_ROTATABLE_BOND_COUNT> 29 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 2.26e-02 g/l > <JCHEM_TRADITIONAL_IUPAC> 1-({4-[(5-amino-3-acetamido-4-hydroxy-6-methyloxan-2-yl)oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl}oxy)-3-(heptanoyloxy)propan-2-yl pentadec-7-enoate > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for #<Metabolite:0x00005634c1c7ae88>HMDB0254121 RDKit 3D Lipoteichoic acid 124125 0 0 0 0 0 0 0 0999 V2000 -2.2055 4.4589 -4.3821 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9245 3.9976 -3.1504 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1052 2.5081 -3.1080 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8231 2.1158 -1.8283 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0280 0.6406 -1.7356 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7008 0.3142 -0.4148 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9420 -1.1908 -0.3135 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6836 -1.9406 -0.4514 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1249 -2.7556 0.4121 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6036 -3.1312 1.7300 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7615 -2.7915 2.9066 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5672 -1.2983 3.1054 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7972 -1.0063 4.3341 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3968 -1.4428 4.4540 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5723 -0.7726 3.5576 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8308 -0.9861 3.7084 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1862 0.0802 2.5763 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0422 0.7876 1.7285 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9903 2.2747 2.2351 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3443 2.7032 2.1681 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8336 3.9459 2.4215 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0390 4.8505 2.7473 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2860 4.2763 2.3211 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5702 5.7380 2.2505 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9344 6.4190 1.0485 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2803 7.9008 1.0447 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6368 8.5226 -0.1661 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1243 8.3738 -0.1732 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7946 0.7812 0.2877 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8501 -0.2559 -0.5269 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1696 -1.3948 -0.4527 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4044 -1.6206 -1.7908 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4849 -0.9297 -2.6456 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0132 -1.2249 -4.0463 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7621 -0.6347 -5.0333 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9400 -1.1293 -2.4051 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5660 -1.6886 -3.5652 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3963 -1.9417 -1.2908 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3453 -2.9525 -1.5843 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0582 -3.3196 -0.4844 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4462 -3.2239 -0.7572 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0231 -3.0922 0.5234 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4585 -2.7344 0.5202 