Showing metabocard for Cholyl-L-dopa (MMDBc0057231)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 1.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected and Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2022-11-10 23:34:10 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2024-04-30 20:56:37 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite ID | MMDBc0057231 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Cholyl-L-dopa | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | NULL | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for #<Metabolite:0x00005634c28d9350>Mrv1652308302119412D 42 46 0 0 0 0 999 V2000 9.2792 -3.2680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5648 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8503 -3.2680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5648 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8503 -1.6180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.1358 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1358 -2.8555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4214 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7069 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9924 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9924 -0.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2780 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1917 -2.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3847 -3.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9722 -2.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1653 -2.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6132 -2.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8682 -3.5342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8063 -2.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5513 -1.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2556 -1.6219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5106 -0.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3176 -0.6658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0414 -0.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8484 -0.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1034 -1.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6554 -0.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9103 -1.3519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4624 -0.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2693 -0.9103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8214 -0.2972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5243 -1.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1374 -1.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2792 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9937 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7082 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4227 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4227 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1371 -3.2680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7082 -3.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7082 -4.0930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9937 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 10 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 22 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 20 26 1 0 0 0 0 26 27 1 0 0 0 0 26 28 1 0 0 0 0 16 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 30 32 1 0 0 0 0 12 32 1 0 0 0 0 15 32 1 0 0 0 0 32 33 1 0 0 0 0 4 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 2 0 0 0 0 36 37 1 0 0 0 0 37 38 2 0 0 0 0 38 39 1 0 0 0 0 38 40 1 0 0 0 0 40 41 1 0 0 0 0 40 42 2 0 0 0 0 35 42 1 0 0 0 0 M END 3D MOL for #<Metabolite:0x00005634c28d9350>HMDB0242386 RDKit 3D Cholyl-L-dopa 91 95 0 0 0 0 0 0 0 0999 V2000 0.8428 2.9426 -0.5038 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3516 2.3515 -1.7488 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3838 1.9135 -2.7244 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3651 0.8733 -2.4942 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3847 0.9300 -1.4642 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5077 1.8336 -0.6441 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3095 -0.1922 -1.4470 N 0 0 0 0 0 0 0 0 0 0 0 0 5.3517 -0.1797 -0.4360 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6548 0.3009 -1.0446 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7231 0.3030 -0.0407 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6328 -0.7603 0.0508 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6344 -0.7605 0.9850 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7771 0.3042 1.8777 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7917 0.2924 2.8145 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9028 1.3609 1.8168 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9468 