Showing metabocard for Cholylphenylalanine (MMDBc0057216)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 1.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected and Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2022-11-10 23:32:13 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2024-04-30 20:56:27 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite ID | MMDBc0057216 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Cholylphenylalanine | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | NULL | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for #<Metabolite:0x00007fec8de00840>Mrv1652308302118192D 40 44 0 0 0 0 999 V2000 9.2792 -3.2680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5648 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8503 -3.2680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5648 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8503 -1.6180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.1358 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1358 -2.8555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4214 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7069 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9924 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9924 -0.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2780 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1917 -2.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3847 -3.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9722 -2.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1653 -2.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6132 -2.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8682 -3.5342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8063 -2.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5513 -1.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2556 -1.6219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5106 -0.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3176 -0.6658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0414 -0.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8484 -0.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1034 -1.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6554 -0.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9103 -1.3519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4624 -0.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2693 -0.9103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8214 -0.2972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5243 -1.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1374 -1.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2792 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9937 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7082 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4227 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4227 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7082 -3.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9937 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 10 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 22 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 20 26 1 0 0 0 0 26 27 1 0 0 0 0 26 28 1 0 0 0 0 16 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 30 32 1 0 0 0 0 12 32 1 0 0 0 0 15 32 1 0 0 0 0 32 33 1 0 0 0 0 4 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 36 37 2 0 0 0 0 37 38 1 0 0 0 0 38 39 2 0 0 0 0 39 40 1 0 0 0 0 35 40 2 0 0 0 0 M END 3D MOL for #<Metabolite:0x00007fec8de00840>HMDB0242371 RDKit 3D Cholylphenylalanine 89 93 0 0 0 0 0 0 0 0999 V2000 1.9698 1.8771 1.9760 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1796 1.0831 0.9038 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9518 -0.1779 0.7139 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3606 0.2709 0.2602 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2011 -0.9279 0.0450 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7073 -2.0582 0.2385 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5423 -0.7872 -0.3731 N 0 0 0 0 0 0 0 0 0 0 0 0 6.4257 -1.9064 -0.6037 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6021 -1.8647 0.3142 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3616 -0.6174 0.0951 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3843 -0.5479 -0.8107 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1176 0.6086 -1.0414 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8089 1.7430 -0.3310 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7794 1.7072 0.5937 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0698 0.5437 0.8003 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8253 -1.9607 -2.0353 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3927 -1.1038 -2.8217 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6698 -2.9412 -2.5278 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1861 0.9871 1.4180 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4022 0.3019 2.7299 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9002 -0.0628 2.7587 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3986 0.6076 1.5151 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7247 0.2836 1.0142 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4249 -0.8631 1.6623 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3247 -0.3865 2.6478 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3015 -1.5331 0.6151 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0982 -0.5015 -0.1620 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1068 -1.2336 -0.9763 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7684 -0.3762 -2.0217 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5941 0.5964 -1.4381 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7496 0.2437 -2.9168 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3285 0.1193 -2.4266 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1999 0.4200 -0.9464 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6606 1.8281 -0.7136 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7828 0.1510 -0.5115 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8190 1.0929 -1.1954 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4097 0.8755 -0.7708 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7383 0.0401 -1.6916 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2250 0.2935 0.5725 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9572 -1.1847 0.5403 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3336 1.1254 2.7044 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7520 2.4922 1.5157 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2714 2.5343 2.5472 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2462 1.6968 -0.0140 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1060 -0.7591 1.6303 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5421 -0.7641 -0.1407 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8592 0.8438 1.0820 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3076 0.8384 -0.6847 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9539 0.1714 -0.5354 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8837 -2.8627 -0.4007 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2201 -1.8835 1.3545 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2183 -2.7690 0.1512 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6430 -1.4209 -1.3757 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9189 0.6252 -1.7653 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3742 2.6510 -0.5028 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5726 2.6305 1.1314 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2610 0.5488 1.5391 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3638 -3.3965 -1.9213 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6307 2.0364 1.5750 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2360 1.0444 3.5651 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2439 -0.5449 2.9467 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9543 -1.1503 2.7731 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3796 0.3205 3.6734 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3012 1.7182 1.7023 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3959 1.1831 1.2056 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7989 -1.6266 2.1221 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3904 0.5980 2.5468 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0653 -2.1260 1.1960 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7733 -2.2523 -0.0080 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6666 0.0810 0.6208 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6559 -2.1069 -1.4746 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9169 -1.5755 -0.2696 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4495 -1.0434 -2.6065 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5651 1.3882 -2.0588 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7724 -0.2531 -3.9247 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9772 1.3280 -3.1319 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8807 -0.8415 -2.6771 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7669 0.9261 -2.9845 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9506 2.3315 -1.6832 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5441 1.8688 -0.0098 