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6662 -4.2744 1.3974 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7409 -4.8344 2.1338 N 0 0 0 0 0 0 0 0 0 0 0 0 5.1498 -5.3641 0.4330 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1538 -5.6321 -0.5061 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8892 -4.8568 -0.2362 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7211 -5.5111 -1.4917 N 0 0 0 0 0 0 0 0 0 0 0 0 2.6142 -6.2823 -1.9095 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5489 -6.9068 -3.2666 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6427 -6.4629 -1.1461 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2028 -2.5694 -0.5156 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5266 -2.9206 0.7536 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4964 5.2571 -4.1019 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5805 3.5827 -4.7295 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8766 4.8077 -5.1931 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9363 4.5026 -3.1602 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3746 4.3522 -2.2601 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2070 1.9263 -3.3206 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8324 2.2535 -3.9364 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8337 2.6048 -1.8284 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1848 2.4309 -0.9817 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5594 0.2121 -2.6102 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0064 0.1851 -1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6510 0.8231 -0.2649 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9285 0.5426 0.3660 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3383 -1.3552 0.6990 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6859 -1.4793 -1.0510 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1265 -1.8150 -1.4119 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1697 -3.2380 0.0958 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6602 -2.8204 1.9278 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6793 -4.2694 1.7244 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3050 -3.1711 3.8135 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8205 -3.3323 2.8377 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5903 -0.8862 3.2491 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1655 -0.8077 2.2223 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3420 -1.3462 5.2526 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7952 0.1270 4.4568 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2770 -2.5593 4.4460 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0639 -1.1706 5.5056 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1075 0.5093 1.9574 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3268 2.2539 3.2833 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6910 2.8967 1.6556 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8092 3.6874 1.5649 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7311 3.9276 3.3085 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6756 5.9058 2.1129 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2919 6.3014 3.1662 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3078 5.9952 0.1055 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8496 6.3358 1.1692 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3878 8.0393 0.9919 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8848 8.4329 1.9288 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8912 9.6014 -0.2806 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9976 8.0404 -1.1152 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2000 7.3375 -0.3443 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2714 9.0025 -0.9919 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2944 8.8035 0.7743 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4710 1.6519 -0.1162 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2577 1.2728 0.1632 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5424 -1.5990 0.3045 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1948 0.1531 -2.4721 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0395 -0.8372 -4.1975 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0757 -2.3082 -4.2609 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5198 0.2933 -5.2535 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4168 -0.1189 -2.3549 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4358 -1.2454 -3.7490 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8557 -1.4208 -0.4056 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8555 -2.8486 0.4558 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4321 -2.2212 0.9611 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9287 -2.6959 -0.4592 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0151 -3.4201 1.2025 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5472 -1.7251 1.0276 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8479 -4.0411 2.1066 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0013 -4.3283 2.9819 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4997 -5.2771 1.6004 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8970 -6.2385 1.0483 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0135 -6.5349 -0.8765 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0649 -5.0511 0.4599 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5228 -5.4106 -2.1898 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4874 -6.9365 -3.6485 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9889 -7.9148 -3.2663 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1620 -6.2557 -3.9410 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7534 -3.3601 -1.0924 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7405 -2.1665 1.3179 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 2 3 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 2 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 18 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 50 52 2 0 38 53 1 0 53 54 1 0 53 31 1 0 48 40 1 0 1 55 1 0 1 56 1 0 1 57 1 0 2 58 1 0 2 59 1 0 3 60 1 0 3 61 1 0 4 62 1 0 4 63 1 0 5 64 1 0 5 65 1 0 6 66 1 0 6 67 1 0 7 68 1 0 7 69 1 0 8 70 1 0 9 71 1 0 10 72 1 0 10 73 1 0 11 74 1 0 11 75 1 0 12 76 1 0 12 77 1 0 13 78 1 0 13 79 1 0 14 80 1 0 14 81 1 0 18 82 1 0 19 83 1 0 19 84 1 0 23 85 1 0 23 86 1 0 24 87 1 0 24 88 1 0 25 89 1 0 25 90 1 0 26 91 1 0 26 92 1 0 27 93 1 0 27 94 1 0 28 95 1 0 28 96 1 0 28 97 1 0 29 98 1 0 29 99 1 0 31100 1 0 33101 1 0 34102 1 0 34103 1 0 35104 1 0 36105 1 0 37106 1 0 38107 1 0 40108 1 0 42109 1 0 43110 1 0 43111 1 0 43112 1 0 44113 1 0 45114 1 0 45115 1 0 46116 1 0 47117 1 0 48118 1 0 49119 1 0 51120 1 0 51121 1 0 51122 1 0 53123 1 0 54124 1 0 M END PDB for #<Metabolite:0x00005634c1c7ae88>HEADER PROTEIN 11-SEP-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 11-SEP-21 0 HETATM 1 C UNK 0 15.994 -5.919 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 15.624 -7.414 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 14.144 -7.841 