2.4620 2.6460 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8900 1.3343 0.8519 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5159 -1.4791 0.1780 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7951 -2.4516 -0.2447 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3896 -1.7740 1.1949 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9175 1.6200 -1.7465 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3049 1.0047 -3.0759 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4495 0.0284 -2.7573 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7215 0.3225 -1.3293 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6371 -0.4987 -0.5986 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8740 -1.9230 -0.9358 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1105 -2.8278 -0.1631 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2997 -2.2684 -0.4605 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7385 -1.4194 0.6615 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7309 -2.1343 1.5924 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4524 -1.0486 2.3394 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2775 -1.6542 3.2845 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5977 0.0062 2.9350 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3363 0.3432 2.2352 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6704 -0.8748 1.5720 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3513 -1.8257 2.7113 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3880 -0.5077 0.9158 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8550 0.8404 1.2214 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4564 0.9700 0.6463 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6210 0.2715 1.5104 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3051 0.5730 -0.7793 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4502 -0.6475 -0.9802 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1006 3.7283 -0.0824 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1196 2.3642 0.3419 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6922 3.6494 -0.7580 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0141 3.3714 -2.2878 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0559 2.8554 -2.9861 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9110 1.8227 -3.7795 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9956 0.8439 -3.4847 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9284 -0.1819 -2.5655 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2386 -0.9629 -2.1139 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0185 0.5718 0.3441 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9053 -0.4327 -1.8684 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5263 1.3046 -1.5291 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5139 -1.5772 -0.6411 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3197 -1.5818 1.0272 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9509 1.0204 3.4833 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6479 2.5377 3.3571 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2134 2.1741 0.8266 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6399 -2.7222 1.4576 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7731 2.3933 -1.6195 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6316 1.7944 -3.7778 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4773 0.4544 -3.5675 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3475 0.3343 -3.3657 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2246 -0.9975 -3.0100 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1253 1.3947 -1.3555 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6609 0.0025 -0.6613 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7889 -2.1589 -2.0238 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4686 -3.7335 -0.2886 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9421 -2.1041 -1.3760 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4025 -3.3434 -0.2197 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3718 -0.5844 0.2292 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4759 -2.6203 0.8967 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2692 -2.8909 2.2176 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1655 -0.5654 1.6062 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9650 -0.9872 3.5863 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2122 0.9567 2.9627 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4499 -0.2212 4.0325 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6703 0.8696 2.9231 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5925 1.0440 1.3873 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3891 -1.4901 3.1581 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2406 -2.8638 