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9070 2.4948 -0.2541 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5318 -0.8737 -0.8471 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0836 2.1567 -1.0810 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8717 0.8381 -2.2839 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8681 1.8568 -0.8466 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2431 0.0619 -2.5431 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8715 -1.7866 0.7511 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6721 -1.4558 -0.4861 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1999 -1.5375 1.2312 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 2 0 8 16 1 0 16 17 2 0 16 18 1 0 2 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 37 39 1 0 39 40 1 0 15 10 1 0 39 19 1 0 39 22 1 0 35 23 1 0 33 27 1 0 1 41 1 0 1 42 1 0 1 43 1 0 2 44 1 0 3 45 1 0 3 46 1 0 4 47 1 0 4 48 1 0 7 49 1 0 8 50 1 0 9 51 1 0 9 52 1 0 11 53 1 0 12 54 1 0 13 55 1 0 14 56 1 0 15 57 1 0 18 58 1 0 19 59 1 0 20 60 1 0 20 61 1 0 21 62 1 0 21 63 1 0 22 64 1 0 23 65 1 0 24 66 1 0 25 67 1 0 26 68 1 0 26 69 1 0 27 70 1 0 28 71 1 0 28 72 1 0 29 73 1 0 30 74 1 0 31 75 1 0 31 76 1 0 32 77 1 0 32 78 1 0 34 79 1 0 34 80 1 0 34 81 1 0 35 82 1 0 36 83 1 0 36 84 1 0 37 85 1 0 38 86 1 0 40 87 1 0 40 88 1 0 40 89 1 0 M END 3D SDF for #<Metabolite:0x00007fec8de00840>Mrv1652308302118192D 40 44 0 0 0 0 999 V2000 9.2792 -3.2680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5648 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8503 -3.2680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5648 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8503 -1.6180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.1358 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1358 -2.8555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4214 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7069 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9924 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9924 -0.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2780 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1917 -2.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3847 -3.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9722 -2.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1653 -2.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6132 -2.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8682 -3.5342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8063 -2.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5513 -1.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2556 -1.6219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5106 -0.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3176 -0.6658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0414 -0.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8484 -0.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1034 -1.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6554 -0.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9103 -1.3519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4624 -0.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2693 -0.9103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8214 -0.2972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5243 -1.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1374 -1.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2792 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9937 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7082 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4227 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4227 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7082 -3.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9937 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 10 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 22 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 20 26 1 0 0 0 0 26 27 1 0 0 0 0 26 28 1 0 0 0 0 16 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 30 32 1 0 0 0 0 12 32 1 0 0 0 0 15 32 1 0 0 0 0 32 33 1 0 0 0 0 4 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 36 37 2 0 0 0 0 37 38 1 0 0 0 0 38 39 2 0 0 0 0 39 40 1 0 0 0 0 35 40 2 0 0 0 0 M END > <DATABASE_ID> MMDBc0057216 > <DATABASE_NAME> MIME > <SMILES> CC(CCC(=O)NC(CC1=CC=CC=C1)C(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C > <INCHI_IDENTIFIER> InChI=1S/C33H49NO6/c1-19(9-12-29(38)34-26(31(39)40)15-20-7-5-4-6-8-20)23-10-11-24-30-25(18-28(37)33(23,24)3)32(2)14-13-22(35)16-21(32)17-27(30)36/h4-8,19,21-28,30,35-37H,9-18H2,1-3H3,(H,34,38)(H,39,40) > <INCHI_KEY> IQKZHEVJCMKOED-UHFFFAOYSA-N > <FORMULA> C33H49NO6 > <MOLECULAR_WEIGHT> 555.756 > <EXACT_MASS> 555.355988302 > <JCHEM_ACCEPTOR_COUNT> 6 > <JCHEM_ATOM_COUNT> 89 > <JCHEM_AVERAGE_POLARIZABILITY> 63.19305046655761 > <JCHEM_BIOAVAILABILITY> 1 > <JCHEM_DONOR_COUNT> 5 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 3-phenyl-2-(4-{5,9,16-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)propanoic acid > <ALOGPS_LOGP> 2.74 > <JCHEM_LOGP> 3.602301826999999 > <ALOGPS_LOGS> -5.24 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 5 > <JCHEM_PHYSIOLOGICAL_CHARGE> -1 > <JCHEM_PKA> 14.112332228190539 > <JCHEM_PKA_STRONGEST_ACIDIC> 3.9003745687037545 > <JCHEM_PKA_STRONGEST_BASIC> -0.13203270659569355 > <JCHEM_POLAR_SURFACE_AREA> 127.09000000000002 > <JCHEM_REFRACTIVITY> 152.70569999999992 > <JCHEM_ROTATABLE_BOND_COUNT> 8 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 3.23e-03 g/l > <JCHEM_TRADITIONAL_IUPAC> 3-phenyl-2-(4-{5,9,16-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)propanoic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for #<Metabolite:0x00007fec8de00840>HMDB0242371 RDKit 3D Cholylphenylalanine 89 93 0 0 0 0 0 0 0 0999 V2000 1.9698 1.8771 1.9760 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1796 1.0831 0.9038 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9518 -0.1779 0.7139 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3606 0.2709 0.2602 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2011 -0.9279 0.0450 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7073 -2.0582 0.2385 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5423 -0.7872 -0.3731 N 0 0 0 0 0 0 0 0 0 0 0 0 6.4257 -1.9064 -0.6037 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6021 -1.8647 0.3142 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3616 -0.6174 0.0951 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3843 -0.5479 -0.8107 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1176 0.6086 -1.0414 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8089 1.7430 -0.3310 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7794 1.7072 0.5937 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0698 0.5437 0.8003 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8253 -1.9607 -2.0353 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3927 -1.1038 -2.8217 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6698 -2.9412 -2.5278 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1861 0.9871 1.4180 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4022 0.3019 2.7299 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9002 -0.0628 2.7587 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3986 0.6076 1.5151 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7247 0.2836 1.0142 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4249 -0.8631 1.6623 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3247 -0.3865 2.6478 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3015 -1.5331 0.6151 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0982 -0.5015 -0.1620 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1068 -1.2336 -0.9763 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7684 -0.3762 -2.0217 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5941 0.5964 -1.4381 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7496 0.2437 -2.9168 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3285 0.1193 -2.4266 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1999 0.4200 -0.9464 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6606 1.8281 -0.7136 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7828 0.1510 -0.5115 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8190 1.0929 -1.1954 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4097 0.8755 -0.7708 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7383 0.0401 -1.6916 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2250 0.2935 0.5725 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9572 -1.1847 0.5403 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3336 1.1254 2.7044 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7520 2.4922 1.5157 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2714 2.5343 2.5472 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2462 1.6968 -0.0140 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1060 -0.7591 1.6303 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5421 -0.7641 -0.1407 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8592 0.8438 1.0820 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3076 0.8384 -0.6847 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9539 0.1714 -0.5354 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8837 -2.8627 -0.4007 