Showing metabocard for Deoxycholylcysteine (MMDBc0057260)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 1.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected and Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2022-11-10 23:38:07 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2024-04-30 20:57:04 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite ID | MMDBc0057260 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Deoxycholylcysteine | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | NULL | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for #<Metabolite:0x00007fece403d120>Mrv1652308302121522D 34 37 0 0 0 0 999 V2000 9.8532 -0.3707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0431 -0.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7730 0.5647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5030 -0.8385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6929 -0.6825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.1528 -1.3062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4228 -2.0857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3426 -1.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8026 -1.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9924 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4523 -2.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7224 -0.8385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9330 -0.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9170 0.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6966 0.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0175 1.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5198 1.9141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8408 2.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6594 2.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9804 3.5362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7990 3.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1200 4.3983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2967 2.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9758 2.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1571 2.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6549 1.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8362 1.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3339 0.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0130 -0.0597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5107 -0.7177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1943 -0.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6205 -0.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7730 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2330 -2.2416 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 10 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 21 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 19 25 1 0 0 0 0 25 26 1 0 0 0 0 25 27 1 0 0 0 0 16 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 29 31 1 0 0 0 0 12 31 1 0 0 0 0 15 31 1 0 0 0 0 31 32 1 0 0 0 0 4 33 1 0 0 0 0 33 34 1 0 0 0 0 M END 3D MOL for #<Metabolite:0x00007fece403d120>HMDB0242415 RDKit 3D Deoxycholylcysteine 79 82 0 0 0 0 0 0 0 0999 V2000 2.3439 -3.8573 0.1708 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6909 -2.5725 0.7159 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7586 -1.7032 1.1819 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8109 -1.2586 0.2285 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8311 -0.3837 0.8580 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6901 -0.0895 2.0685 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9475 0.1307 0.1652 N 0 0 0 0 0 0 0 0 0 0 0 0 6.9441 0.9819 0.7681 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9615 2.2969 0.0378 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1730 3.4527 0.7007 S 0 0 0 0 0 0 0 0 0 0 0 0 8.2692 0.3145 0.6773 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4167 -0.8189 0.1575 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4272 0.9283 1.1728 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5814 -2.2101 -0.1145 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6948 -1.9002 -1.5413 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6371 -1.2085 -1.8980 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4665 -1.4963 -0.7118 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7220 -0.7496 -0.5287 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5016 -0.7726 -1.8231 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8569 -0.2005 -1.5847 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8965 1.0631 -0.7952 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6478 0.8788 0.5315 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1997 2.2249 0.9188 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3418 2.4512 0.1455 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1526 3.2625 0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7535 2.7030 0.5823 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5225 1.6443 -0.4946 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9518 2.3559 -1.6651 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6151 0.5901 0.1224 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2318 1.1337 0.2304 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1409 0.1551 0.4803 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9290 0.5484 -0.3684 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4689 -1.2669 0.4201 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0277 -1.7447 1.7392 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5304 -4.6307 0.0700 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0665 -4.2770 0.8910 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7620 -3.7241 -0.8226 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2210 -2.9985 1.6797 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3988 -0.8180 1.7904 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3343 -2.2823 1.9765 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3573 -2.0731 -0.2724 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3635 -0.6501 -0.5818 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0594 -0.1184 -0.8395 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6570 1.1858 1.8219 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1510 2.2021 -1.0495 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9524 2.7744 0.1417 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4815 3.1747 0.2907 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9712 0.4750 1.8983 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0452 -3.1856 -0.1324 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7281 -2.8294 -2.1915 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5428 -1.3163 -1.9022 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1097 -1.6820 -2.7893 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4812 -0.1607 -2.1480 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6739 -2.6054 -0.7148 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3499 -1.4083 0.1504 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9784 -0.4138 -2.6973 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6667 -1.8777 -2.0244 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4493 -0.0995 -2.5441 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4493 -0.9725 -1.0079 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4439 1.8329 -1.3851 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4688 0.1496 0.2822 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0352 0.4074 1.2969 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4575 2.2805 2.0059 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3066 3.2951 -0.3549 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3413 3.6535 -0.4684 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1752 4.1199 1.2557 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0576 3.5610 0.4917 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5432 2.2504 1.5874 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2714 1.8267 -2.3137 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4235 3.3128 -1.3805 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8035 2.7233 -2.3016 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0020 0.5311 1.1895 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0603 1.7616 -0.6871 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2417 1.9215 1.0448 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2829 0.3486 1.5161 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1152 1.5042 -0.1479 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6130 -1.0863 2.5284 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1163 -1.5963 1.7484 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7454 -2.7833 1.9993 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 8 11 1 0 11 12 2 0 11 13 1 0 2 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 33 14 1 0 33 17 1 0 29 18 1 0 27 21 1 0 1 35 1 0 1 36 1 0 1 37 1 0 2 38 1 0 3 39 1 0 3 40 1 0 4 41 1 0 4 42 1 0 7 43 1 0 8 44 1 0 9 45 1 0 9 46 1 0 10 47 1 0 13 48 1 0 14 49 1 0 15 50 1 0 15 51 1 0 16 52 1 0 16 53 1 0 17 54 1 0 18 55 1 0 19 56 1 0 19 57 1 0 20 58 1 0 20 59 1 0 21 60 1 0 22 61 1 0 22 62 1 0 23 63 1 0 24 64 1 0 25 65 1 0 25 66 1 0 26 67 1 0 26 68 1 0 28 69 1 0 28 70 1 0 28 71 1 0 29 72 1 0 30 73 1 0 30 74 1 0 31 75 1 0 32 76 1 0 34 77 1 0 34 78 1 0 34 79 1 0 M END 3D SDF for #<Metabolite:0x00007fece403d120>Mrv1652308302121522D 34 37 0 0 0 0 999 V2000 9.8532 -0.3707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0431 -0.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7730 0.5647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5030 -0.8385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6929 -0.6825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.1528 -1.3062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4228 -2.0857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3426 -1.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8026 -1.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9924 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4523 -2.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7224 -0.8385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9330 -0.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9170 0.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6966 0.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0175 1.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5198 1.9141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8408 2.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6594 2.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9804 3.5362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7990 3.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1200 4.3983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2967 2.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9758 2.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1571 2.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6549 1.