2.4024 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0928 -1.7757 3.5271 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6252 -1.2749 1.0896 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7275 0.9451 2.3361 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4499 1.6824 0.8244 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2148 2.0416 0.7554 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0357 -0.0205 2.3335 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6025 -0.4749 -0.6729 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4415 -1.0159 -2.0180 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7683 -1.5302 -0.3875 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 11 12 1 0 12 13 2 0 13 14 1 0 13 15 1 0 15 16 1 0 15 17 2 0 8 18 1 0 18 19 2 0 18 20 1 0 2 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 17 10 1 0 41 21 1 0 41 24 1 0 37 25 1 0 35 29 1 0 1 43 1 0 1 44 1 0 1 45 1 0 2 46 1 0 3 47 1 0 3 48 1 0 4 49 1 0 4 50 1 0 7 51 1 0 8 52 1 0 9 53 1 0 9 54 1 0 11 55 1 0 12 56 1 0 14 57 1 0 16 58 1 0 17 59 1 0 20 60 1 0 21 61 1 0 22 62 1 0 22 63 1 0 23 64 1 0 23 65 1 0 24 66 1 0 25 67 1 0 26 68 1 0 27 69 1 0 28 70 1 0 28 71 1 0 29 72 1 0 30 73 1 0 30 74 1 0 31 75 1 0 32 76 1 0 33 77 1 0 33 78 1 0 34 79 1 0 34 80 1 0 36 81 1 0 36 82 1 0 36 83 1 0 37 84 1 0 38 85 1 0 38 86 1 0 39 87 1 0 40 88 1 0 42 89 1 0 42 90 1 0 42 91 1 0 M END 3D SDF for #<Metabolite:0x00005634c28d9350>Mrv1652308302119412D 42 46 0 0 0 0 999 V2000 9.2792 -3.2680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5648 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8503 -3.2680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5648 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8503 -1.6180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.1358 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1358 -2.8555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4214 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7069 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9924 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9924 -0.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2780 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1917 -2.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3847 -3.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9722 -2.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1653 -2.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6132 -2.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8682 -3.5342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8063 -2.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5513 -1.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2556 -1.6219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5106 -0.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3176 -0.6658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0414 -0.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8484 -0.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1034 -1.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6554 -0.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9103 -1.3519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4624 -0.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2693 -0.9103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8214 -0.2972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5243 -1.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1374 -1.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2792 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9937 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7082 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4227 -2.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4227 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1371 -3.2680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7082 -3.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7082 -4.0930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9937 -2.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 10 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 22 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 20 26 1 0 0 0 0 26 27 1 0 0 0 0 26 28 1 0 0 0 0 16 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 30 32 1 0 0 0 0 12 32 1 0 0 0 0 15 32 1 0 0 0 0 32 33 1 0 0 0 0 4 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 2 0 0 0 0 36 37 1 0 0 0 0 37 38 2 0 0 0 0 38 39 1 0 0 0 0 38 40 1 0 0 0 0 40 41 1 0 0 0 0 40 42 2 0 0 0 0 35 42 1 0 0 0 0 M END > <DATABASE_ID> MMDBc0057231 > <DATABASE_NAME> MIME > <SMILES> CC(CCC(=O)NC(CC1=CC=C(O)C(O)=C1)C(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C > <INCHI_IDENTIFIER> InChI=1S/C33H49NO8/c1-17(4-9-29(40)34-24(31(41)42)12-18-5-8-25(36)26(37)13-18)21-6-7-22-30-23(16-28(39)33(21,22)3)32(2)11-10-20(35)14-19(32)15-27(30)38/h5,8,13,17,19-24,27-28,30,35-39H,4,6-7,9-12,14-16H2,1-3H3,(H,34,40)(H,41,42) > <INCHI_KEY> BKUPZHCMTLXWET-UHFFFAOYSA-N > <FORMULA> C33H49NO8 > <MOLECULAR_WEIGHT> 587.754 > <EXACT_MASS> 587.345817542 > <JCHEM_ACCEPTOR_COUNT> 8 > <JCHEM_ATOM_COUNT> 91 > <JCHEM_AVERAGE_POLARIZABILITY> 65.07583006588096 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 7 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 3-(3,4-dihydroxyphenyl)-2-(4-{5,9,16-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)propanoic acid > <ALOGPS_LOGP> 2.72 > <JCHEM_LOGP> 2.9951711836666655 > <ALOGPS_LOGS> -5.11 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 5 > <JCHEM_PHYSIOLOGICAL_CHARGE> -1 > <JCHEM_PKA> 9.287042387100357 > <JCHEM_PKA_STRONGEST_ACIDIC> 3.515662775403055 > <JCHEM_PKA_STRONGEST_BASIC> -0.158744906854147 > <JCHEM_POLAR_SURFACE_AREA> 167.55 > <JCHEM_REFRACTIVITY> 156.66749999999996 > <JCHEM_ROTATABLE_BOND_COUNT> 8 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 4.54e-03 g/l > <JCHEM_TRADITIONAL_IUPAC> 3-(3,4-dihydroxyphenyl)-2-(4-{5,9,16-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)propanoic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for #<Metabolite:0x00005634c28d9350>HMDB0242386 RDKit 3D Cholyl-L-dopa 91 95 0 0 0 0 0 0 0 0999 V2000 0.8428 2.9426 -0.5038 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3516 2.3515 -1.7488 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3838 1.9135 -2.7244 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3651 0.8733 -2.4942 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3847 0.9300 -1.4642 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5077 1.8336 -0.6441 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3095 -0.1922 -1.4470 N 0 0 0 0 0 0 0 0 0 0 0 0 5.3517 -0.1797 -0.4360 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6548 0.3009 -1.0446 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7231 0.3030 -0.0407 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6328 -0.7603 0.0508 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6344 -0.7605 0.9850 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7771 0.3042 1.8777 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7917 0.2924 2.8145 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9028 1.3609 1.8168 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9468 2.4620 2.6460 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8900 1.3343 0.8519 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5159 -1.4791 0.1780 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7951 -2.4516 -0.2447 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3896 -1.7740 1.1949 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9175 1.6200 -1.7465 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3049 1.0047 -3.0759 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4495 0.0284 -2.7573 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7215 0.3225 -1.3293 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6371 -0.4987 -0.5986 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8740 -1.9230 -0.9358 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1105 -2.8278 -0.1631 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2997 -2.2684 -0.4605 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7385 -1.4194 0.6615 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7309 -2.1343 1.5924 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4524 -1.0486 2.3394 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2775 -1.6542 3.2845 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5977 0.0062 2.9350 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3363 0.3432 2.2352 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6704 -0.8748 1.5720 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3513 -1.8257 2.7113 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3880 -0.5077 0.9158 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8550 0.8404 1.2214 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4564 0.9700 0.6463 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6210 0.2715 1.5104 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3051 0.5730 -0.7793 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4502 -0.6475 -0.9802 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1006 3.7283 -0.0824 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1196 2.3642 0.3419 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6922 3.6494 -0.7580 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0141 3.3714 -2.2878 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0559 2.8554 -2.9861 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9110 1.8227 -3.7795 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9956 0.8439 -3.4847 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9284 -0.1819 -2.5655 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2386 -0.9629 -2.1139 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0185 0.5718 0.3441 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9053 -0.4327 -1.8684 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5263 1.3046 -1.5291 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5139 -1.5772 -0.6411 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3197 -1.5818 1.0272 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9509 1.0204 3.4833 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6479 2.5377 3.3571 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2134 2.1741 0.8266 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6399 -2.7222 1.4576 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7731 2.3933 -1.6195 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6316 1.7944 -3.7778 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4773 0.4544 -3.5675 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3475 0.3343 -3.3657 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2246 -0.9975 -3.0100 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1253 1.3947 -1.3555 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6609 0.0025 -0.6613 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7889 -2.1589 -2.0238 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4686 -3.7335 -0.2886 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9421 -2.1041 -1.3760 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4025 -3.3434 -0.2197 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3718 -0.5844 0.2292 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4759 -2.6203 0.8967 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2692 -2.8909 2.2176 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1655 -0.5654 1.6062 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9650 -0.9872 3.5863 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2122 0.9567 2.9627 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4499 -0.2212 4.0325 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6703 0.8696 2.9231 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5925 1.0440 1.3873 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3891 -1.4901 3.1581 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2406 -2.8638 2.4024 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0928 -1.7757 3.5271 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6252 -1.2749 1.0896 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7275 0.9451 2.3361 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4499 1.6824 0.8244 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2148 2.0416 0.7554 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0357 -0.0205 2.3335 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6025 -0.4749 -0.6729 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4415 -1.0159 -2.0180 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7683 -1.5302 -0.3875 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 11 12 1 0 12 13 2 0 13 14 1 0 13 15 1 0 15 16 1 0 15 17 2 0 8 18 1 0 18 19 2 0 18 20 1 0 2 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 17 10 1 0 41 21 1 0 41 24 1 0 37 25 1 0 35 29 1 0 1 43 1 0 1 44 1 0 1 45 1 0 2 46 1 0 3 47 1 0 3 48 1 0 4 49 1 0 4 50 1 0 7 51 1 0 8 52 1 0 9 53 1 0 9 54 1 0 11 55 1 0 12 56 1 0 14 57 1 0 16 58 1 0 17 59 1 0 20 60 1 0 21 61 1 0 22 62 1 0 22 63 1 0 23 64 1 0 23 65 1 0 24 66 1 0 25 67 1 0 26 68 1 0 27 69 1 0 28 70 1 0 28 71 1 0 29 72 1 0 30 73 1 0 30 74 1 0 31 75 1 0 32 76 1 0 33 77 1 0 33 78 1 0 34 79 1 0 34 80 1 0 36 81 1 0 36 82 1 0 36 83 1 0 37 84 1 0 38 85 1 0 38 86 1 0 39 87 1 0 40 88 1 0 42 89 1 0 42 90 1 0 42 91 1 0 M END PDB for #<Metabolite:0x00005634c28d9350>HEADER PROTEIN 30-AUG-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 30-AUG-21 0 HETATM 1 O UNK 0 17.321 -6.100 0.000 0.00 0.00 O+0 HETATM 2 C UNK 0 15.988 -5.330 0.000 0.00 0.00 C+0 HETATM 3 O UNK 0 14.654 -6.100 0.000 0.00 0.00 O+0 HETATM 4 C UNK 0 15.988 -3.790 0.000 0.00 0.00 C+0 HETATM 5 N UNK 0 14.654 -3.020 0.000 0.00 0.00 N+0 HETATM 6 C UNK 0 13.320 -3.790 0.000 0.00 0.00 C+0 HETATM 7 O UNK 0 13.320 -5.330 0.000 0.00 0.00 O+0 HETATM 8 C UNK 0 11.987 -3.020 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 10.653 -3.790 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 9.319 -3.020 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 9.319 -1.480 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 7.986 -3.790 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 7.825 -5.322 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 6.318 -5.642 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 5.548 -4.308 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 4.042 -3.988 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 3.011 -5.133 