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 13.775 -9.336 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 12.295 -9.763 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 11.925 -11.258 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 10.445 -11.685 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 10.076 -13.180 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 8.596 -13.607 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 8.226 -15.102 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 9.336 -16.170 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 8.966 -17.665 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 10.076 -18.733 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 9.706 -20.228 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 10.815 -21.295 0.000 0.00 0.00 C+0 HETATM 16 O UNK 0 12.295 -20.868 0.000 0.00 0.00 O+0 HETATM 17 O UNK 0 10.445 -22.790 0.000 0.00 0.00 O+0 HETATM 18 C UNK 0 11.555 -23.858 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 11.185 -25.353 0.000 0.00 0.00 C+0 HETATM 20 O UNK 0 12.295 -26.421 0.000 0.00 0.00 O+0 HETATM 21 C UNK 0 11.925 -27.916 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 13.035 -28.984 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 12.665 -30.478 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 11.185 -30.906 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 10.076 -29.838 0.000 0.00 0.00 C+0 HETATM 26 O UNK 0 10.445 -28.343 0.000 0.00 0.00 O+0 HETATM 27 C UNK 0 8.596 -30.265 0.000 0.00 0.00 C+0 HETATM 28 O UNK 0 7.486 -29.197 0.000 0.00 0.00 O+0 HETATM 29 O UNK 0 10.815 -32.401 0.000 0.00 0.00 O+0 HETATM 30 O UNK 0 13.775 -31.546 0.000 0.00 0.00 O+0 HETATM 31 C UNK 0 13.405 -33.041 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 14.514 -34.109 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 14.144 -35.604 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 12.665 -36.031 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 11.555 -34.963 0.000 0.00 0.00 C+0 HETATM 36 O UNK 0 11.925 -33.468 0.000 0.00 0.00 O+0 HETATM 37 C UNK 0 10.076 -35.390 0.000 0.00 0.00 C+0 HETATM 38 N UNK 0 12.295 -37.526 0.000 0.00 0.00 N+0 HETATM 39 O UNK 0 15.254 -36.672 0.000 0.00 0.00 O+0 HETATM 40 N UNK 0 15.994 -33.682 0.000 0.00 0.00 N+0 HETATM 41 C UNK 0 16.364 -32.187 0.000 0.00 0.00 C+0 HETATM 42 O UNK 0 15.254 -31.119 0.000 0.00 0.00 O+0 HETATM 43 C UNK 0 17.843 -31.760 0.000 0.00 0.00 C+0 HETATM 44 O UNK 0 14.514 -28.556 0.000 0.00 0.00 O+0 HETATM 45 C UNK 0 13.035 -23.431 0.000 0.00 0.00 C+0 HETATM 46 O UNK 0 13.405 -21.936 0.000 0.00 0.00 O+0 HETATM 47 C UNK 0 14.884 -21.509 0.000 0.00 0.00 C+0 HETATM 48 O UNK 0 15.994 -22.577 0.000 0.00 0.00 O+0 HETATM 49 C UNK 0 15.254 -20.014 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 16.734 -19.587 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 17.104 -18.092 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 18.583 -17.665 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 18.953 -16.170 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 20.433 -15.743 0.000 0.00 0.00 C+0 CONECT 1 2 CONECT 2 1 3 CONECT 3 2 4 CONECT 4 3 5 CONECT 5 4 6 CONECT 6 5 7 CONECT 7 6 8 CONECT 8 7 9 CONECT 9 8 10 CONECT 10 9 11 CONECT 11 10 12 CONECT 12 11 13 CONECT 13 12 14 CONECT 14 13 15 CONECT 15 14 16 17 CONECT 16 15 CONECT 17 15 18 CONECT 18 17 19 45 CONECT 19 18 20 CONECT 20 19 21 CONECT 21 20 22 26 CONECT 22 21 23 44 CONECT 23 22 24 30 CONECT 24 23 25 29 CONECT 25 24 26 27 CONECT 26 25 21 CONECT 27 25 28 CONECT 28 27 CONECT 29 24 CONECT 