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8362 1.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3339 0.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0130 -0.0597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5107 -0.7177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1943 -0.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6205 -0.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7730 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2330 -2.2416 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 10 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 21 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 19 25 1 0 0 0 0 25 26 1 0 0 0 0 25 27 1 0 0 0 0 16 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 29 31 1 0 0 0 0 12 31 1 0 0 0 0 15 31 1 0 0 0 0 31 32 1 0 0 0 0 4 33 1 0 0 0 0 33 34 1 0 0 0 0 M END > <DATABASE_ID> MMDBc0057260 > <DATABASE_NAME> MIME > <SMILES> CC(CCC(=O)NC(CS)C(O)=O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C > <INCHI_IDENTIFIER> InChI=1S/C27H45NO5S/c1-15(4-9-24(31)28-22(14-34)25(32)33)19-7-8-20-18-6-5-16-12-17(29)10-11-26(16,2)21(18)13-23(30)27(19,20)3/h15-23,29-30,34H,4-14H2,1-3H3,(H,28,31)(H,32,33) > <INCHI_KEY> CBETXCRGHYBMPS-UHFFFAOYSA-N > <FORMULA> C27H45NO5S > <MOLECULAR_WEIGHT> 495.72 > <EXACT_MASS> 495.301844727 > <JCHEM_ACCEPTOR_COUNT> 5 > <JCHEM_ATOM_COUNT> 79 > <JCHEM_AVERAGE_POLARIZABILITY> 56.81688064202004 > <JCHEM_BIOAVAILABILITY> 1 > <JCHEM_DONOR_COUNT> 5 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2-(4-{5,16-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)-3-sulfanylpropanoic acid > <ALOGPS_LOGP> 3.46 > <JCHEM_LOGP> 3.3032922256666657 > <ALOGPS_LOGS> -5.74 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 4 > <JCHEM_PHYSIOLOGICAL_CHARGE> -1 > <JCHEM_PKA> 10.049481600943299 > <JCHEM_PKA_STRONGEST_ACIDIC> 3.752998310859828 > <JCHEM_PKA_STRONGEST_BASIC> -0.3099981187716577 > <JCHEM_POLAR_SURFACE_AREA> 106.86000000000001 > <JCHEM_REFRACTIVITY> 134.2205 > <JCHEM_ROTATABLE_BOND_COUNT> 7 > <JCHEM_RULE_OF_FIVE> 1 > <ALOGPS_SOLUBILITY> 9.11e-04 g/l > <JCHEM_TRADITIONAL_IUPAC> 2-(4-{5,16-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)-3-sulfanylpropanoic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for #<Metabolite:0x00007fece403d120>HMDB0242415 RDKit 3D Deoxycholylcysteine 79 82 0 0 0 0 0 0 0 0999 V2000 2.3439 -3.8573 0.1708 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6909 -2.5725 0.7159 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7586 -1.7032 1.1819 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8109 -1.2586 0.2285 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8311 -0.3837 0.8580 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6901 -0.0895 2.0685 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9475 0.1307 0.1652 N 0 0 0 0 0 0 0 0 0 0 0 0 6.9441 0.9819 0.7681 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9615 2.2969 0.0378 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1730 3.4527 0.7007 S 0 0 0 0 0 0 0 0 0 0 0 0 8.2692 0.3145 0.6773 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4167 -0.8189 0.1575 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4272 0.9283 1.1728 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5814 -2.2101 -0.1145 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6948 -1.9002 -1.5413 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6371 -1.2085 -1.8980 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4665 -1.4963 -0.7118 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7220 -0.7496 -0.5287 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5016 -0.7726 -1.8231 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8569 -0.2005 -1.5847 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8965 1.0631 -0.7952 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6478 0.8788 0.5315 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1997 2.2249 0.9188 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3418 2.4512 0.1455 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1526 3.2625 0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7535 2.7030 0.5823 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5225 1.6443 -0.4946 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9518 2.3559 -1.6651 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6151 0.5901 0.1224 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2318 1.1337 0.2304 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1409 0.1551 0.4803 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9290 0.5484 -0.3684 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4689 -1.2669 0.4201 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0277 -1.7447 1.7392 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5304 -4.6307 0.0700 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0665 -4.2770 0.8910 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7620 -3.7241 -0.8226 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2210 -2.9985 1.6797 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3988 -0.8180 1.7904 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3343 -2.2823 1.9765 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3573 -2.0731 -0.2724 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3635 -0.6501 -0.5818 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0594 -0.1184 -0.8395 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6570 1.1858 1.8219 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1510 