0.000 0.00 0.00 C+0 HETATM 18 O UNK 0 3.487 -6.597 0.000 0.00 0.00 O+0 HETATM 19 C UNK 0 1.505 -4.812 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 1.029 -3.348 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -0.477 -3.028 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 -0.953 -1.563 0.000 0.00 0.00 C+0 HETATM 23 O UNK 0 -2.459 -1.243 0.000 0.00 0.00 O+0 HETATM 24 C UNK 0 0.077 -0.419 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 1.584 -0.739 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 2.060 -2.203 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 3.090 -1.059 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 3.566 -2.524 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 4.596 -1.379 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 6.103 -1.699 0.000 0.00 0.00 C+0 HETATM 31 O UNK 0 7.133 -0.555 0.000 0.00 0.00 O+0 HETATM 32 C UNK 0 6.579 -3.164 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 7.723 -2.133 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 17.321 -3.020 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 18.655 -3.790 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 19.989 -3.020 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 21.322 -3.790 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 21.322 -5.330 0.000 0.00 0.00 C+0 HETATM 39 O UNK 0 22.656 -6.100 0.000 0.00 0.00 O+0 HETATM 40 C UNK 0 19.989 -6.100 0.000 0.00 0.00 C+0 HETATM 41 O UNK 0 19.989 -7.640 0.000 0.00 0.00 O+0 HETATM 42 C UNK 0 18.655 -5.330 0.000 0.00 0.00 C+0 CONECT 1 2 CONECT 2 1 3 4 CONECT 3 2 CONECT 4 2 5 34 CONECT 5 4 6 CONECT 6 5 7 8 CONECT 7 6 CONECT 8 6 9 CONECT 9 8 10 CONECT 10 9 11 12 CONECT 11 10 CONECT 12 10 13 32 CONECT 13 12 14 CONECT 14 13 15 CONECT 15 14 16 32 CONECT 16 15 17 28 CONECT 17 16 18 19 CONECT 18 17 CONECT 19 17 20 CONECT 20 19 21 26 CONECT 21 20 22 CONECT 22 21 23 24 CONECT 23 22 CONECT 24 22 25 CONECT 25 24 26 CONECT 26 25 20 27 28 CONECT 27 26 CONECT 28 26 16 29 CONECT 29 28 30 CONECT 30 29 31 32 CONECT 31 30 CONECT 32 30 12 15 33 CONECT 33 32 CONECT 34 4 35 CONECT 35 34 36 42 CONECT 36 35 37 CONECT 37 36 38 CONECT 38 37 39 40 CONECT 39 38 CONECT 40 38 41 42 CONECT 41 40 CONECT 42 40 35 MASTER 0 0 0 0 0 0 0 0 42 0 92 0 END 3D PDB for #<Metabolite:0x00005634c28d9350>COMPND HMDB0242386 HETATM 1 C1 UNL 1 0.843 2.943 -0.504 1.00 0.00 C HETATM 2 C2 UNL 1 0.352 2.352 -1.749 1.00 0.00 C HETATM 3 C3 UNL 1 1.384 1.913 -2.724 1.00 0.00 C HETATM 4 C4 UNL 1 2.365 0.873 -2.494 1.00 0.00 C HETATM 5 C5 UNL 1 3.385 0.930 -1.464 1.00 0.00 C HETATM 6 O1 UNL 1 3.508 1.834 -0.644 1.00 0.00 O HETATM 7 N1 UNL 1 4.310 -0.192 -1.447 1.00 0.00 N HETATM 8 C6 UNL 1 5.352 -0.180 -0.436 1.00 0.00 C HETATM 9 C7 UNL 1 6.655 0.301 -1.045 1.00 0.00 C HETATM 10 C8 UNL 1 7.723 0.303 -0.041 1.00 0.00 C HETATM 11 C9 UNL 1 8.633 -0.760 0.051 1.00 0.00 C HETATM 12 C10 UNL 1 9.634 -0.760 0.985 1.00 0.00 C HETATM 13 C11 UNL 1 9.777 0.304 1.878 1.00 0.00 C HETATM 14 O2 UNL 1 10.792 0.292 2.815 1.00 0.00 O HETATM 15 C12 UNL 1 8.903 1.361 1.817 1.00 0.00 C HETATM 16 O3 UNL 1 8.947 2.462 2.646 1.00 0.00 O HETATM 17 C13 UNL 1 7.890 1.334 0.852 1.00 0.00 C HETATM 18 C14 UNL 1 5.516 -1.479 0.178 1.00 0.00 C HETATM 19 O4 UNL 1 4.795 -2.452 -0.245 1.00 0.00 O HETATM 20 O5 UNL 1 6.390 -1.774 1.195 1.00 0.00 O HETATM 21 C15 UNL 1 -0.917 1.620 -1.747 1.00 0.00 C HETATM 22 C16 UNL 1 -1.305 1.005 -3.076 1.00 0.00 C HETATM 23 C17 UNL 1 -2.449 0.028 -2.757 1.00 0.00 C HETATM 24 C18 UNL 1 -2.722 0.323 -1.329 1.00 0.00 C HETATM 25 C19 UNL 1 -3.637 -0.499 -0.599 1.00 0.00 C HETATM 26 C20 UNL 1 -3.874 -1.923 -0.936 1.00 0.00 C HETATM 27 O6 UNL 1 -3.111 -2.828 -0.163 1.00 0.00 O HETATM 28 C21 UNL 1 -5.300 -2.268 -0.461 1.00 0.00 C HETATM 29 C22 UNL 1 -5.738 -1.419 0.661 1.00 0.00 C HETATM 30 C23 UNL 1 -6.731 -2.134 1.592 1.00 0.00 C HETATM 31 C24 UNL 1 -7.452 -1.049 2.339 1.00 0.00 C HETATM 32 O7 UNL 1 -8.278 -1.654 3.284 1.00 0.00 O HETATM 33 C25 UNL 1 -6.598 0.006 2.935 1.00 0.00 C HETATM 34 C26 UNL 1 -5.336 0.343 2.235 1.00 0.00 C HETATM 35 C27 UNL 1 -4.670 -0.875 1.572 1.00 0.00 C HETATM 36 C28 UNL 1 -4.351 -1.826 2.711 1.00 0.00 C HETATM 37 C29 UNL 1 -3.388 -0.508 0.916 1.00 0.00 C HETATM 38 C30 UNL 1 -2.855 0.840 1.221 1.00 0.00 C HETATM 39 C31 UNL 1 -1.456 0.970 0.646 1.00 0.00 C HETATM 40 O8 UNL 1 -0.621 0.272 1.510 1.00 0.00 O HETATM 41 C32 UNL 1 -1.305 0.573 -0.779 1.00 0.00 C HETATM 42 C33 UNL 1 -0.450 -0.647 -0.980 1.00 0.00 C HETATM 43 H1 UNL 1 0.101 3.728 -0.082 1.00 0.00 H HETATM 44 H2 UNL 1 1.120 2.364 0.342 1.00 0.00 H HETATM 45 H3 UNL 1 1.692 3.649 -0.758 1.00 0.00 H HETATM 46 H4 UNL 1 0.014 3.371 -2.288 1.00 0.00 H HETATM 47 H5 UNL 1 2.056 2.855 -2.986 1.00 0.00 H HETATM 48 H6 UNL 1 0.911 1.823 -3.780 1.00 0.00 H HETATM 49 H7 UNL 1 2.996 0.844 -3.485 1.00 0.00 H HETATM 50 H8 UNL 1 1.928 -0.182 -2.565 1.00 0.00 H