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2201 -1.8835 1.3545 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2183 -2.7690 0.1512 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6430 -1.4209 -1.3757 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9189 0.6252 -1.7653 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3742 2.6510 -0.5028 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5726 2.6305 1.1314 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2610 0.5488 1.5391 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3638 -3.3965 -1.9213 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6307 2.0364 1.5750 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2360 1.0444 3.5651 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2439 -0.5449 2.9467 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9543 -1.1503 2.7731 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3796 0.3205 3.6734 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3012 1.7182 1.7023 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3959 1.1831 1.2056 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7989 -1.6266 2.1221 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3904 0.5980 2.5468 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0653 -2.1260 1.1960 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7733 -2.2523 -0.0080 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6666 0.0810 0.6208 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6559 -2.1069 -1.4746 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9169 -1.5755 -0.2696 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4495 -1.0434 -2.6065 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5651 1.3882 -2.0588 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7724 -0.2531 -3.9247 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9772 1.3280 -3.1319 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8807 -0.8415 -2.6771 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7669 0.9261 -2.9845 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9506 2.3315 -1.6832 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5441 1.8688 -0.0098 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9070 2.4948 -0.2541 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5318 -0.8737 -0.8471 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0836 2.1567 -1.0810 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8717 0.8381 -2.2839 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8681 1.8568 -0.8466 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2431 0.0619 -2.5431 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8715 -1.7866 0.7511 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6721 -1.4558 -0.4861 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1999 -1.5375 1.2312 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 2 0 8 16 1 0 16 17 2 0 16 18 1 0 2 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 37 39 1 0 39 40 1 0 15 10 1 0 39 19 1 0 39 22 1 0 35 23 1 0 33 27 1 0 1 41 1 0 1 42 1 0 1 43 1 0 2 44 1 0 3 45 1 0 3 46 1 0 4 47 1 0 4 48 1 0 7 49 1 0 8 50 1 0 9 51 1 0 9 52 1 0 11 53 1 0 12 54 1 0 13 55 1 0 14 56 1 0 15 57 1 0 18 58 1 0 19 59 1 0 20 60 1 0 20 61 1 0 21 62 1 0 21 63 1 0 22 64 1 0 23 65 1 0 24 66 1 0 25 67 1 0 26 68 1 0 26 69 1 0 27 70 1 0 28 71 1 0 28 72 1 0 29 73 1 0 30 74 1 0 31 75 1 0 31 76 1 0 32 77 1 0 32 78 1 0 34 79 1 0 34 80 1 0 34 81 1 0 35 82 1 0 36 83 1 0 36 84 1 0 37 85 1 0 38 86 1 0 40 87 1 0 40 88 1 0 40 89 1 0 M END PDB for #<Metabolite:0x00007fec8de00840>HEADER PROTEIN 30-AUG-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 30-AUG-21 0 HETATM 1 O UNK 0 17.321 -6.100 0.000 0.00 0.00 O+0 HETATM 2 C UNK 0 15.988 -5.330 0.000 0.00 0.00 C+0 HETATM 3 O UNK 0 14.654 -6.100 0.000 0.00 0.00 O+0 HETATM 4 C UNK 0 15.988 -3.790 0.000 0.00 0.00 C+0 HETATM 5 N UNK 0 14.654 -3.020 0.000 0.00 0.00 N+0 HETATM 6 C UNK 0 13.320 -3.790 0.000 0.00 0.00 C+0 HETATM 7 O UNK 0 13.320 -5.330 0.000 0.00 0.00 O+0 HETATM 8 C UNK 0 11.987 -3.020 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 10.653 -3.790 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 9.319 -3.020 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 9.319 -1.480 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 7.986 -3.790 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 7.825 -5.322 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 6.318 -5.642 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 5.548 -4.308 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 4.042 -3.988 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 3.011 -5.133 0.000 0.00 0.00 C+0 HETATM 18 O UNK 0 3.487 -6.597 0.000 0.00 0.00 O+0 HETATM 19 C UNK 0 1.505 -4.812 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 1.029 -3.348 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -0.477 -3.028 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 -0.953 -1.563 0.000 0.00 0.00 C+0 HETATM 23 O UNK 0 -2.459 -1.243 0.000 0.00 0.00 O+0 HETATM 24 C UNK 0 0.077 -0.419 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 1.584 -0.739 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 2.060 -2.203 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 3.090 -1.059 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 3.566 -2.524 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 4.596 -1.379 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 6.103 -1.699 0.000 0.00 0.00 C+0 HETATM 31 O UNK 0 7.133 -0.555 0.000 0.00 0.00 O+0 HETATM 32 C UNK 0 6.579 -3.164 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 7.723 -2.133 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 17.321 -3.020 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 18.655 -3.790 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 19.989 -3.020 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 21.322 -3.790 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 21.322 -5.330 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 19.989 -6.100 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 18.655 -5.330 0.000 0.00 0.00 C+0 CONECT 1 2 CONECT 2 1 3 4 CONECT 3 2 CONECT 4 2 5 34 CONECT 5 4 6 CONECT 6 5 7 8 CONECT 7 6 CONECT 8 6 9 CONECT 9 8 10 CONECT 10 9 11 12 CONECT 11 10 CONECT 12 10 13 32 CONECT 13 12 14 CONECT 14 13 15 CONECT 15 14 16 32 CONECT 16 15 17 28 CONECT 17 16 18 19 CONECT 18 17 CONECT 19 17 20 CONECT 20 19 21 26 CONECT 21 20 22 CONECT 22 21 23 24 CONECT 23 22 CONECT 24 22 25 CONECT 25 24 26 CONECT 26 25 20 27 28 CONECT 27 26 CONECT 28 26 16 29 CONECT 29 28 30 CONECT 30 29 31 32 CONECT 31 30 CONECT 32 30 12 15 33 CONECT 33 32 CONECT 34 4 35 CONECT 35 34 36 40 CONECT 36 35 37 CONECT 37 36 38 CONECT 38 37 39 CONECT 39 38 40 CONECT 40 39 35 MASTER 0 0 0 0 0 0 0 0 40 0 88 0 END 3D PDB for #<Metabolite:0x00007fec8de00840>COMPND HMDB0242371 HETATM 1 C1 UNL 1 1.970 1.877 1.976 1.00 0.00 C HETATM 2 C2 UNL 1 1.180 1.083 0.904 1.00 0.00 C HETATM 3 C3 UNL 1 1.952 -0.178 0.714 1.00 0.00 C HETATM 4 C4 UNL 1 3.361 0.271 0.260 1.00 0.00 C HETATM 5 C5 UNL 1 4.201 -0.928 0.045 1.00 0.00 C HETATM 6 O1 UNL 1 3.707 -2.058 0.239 1.00 0.00 O HETATM 7 N1 UNL 1 5.542 -0.787 -0.373 1.00 0.00 N HETATM 8 C6 UNL 1 6.426 -1.906 -0.604 1.00 0.00 C HETATM 9 C7 UNL 1 7.602 -1.865 0.314 1.00 0.00 C HETATM 10 C8 UNL 1 8.362 -0.617 0.095 1.00 0.00 C HETATM 11 C9 UNL 1 9.384 -0.548 -0.811 1.00 0.00 C HETATM 12 C10 UNL 1 10.118 0.609 -1.041 1.00 0.00 C HETATM 13 C11 UNL 1 9.809 1.743 -0.331 1.00 0.00 C HETATM 14 C12 UNL 1 8.779 1.707 0.594 1.00 0.00 C HETATM 15 C13 UNL 1 8.070 0.544 0.800 1.00 0.00 C HETATM 16 C14 UNL 1 6.825 -1.961 -2.035 1.00 0.00 C HETATM 17 O2 UNL 1 6.393 -1.104 -2.822 1.00 0.00 O HETATM 18 O3 UNL 1 7.670 -2.941 -2.528 1.00 0.00 O HETATM 19 C15 UNL 1 -0.186 0.987 1.418 1.00 0.00 C HETATM 20 C16 UNL 1 -0.402 0.302 2.730 1.00 0.00 C HETATM 21 C17 UNL 1 -1.900 -0.063 2.759 1.00 0.00 C HETATM 22 C18 UNL 1 -2.399 0.608 1.515 1.00 0.00 C HETATM 23 C19 UNL 1 -3.725 0.284 1.014 1.00 0.00 C HETATM 24 C20 UNL 1 -4.425 -0.863 1.662 1.00 0.00 C HETATM 25 O4 UNL 1 -5.325 -0.386 2.648 1.00 0.00 O HETATM 26 C21 UNL 1 -5.301 -1.533 0.615 1.00 0.00 C HETATM 27 C22 UNL 1 -6.098 -0.502 -0.162 1.00 0.00 C HETATM 28 C23 UNL 1 -7.107 -1.234 -0.976 1.00 0.00 C HETATM 29 C24 UNL 1 -7.768 -0.376 -2.022 1.00 0.00 C HETATM 30 O5 UNL 1 -8.594 0.596 -1.438 1.00 0.00 O HETATM 31 C25 UNL 1 -6.750 0.244 -2.917 1.00 0.00 C HETATM 32 C26 UNL 1 -5.329 0.119 -2.427 1.00 0.00 C HETATM 33 C27 UNL 1 -5.200 0.420 -0.946 1.00 0.00 C HETATM 34 C28 UNL 1 -5.661 1.828 -0.714 1.00 0.00 C HETATM 35 C29 UNL 1 -3.783 0.151 -0.512 1.00 0.00 C HETATM 36 C30 UNL 1 -2.819 1.093 -1.195 1.00 0.00 C HETATM 37 C31 UNL 1 -1.410 0.876 -0.771 1.00 0.00 C HETATM 38 O6 UNL 1 -0.738 0.040 -1.692 1.00 0.00 O HETATM 39 C32 UNL 1 -1.225 0.293 0.573 1.00 0.00 C HETATM 40 C33 UNL 1 -0.957 -1.185 0.540 1.00 0.00 C HETATM 41 H1 UNL 1 2.334 1.125 2.704 1.00 0.00 H HETATM 42 H2 UNL 1 2.752 2.492 1.516 1.00 0.00 H HETATM 43 H3 UNL 1 1.271 2.534 2.547 1.00 0.00 H HETATM 44 H4 UNL 1 1.246 1.697 -0.014 1.00 0.00 H HETATM 45 H5 UNL 1 2.106 -0.759 1.630 1.00 0.00 H HETATM 46 H6 UNL 1 1.542 -0.764 -0.141 1.00 0.00 H HETATM 47 H7 UNL 1 3.859 0.844 1.082 1.00 0.00 H HETATM 48 H8 UNL 1 3.308 0.838 -0.685 1.00 0.00 H HETATM 49 H9 UNL 1 5.954 0.171 -0.535 1.00 0.00 H HETATM 50 H10 UNL 1 5.884 -2.863 -0.401 1.00 0.00 H HETATM 51 