30 23 31 CONECT 31 30 32 36 CONECT 32 31 33 40 CONECT 33 32 34 39 CONECT 34 33 35 38 CONECT 35 34 36 37 CONECT 36 35 31 CONECT 37 35 CONECT 38 34 CONECT 39 33 CONECT 40 32 41 CONECT 41 40 42 43 CONECT 42 41 CONECT 43 41 CONECT 44 22 CONECT 45 18 46 CONECT 46 45 47 CONECT 47 46 48 49 CONECT 48 47 CONECT 49 47 50 CONECT 50 49 51 CONECT 51 50 52 CONECT 52 51 53 CONECT 53 52 54 CONECT 54 53 MASTER 0 0 0 0 0 0 0 0 54 0 110 0 END 3D PDB for #<Metabolite:0x00005634c1c7ae88>COMPND HMDB0254121 HETATM 1 C1 UNL 1 -2.206 4.459 -4.382 1.00 0.00 C HETATM 2 C2 UNL 1 -2.925 3.998 -3.150 1.00 0.00 C HETATM 3 C3 UNL 1 -3.105 2.508 -3.108 1.00 0.00 C HETATM 4 C4 UNL 1 -3.823 2.116 -1.828 1.00 0.00 C HETATM 5 C5 UNL 1 -4.028 0.641 -1.736 1.00 0.00 C HETATM 6 C6 UNL 1 -4.701 0.314 -0.415 1.00 0.00 C HETATM 7 C7 UNL 1 -4.942 -1.191 -0.314 1.00 0.00 C HETATM 8 C8 UNL 1 -3.684 -1.941 -0.451 1.00 0.00 C HETATM 9 C9 UNL 1 -3.125 -2.756 0.412 1.00 0.00 C HETATM 10 C10 UNL 1 -3.604 -3.131 1.730 1.00 0.00 C HETATM 11 C11 UNL 1 -2.761 -2.791 2.907 1.00 0.00 C HETATM 12 C12 UNL 1 -2.567 -1.298 3.105 1.00 0.00 C HETATM 13 C13 UNL 1 -1.797 -1.006 4.334 1.00 0.00 C HETATM 14 C14 UNL 1 -0.397 -1.443 4.454 1.00 0.00 C HETATM 15 C15 UNL 1 0.572 -0.773 3.558 1.00 0.00 C HETATM 16 O1 UNL 1 1.831 -0.986 3.708 1.00 0.00 O HETATM 17 O2 UNL 1 0.186 0.080 2.576 1.00 0.00 O HETATM 18 C16 UNL 1 1.042 0.788 1.728 1.00 0.00 C HETATM 19 C17 UNL 1 0.990 2.275 2.235 1.00 0.00 C HETATM 20 O3 UNL 1 -0.344 2.703 2.168 1.00 0.00 O HETATM 21 C18 UNL 1 -0.834 3.946 2.422 1.00 0.00 C HETATM 22 O4 UNL 1 -0.039 4.850 2.747 1.00 0.00 O HETATM 23 C19 UNL 1 -2.286 4.276 2.321 1.00 0.00 C HETATM 24 C20 UNL 1 -2.570 5.738 2.251 1.00 0.00 C HETATM 25 C21 UNL 1 -1.934 6.419 1.048 1.00 0.00 C HETATM 26 C22 UNL 1 -2.280 7.901 1.045 1.00 0.00 C HETATM 27 C23 UNL 1 -1.637 8.523 -0.166 1.00 0.00 C HETATM 28 C24 UNL 1 -0.124 8.374 -0.173 1.00 0.00 C HETATM 29 C25 UNL 1 0.795 0.781 0.288 1.00 0.00 C HETATM 30 O5 UNL 1 0.850 -0.256 -0.527 1.00 0.00 O HETATM 31 C26 UNL 1 0.170 -1.395 -0.453 1.00 0.00 C HETATM 32 O6 UNL 1 -0.404 -1.621 -1.791 1.00 0.00 O HETATM 33 C27 UNL 1 0.485 -0.930 -2.646 1.00 0.00 C HETATM 34 C28 UNL 1 0.013 -1.225 -4.046 1.00 0.00 C HETATM 35 O7 UNL 1 0.762 -0.635 -5.033 1.00 0.00 O HETATM 36 C29 UNL 1 1.940 -1.129 -2.405 1.00 0.00 C HETATM 37 O8 UNL 1 2.566 -1.689 -3.565 1.00 0.00 O HETATM 38 C30 UNL 1 2.396 -1.942 -1.291 1.00 0.00 C HETATM 39 O9 UNL 1 3.345 -2.952 -1.584 1.00 0.00 O HETATM 40 C31 UNL 1 4.058 -3.320 -0.484 1.00 0.00 C HETATM 41 O10 UNL 1 5.446 -3.224 -0.757 1.00 0.00 O HETATM 42 C32 UNL 1 6.023 -3.092 0.523 1.00 0.00 C HETATM 43 C33 UNL 1 7.459 -2.734 0.520 1.00 0.00 C HETATM 44 C34 UNL 1 5.666 -4.274 1.397 1.00 0.00 C HETATM 45 N1 UNL 1 6.741 -4.834 2.134 1.00 0.00 N HETATM 46 C35 UNL 1 5.150 -5.364 0.433 1.00 0.00 C HETATM 47 O11 UNL 1 6.154 -5.632 -0.506 1.00 0.00 O HETATM 48 C36 UNL 1 3.889 -4.857 -0.236 1.00 0.00 C HETATM 49 N2 UNL 1 3.721 -5.511 -1.492 1.00 0.00 N HETATM 50 C37 UNL 1 2.614 -6.282 -1.909 1.00 0.00 C HETATM 51 C38 UNL 1 2.549 -6.907 -3.267 1.00 0.00 C HETATM 52 O12 UNL 1 1.643 -6.463 -1.146 1.00 0.00 O HETATM 53 C39 UNL 1 1.203 -2.569 -0.516 1.00 0.00 C HETATM 54 O13 UNL 1 1.527 -2.921 0.754 1.00 0.00 O HETATM 55 H1 UNL 1 -1.496 5.257 -4.102 1.00 0.00 H HETATM 56 H2 UNL 1 -1.580 3.583 -4.729 1.00 0.00 H HETATM 57 H3 UNL 1 -2.877 4.808 -5.193 1.00 0.00 H HETATM 58 H4 UNL 1 -3.936 4.503 -3.160 1.00 0.00 H HETATM 59 H5 UNL 1 -2.375 4.352 -2.260 1.00 0.00 H HETATM 60 H6 UNL 1 -2.207 1.926 -3.321 1.00 0.00 H