HETATM 51 H9 UNL 1 4.239 -0.963 -2.114 1.00 0.00 H HETATM 52 H10 UNL 1 5.019 0.572 0.344 1.00 0.00 H HETATM 53 H11 UNL 1 6.905 -0.433 -1.868 1.00 0.00 H HETATM 54 H12 UNL 1 6.526 1.305 -1.529 1.00 0.00 H HETATM 55 H13 UNL 1 8.514 -1.577 -0.641 1.00 0.00 H HETATM 56 H14 UNL 1 10.320 -1.582 1.027 1.00 0.00 H HETATM 57 H15 UNL 1 10.951 1.020 3.483 1.00 0.00 H HETATM 58 H16 UNL 1 9.648 2.538 3.357 1.00 0.00 H HETATM 59 H17 UNL 1 7.213 2.174 0.827 1.00 0.00 H HETATM 60 H18 UNL 1 6.640 -2.722 1.458 1.00 0.00 H HETATM 61 H19 UNL 1 -1.773 2.393 -1.620 1.00 0.00 H HETATM 62 H20 UNL 1 -1.632 1.794 -3.778 1.00 0.00 H HETATM 63 H21 UNL 1 -0.477 0.454 -3.567 1.00 0.00 H HETATM 64 H22 UNL 1 -3.348 0.334 -3.366 1.00 0.00 H HETATM 65 H23 UNL 1 -2.225 -0.998 -3.010 1.00 0.00 H HETATM 66 H24 UNL 1 -3.125 1.395 -1.356 1.00 0.00 H HETATM 67 H25 UNL 1 -4.661 0.002 -0.661 1.00 0.00 H HETATM 68 H26 UNL 1 -3.789 -2.159 -2.024 1.00 0.00 H HETATM 69 H27 UNL 1 -3.469 -3.734 -0.289 1.00 0.00 H HETATM 70 H28 UNL 1 -5.942 -2.104 -1.376 1.00 0.00 H HETATM 71 H29 UNL 1 -5.403 -3.343 -0.220 1.00 0.00 H HETATM 72 H30 UNL 1 -6.372 -0.584 0.229 1.00 0.00 H HETATM 73 H31 UNL 1 -7.476 -2.620 0.897 1.00 0.00 H HETATM 74 H32 UNL 1 -6.269 -2.891 2.218 1.00 0.00 H HETATM 75 H33 UNL 1 -8.166 -0.565 1.606 1.00 0.00 H HETATM 76 H34 UNL 1 -8.965 -0.987 3.586 1.00 0.00 H HETATM 77 H35 UNL 1 -7.212 0.957 2.963 1.00 0.00 H HETATM 78 H36 UNL 1 -6.450 -0.221 4.033 1.00 0.00 H HETATM 79 H37 UNL 1 -4.670 0.870 2.923 1.00 0.00 H HETATM 80 H38 UNL 1 -5.593 1.044 1.387 1.00 0.00 H HETATM 81 H39 UNL 1 -3.389 -1.490 3.158 1.00 0.00 H HETATM 82 H40 UNL 1 -4.241 -2.864 2.402 1.00 0.00 H HETATM 83 H41 UNL 1 -5.093 -1.776 3.527 1.00 0.00 H HETATM 84 H42 UNL 1 -2.625 -1.275 1.090 1.00 0.00 H HETATM 85 H43 UNL 1 -2.727 0.945 2.336 1.00 0.00 H HETATM 86 H44 UNL 1 -3.450 1.682 0.824 1.00 0.00 H HETATM 87 H45 UNL 1 -1.215 2.042 0.755 1.00 0.00 H HETATM 88 H46 UNL 1 -1.036 -0.021 2.333 1.00 0.00 H HETATM 89 H47 UNL 1 0.602 -0.475 -0.673 1.00 0.00 H HETATM 90 H48 UNL 1 -0.442 -1.016 -2.018 1.00 0.00 H HETATM 91 H49 UNL 1 -0.768 -1.530 -0.388 1.00 0.00 H CONECT 1 2 43 44 45 CONECT 2 3 21 46 CONECT 3 4 47 48 CONECT 4 5 49 50 CONECT 5 6 6 7 CONECT 7 8 51 CONECT 8 9 18 52 CONECT 9 10 53 54 CONECT 10 11 11 17 CONECT 11 12 55 CONECT 12 13 13 56 CONECT 13 14 15 CONECT 14 57 CONECT 15 16 17 17 CONECT 16 58 CONECT 17 59 CONECT 18 19 19 20 CONECT 20 60 CONECT 21 22 41 61 CONECT 22 23 62 63 CONECT 23 24 64 65 CONECT 24 25 41 66 CONECT 25 26 37 67 CONECT 26 27 28 68 CONECT 27 69 CONECT 28 29 70 71 CONECT 29 30 35 72 CONECT 30 31 73 74 CONECT 31 32 33 75 CONECT 32 76 CONECT 33 34 77 78 CONECT 34 35 79 80 CONECT 35 36 37 CONECT 36 81 82 83 CONECT 37 38 84 CONECT 38 39 85 86 CONECT 39 40 41 87 CONECT 40 88 CONECT 41 42 CONECT 42 89 90 91 END SMILES for #<Metabolite:0x00005634c28d9350>CC(CCC(=O)NC(CC1=CC=C(O)C(O)=C1)C(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C INCHI for #<Metabolite:0x00005634c28d9350>InChI=1S/C33H49NO8/c1-17(4-9-29(40)34-24(31(41)42)12-18-5-8-25(36)26(37)13-18)21-6-7-22-30-23(16-28(39)33(21,22)3)32(2)11-10-20(35)14-19(32)15-27(30)38/h5,8,13,17,19-24,27-28,30,35-39H,4,6-7,9-12,14-16H2,1-3H3,(H,34,40)(H,41,42) 3D Structure for #<Metabolite:0x00005634c28d9350> | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Formula | C33H49NO8 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 587.754 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 587.345817542 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-(4-{5,9,16-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)propanoic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 3-(3,4-dihydroxyphenyl)-2-(4-{5,9,16-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)propanoic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC(CCC(=O)NC(CC1=CC=C(O)C(O)=C1)C(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C33H49NO8/c1-17(4-9-29(40)34-24(31(41)42)12-18-5-8-25(36)26(37)13-18)21-6-7-22-30-23(16-28(39)33(21,22)3)32(2)11-10-20(35)14-19(32)15-27(30)38/h5,8,13,17,19-24,27-28,30,35-39H,4,6-7,9-12,14-16H2,1-3H3,(H,34,40)(H,41,42) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | BKUPZHCMTLXWET-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Functional Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Proteins and Enzymes | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Pathways | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolic Reactions | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Health Effects and Bioactivity | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Microbial Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Exposure Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Host Biospecimen and Location | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0242386 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|