H11 UNL 1 7.220 -1.884 1.355 1.00 0.00 H HETATM 52 H12 UNL 1 8.218 -2.769 0.151 1.00 0.00 H HETATM 53 H13 UNL 1 9.643 -1.421 -1.376 1.00 0.00 H HETATM 54 H14 UNL 1 10.919 0.625 -1.765 1.00 0.00 H HETATM 55 H15 UNL 1 10.374 2.651 -0.503 1.00 0.00 H HETATM 56 H16 UNL 1 8.573 2.630 1.131 1.00 0.00 H HETATM 57 H17 UNL 1 7.261 0.549 1.539 1.00 0.00 H HETATM 58 H18 UNL 1 8.364 -3.397 -1.921 1.00 0.00 H HETATM 59 H19 UNL 1 -0.631 2.036 1.575 1.00 0.00 H HETATM 60 H20 UNL 1 -0.236 1.044 3.565 1.00 0.00 H HETATM 61 H21 UNL 1 0.244 -0.545 2.947 1.00 0.00 H HETATM 62 H22 UNL 1 -1.954 -1.150 2.773 1.00 0.00 H HETATM 63 H23 UNL 1 -2.380 0.321 3.673 1.00 0.00 H HETATM 64 H24 UNL 1 -2.301 1.718 1.702 1.00 0.00 H HETATM 65 H25 UNL 1 -4.396 1.183 1.206 1.00 0.00 H HETATM 66 H26 UNL 1 -3.799 -1.627 2.122 1.00 0.00 H HETATM 67 H27 UNL 1 -5.390 0.598 2.547 1.00 0.00 H HETATM 68 H28 UNL 1 -6.065 -2.126 1.196 1.00 0.00 H HETATM 69 H29 UNL 1 -4.773 -2.252 -0.008 1.00 0.00 H HETATM 70 H30 UNL 1 -6.667 0.081 0.621 1.00 0.00 H HETATM 71 H31 UNL 1 -6.656 -2.107 -1.475 1.00 0.00 H HETATM 72 H32 UNL 1 -7.917 -1.575 -0.270 1.00 0.00 H HETATM 73 H33 UNL 1 -8.449 -1.043 -2.607 1.00 0.00 H HETATM 74 H34 UNL 1 -8.565 1.388 -2.059 1.00 0.00 H HETATM 75 H35 UNL 1 -6.772 -0.253 -3.925 1.00 0.00 H HETATM 76 H36 UNL 1 -6.977 1.328 -3.132 1.00 0.00 H HETATM 77 H37 UNL 1 -4.881 -0.842 -2.677 1.00 0.00 H HETATM 78 H38 UNL 1 -4.767 0.926 -2.985 1.00 0.00 H HETATM 79 H39 UNL 1 -5.951 2.331 -1.683 1.00 0.00 H HETATM 80 H40 UNL 1 -6.544 1.869 -0.010 1.00 0.00 H HETATM 81 H41 UNL 1 -4.907 2.495 -0.254 1.00 0.00 H HETATM 82 H42 UNL 1 -3.532 -0.874 -0.847 1.00 0.00 H HETATM 83 H43 UNL 1 -3.084 2.157 -1.081 1.00 0.00 H HETATM 84 H44 UNL 1 -2.872 0.838 -2.284 1.00 0.00 H HETATM 85 H45 UNL 1 -0.868 1.857 -0.847 1.00 0.00 H HETATM 86 H46 UNL 1 -1.243 0.062 -2.543 1.00 0.00 H HETATM 87 H47 UNL 1 -1.871 -1.787 0.751 1.00 0.00 H HETATM 88 H48 UNL 1 -0.672 -1.456 -0.486 1.00 0.00 H HETATM 89 H49 UNL 1 -0.200 -1.537 1.231 1.00 0.00 H CONECT 1 2 41 42 43 CONECT 2 3 19 44 CONECT 3 4 45 46 CONECT 4 5 47 48 CONECT 5 6 6 7 CONECT 7 8 49 CONECT 8 9 16 50 CONECT 9 10 51 52 CONECT 10 11 11 15 CONECT 11 12 53 CONECT 12 13 13 54 CONECT 13 14 55 CONECT 14 15 15 56 CONECT 15 57 CONECT 16 17 17 18 CONECT 18 58 CONECT 19 20 39 59 CONECT 20 21 60 61 CONECT 21 22 62 63 CONECT 22 23 39 64 CONECT 23 24 35 65 CONECT 24 25 26 66 CONECT 25 67 CONECT 26 27 68 69 CONECT 27 28 33 70 CONECT 28 29 71 72 CONECT 29 30 31 73 CONECT 30 74 CONECT 31 32 75 76 CONECT 32 33 77 78 CONECT 33 34 35 CONECT 34 79 80 81 CONECT 35 36 82 CONECT 36 37 83 84 CONECT 37 38 39 85 CONECT 38 86 CONECT 39 40 CONECT 40 87 88 89 END SMILES for #<Metabolite:0x00007fec8de00840>CC(CCC(=O)NC(CC1=CC=CC=C1)C(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C INCHI for #<Metabolite:0x00007fec8de00840>InChI=1S/C33H49NO6/c1-19(9-12-29(38)34-26(31(39)40)15-20-7-5-4-6-8-20)23-10-11-24-30-25(18-28(37)33(23,24)3)32(2)14-13-22(35)16-21(32)17-27(30)36/h4-8,19,21-28,30,35-37H,9-18H2,1-3H3,(H,34,38)(H,39,40) 3D Structure for #<Metabolite:0x00007fec8de00840> | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Formula | C33H49NO6 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 555.756 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 555.355988302 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 3-phenyl-2-(4-{5,9,16-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)propanoic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 3-phenyl-2-(4-{5,9,16-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)propanoic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC(CCC(=O)NC(CC1=CC=CC=C1)C(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C33H49NO6/c1-19(9-12-29(38)34-26(31(39)40)15-20-7-5-4-6-8-20)23-10-11-24-30-25(18-28(37)33(23,24)3)32(2)14-13-22(35)16-21(32)17-27(30)36/h4-8,19,21-28,30,35-37H,9-18H2,1-3H3,(H,34,38)(H,39,40) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | IQKZHEVJCMKOED-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Functional Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Proteins and Enzymes | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Pathways | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolic Reactions | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Health Effects and Bioactivity | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Microbial Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Exposure Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Host Biospecimen and Location | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0242371 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 78192682 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|