HETATM 61 H7 UNL 1 -3.832 2.253 -3.936 1.00 0.00 H HETATM 62 H8 UNL 1 -4.834 2.605 -1.828 1.00 0.00 H HETATM 63 H9 UNL 1 -3.185 2.431 -0.982 1.00 0.00 H HETATM 64 H10 UNL 1 -4.559 0.212 -2.610 1.00 0.00 H HETATM 65 H11 UNL 1 -3.006 0.185 -1.664 1.00 0.00 H HETATM 66 H12 UNL 1 -5.651 0.823 -0.265 1.00 0.00 H HETATM 67 H13 UNL 1 -3.929 0.543 0.366 1.00 0.00 H HETATM 68 H14 UNL 1 -5.338 -1.355 0.699 1.00 0.00 H HETATM 69 H15 UNL 1 -5.686 -1.479 -1.051 1.00 0.00 H HETATM 70 H16 UNL 1 -3.127 -1.815 -1.412 1.00 0.00 H HETATM 71 H17 UNL 1 -2.170 -3.238 0.096 1.00 0.00 H HETATM 72 H18 UNL 1 -4.660 -2.820 1.928 1.00 0.00 H HETATM 73 H19 UNL 1 -3.679 -4.269 1.724 1.00 0.00 H HETATM 74 H20 UNL 1 -3.305 -3.171 3.813 1.00 0.00 H HETATM 75 H21 UNL 1 -1.821 -3.332 2.838 1.00 0.00 H HETATM 76 H22 UNL 1 -3.590 -0.886 3.249 1.00 0.00 H HETATM 77 H23 UNL 1 -2.166 -0.808 2.222 1.00 0.00 H HETATM 78 H24 UNL 1 -2.342 -1.346 5.253 1.00 0.00 H HETATM 79 H25 UNL 1 -1.795 0.127 4.457 1.00 0.00 H HETATM 80 H26 UNL 1 -0.277 -2.559 4.446 1.00 0.00 H HETATM 81 H27 UNL 1 -0.064 -1.171 5.506 1.00 0.00 H HETATM 82 H28 UNL 1 2.107 0.509 1.957 1.00 0.00 H HETATM 83 H29 UNL 1 1.327 2.254 3.283 1.00 0.00 H HETATM 84 H30 UNL 1 1.691 2.897 1.656 1.00 0.00 H HETATM 85 H31 UNL 1 -2.809 3.687 1.565 1.00 0.00 H HETATM 86 H32 UNL 1 -2.731 3.928 3.309 1.00 0.00 H HETATM 87 H33 UNL 1 -3.676 5.906 2.113 1.00 0.00 H HETATM 88 H34 UNL 1 -2.292 6.301 3.166 1.00 0.00 H HETATM 89 H35 UNL 1 -2.308 5.995 0.106 1.00 0.00 H HETATM 90 H36 UNL 1 -0.850 6.336 1.169 1.00 0.00 H HETATM 91 H37 UNL 1 -3.388 8.039 0.992 1.00 0.00 H HETATM 92 H38 UNL 1 -1.885 8.433 1.929 1.00 0.00 H HETATM 93 H39 UNL 1 -1.891 9.601 -0.281 1.00 0.00 H HETATM 94 H40 UNL 1 -1.998 8.040 -1.115 1.00 0.00 H HETATM 95 H41 UNL 1 0.200 7.337 -0.344 1.00 0.00 H HETATM 96 H42 UNL 1 0.271 9.003 -0.992 1.00 0.00 H HETATM 97 H43 UNL 1 0.294 8.803 0.774 1.00 0.00 H HETATM 98 H44 UNL 1 1.471 1.652 -0.116 1.00 0.00 H HETATM 99 H45 UNL 1 -0.258 1.273 0.163 1.00 0.00 H HETATM 100 H46 UNL 1 -0.542 -1.599 0.304 1.00 0.00 H HETATM 101 H47 UNL 1 0.195 0.153 -2.472 1.00 0.00 H HETATM 102 H48 UNL 1 -1.040 -0.837 -4.197 1.00 0.00 H HETATM 103 H49 UNL 1 -0.076 -2.308 -4.261 1.00 0.00 H HETATM 104 H50 UNL 1 0.520 0.293 -5.254 1.00 0.00 H HETATM 105 H51 UNL 1 2.417 -0.119 -2.355 1.00 0.00 H HETATM 106 H52 UNL 1 3.436 -1.245 -3.749 1.00 0.00 H HETATM 107 H53 UNL 1 2.856 -1.421 -0.406 1.00 0.00 H HETATM 108 H54 UNL 1 3.855 -2.849 0.456 1.00 0.00 H HETATM 109 H55 UNL 1 5.432 -2.221 0.961 1.00 0.00 H HETATM 110 H56 UNL 1 7.929 -2.696 -0.459 1.00 0.00 H HETATM 111 H57 UNL 1 8.015 -3.420 1.202 1.00 0.00 H HETATM 112 H58 UNL 1 7.547 -1.725 1.028 1.00 0.00 H HETATM 113 H59 UNL 1 4.848 -4.041 2.107 1.00 0.00 H HETATM 114 H60 UNL 1 7.001 -4.328 2.982 1.00 0.00 H HETATM 115 H61 UNL 1 7.500 -5.277 1.600 1.00 0.00 H HETATM 116 H62 UNL 1 4.897 -6.239 1.048 1.00 0.00 H HETATM 117 H63 UNL 1 6.014 -6.535 -0.877 1.00 0.00 H HETATM 118 H64 UNL 1 3.065 -5.051 0.460 1.00 0.00 H HETATM 119 H65 UNL 1 4.523 -5.411 -2.190 1.00 0.00 H HETATM 120 H66 UNL 1 1.487 -6.937 -3.649 1.00 0.00 H HETATM 121 H67 UNL 1 2.989 -7.915 -3.266 1.00 0.00 H HETATM 122 H68 UNL 1 3.162 -6.256 -3.941 1.00 0.00 H HETATM 123 H69 UNL 1 0.753 -3.360 -1.092 1.00 0.00 H HETATM 124 H70 UNL 1 1.740 -2.167 1.318 1.00 0.00 H CONECT 1 2 55 56 57 CONECT 2 3 58 59 CONECT 3 4 60 61 CONECT 4 5 62 63 CONECT 5 6 64 65 CONECT 6 7 66 67 CONECT 7 8 68 69 CONECT 8 9 9 70 CONECT 9 10 71 CONECT 10 11 72 73 CONECT 11 12 74 75 CONECT 12 13 76 77 CONECT 13 14 78 79 CONECT 14 15 80 81 CONECT 15 16 16 17 CONECT 17 18 CONECT 18 19 29 82 CONECT 19 20 83 84 CONECT 20 21 CONECT 21 22 22 23 CONECT 23 24 85 86 CONECT 24 25 87 88 CONECT 25 26 89 90 CONECT 26 27 91 92 CONECT 27 28 93 94 CONECT 28 95 96 97 CONECT 29 30 98 99 CONECT 30 31 CONECT 31 32 53 100 CONECT 32 33 CONECT 33 34 36 101 CONECT 34 35 102 103 CONECT 35 104 CONECT 36 37 38 105 CONECT 37 106 CONECT 38 39 53 107 CONECT 39 40 CONECT 40 41 48 108 CONECT 41 42 CONECT 42 43 44 109 CONECT 43 110 111 112 CONECT 44 45 46 113 CONECT 45 114 115 CONECT 46 47 48 116 CONECT 47 117 CONECT 48 49 118 CONECT 49 50 119 CONECT 50 51 52 52 CONECT 51 120 121 122 CONECT 53 54 123 CONECT 54 124 END SMILES for #<Metabolite:0x00005634c1c7ae88>CCCCCCCC=CCCCCCC(=O)OC(COC1OC(CO)C(O)C(OC2OC(C)C(N)C(O)C2NC(C)=O)C1O)COC(=O)CCCCCC INCHI for #<Metabolite:0x00005634c1c7ae88>InChI=1S/C39H70N2O13/c1-5-7-9-11-12-13-14-15-16-17-18-20-22-31(45)52-28(24-49-30(44)21-19-10-8-6-2)25-50-39-36(48)37(34(46)29(23-42)53-39)54-38-33(41-27(4)43)35(47)32(40)26(3)51-38/h14-15,26,28-29,32-39,42,46-48H,5-13,16-25,40H2,1-4H3,(H,41,43) 3D Structure for #<Metabolite:0x00005634c1c7ae88> | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Formula | C39H70N2O13 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 774.99 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 774.487790322 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 1-({4-[(5-amino-3-acetamido-4-hydroxy-6-methyloxan-2-yl)oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl}oxy)-3-(heptanoyloxy)propan-2-yl pentadec-7-enoate | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 1-({4-[(5-amino-3-acetamido-4-hydroxy-6-methyloxan-2-yl)oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl}oxy)-3-(heptanoyloxy)propan-2-yl pentadec-7-enoate | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CCCCCCCC=CCCCCCC(=O)OC(COC1OC(CO)C(O)C(OC2OC(C)C(N)C(O)C2NC(C)=O)C1O)COC(=O)CCCCCC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C39H70N2O13/c1-5-7-9-11-12-13-14-15-16-17-18-20-22-31(45)52-28(24-49-30(44)21-19-10-8-6-2)25-50-39-36(48)37(34(46)29(23-42)53-39)54-38-33(41-27(4)43)35(47)32(40)26(3)51-38/h14-15,26,28-29,32-39,42,46-48H,5-13,16-25,40H2,1-4H3,(H,41,43) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | PANDRCFROUDETH-UHFFFAOYSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as acylaminosugars. These are organic compounds containing a sugar linked to a chain through N-acyl group. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Organic oxygen compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Organooxygen compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Carbohydrates and carbohydrate conjugates | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Acylaminosugars | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteromonocyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Functional Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Proteins and Enzymes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Pathways | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolic Reactions | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Health Effects and Bioactivity | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Microbial Sources | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Exposure Sources | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Host Biospecimen and Location | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0254121 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 155886516 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|