2.2021 -1.0495 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9524 2.7744 0.1417 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4815 3.1747 0.2907 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9712 0.4750 1.8983 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0452 -3.1856 -0.1324 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7281 -2.8294 -2.1915 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5428 -1.3163 -1.9022 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1097 -1.6820 -2.7893 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4812 -0.1607 -2.1480 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6739 -2.6054 -0.7148 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3499 -1.4083 0.1504 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9784 -0.4138 -2.6973 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6667 -1.8777 -2.0244 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4493 -0.0995 -2.5441 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4493 -0.9725 -1.0079 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4439 1.8329 -1.3851 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4688 0.1496 0.2822 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0352 0.4074 1.2969 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4575 2.2805 2.0059 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3066 3.2951 -0.3549 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3413 3.6535 -0.4684 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1752 4.1199 1.2557 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0576 3.5610 0.4917 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5432 2.2504 1.5874 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2714 1.8267 -2.3137 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4235 3.3128 -1.3805 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8035 2.7233 -2.3016 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0020 0.5311 1.1895 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0603 1.7616 -0.6871 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2417 1.9215 1.0448 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2829 0.3486 1.5161 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1152 1.5042 -0.1479 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6130 -1.0863 2.5284 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1163 -1.5963 1.7484 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7454 -2.7833 1.9993 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 8 11 1 0 11 12 2 0 11 13 1 0 2 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 33 14 1 0 33 17 1 0 29 18 1 0 27 21 1 0 1 35 1 0 1 36 1 0 1 37 1 0 2 38 1 0 3 39 1 0 3 40 1 0 4 41 1 0 4 42 1 0 7 43 1 0 8 44 1 0 9 45 1 0 9 46 1 0 10 47 1 0 13 48 1 0 14 49 1 0 15 50 1 0 15 51 1 0 16 52 1 0 16 53 1 0 17 54 1 0 18 55 1 0 19 56 1 0 19 57 1 0 20 58 1 0 20 59 1 0 21 60 1 0 22 61 1 0 22 62 1 0 23 63 1 0 24 64 1 0 25 65 1 0 25 66 1 0 26 67 1 0 26 68 1 0 28 69 1 0 28 70 1 0 28 71 1 0 29 72 1 0 30 73 1 0 30 74 1 0 31 75 1 0 32 76 1 0 34 77 1 0 34 78 1 0 34 79 1 0 M END PDB for #<Metabolite:0x00007fece403d120>HEADER PROTEIN 30-AUG-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 30-AUG-21 0 HETATM 1 O UNK 0 18.393 -0.692 0.000 0.00 0.00 O+0 HETATM 2 C UNK 0 16.880 -0.401 0.000 0.00 0.00 C+0 HETATM 3 O UNK 0 16.376 1.054 0.000 0.00 0.00 O+0 HETATM 4 C UNK 0 15.872 -1.565 0.000 0.00 0.00 C+0 HETATM 5 N UNK 0 14.360 -1.274 0.000 0.00 0.00 N+0 HETATM 6 C UNK 0 13.352 -2.438 0.000 0.00 0.00 C+0 HETATM 7 O UNK 0 13.856 -3.893 0.000 0.00 0.00 O+0 HETATM 8 C UNK 0 11.840 -2.147 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 10.831 -3.311 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 9.319 -3.020 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 8.311 -4.184 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 8.815 -1.565 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 7.342 -1.118 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 7.312 0.422 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 8.767 0.926 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 9.366 2.345 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 8.437 3.573 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 9.036 4.992 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 10.564 5.182 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 11.163 6.601 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 12.691 6.791 0.000 0.00 0.00 C+0 HETATM 22 O UNK 0 13.291 8.210 0.000 0.00 0.00 O+0 HETATM 23 C UNK 0 13.621 5.563 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 13.021 4.145 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 11.493 3.954 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 12.422 2.726 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 10.894 2.535 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 11.823 1.307 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 11.224 -0.111 0.000 0.00 0.00 C+0 HETATM 30 O UNK 0 12.153 -1.340 0.000 0.00 0.00 O+0 HETATM 31 C UNK 0 9.696 -0.302 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 10.492 -1.621 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 16.376 -3.020 0.000 0.00 0.00 C+0 HETATM 34 S UNK 0 15.368 -4.184 0.000 0.00 0.00 S+0 CONECT 1 2 CONECT 2 1 3 4 CONECT 3 2 CONECT 4 2 5 33 CONECT 5 4 6 CONECT 6 5 7 8 CONECT 7 6 CONECT 8 6 9 CONECT 9 8 10 CONECT 10 9 11 12 CONECT 11 10 CONECT 12 10 13 31 CONECT 13 12 14 CONECT 14 13 15 CONECT 15 14 16 31 CONECT 16 15 17 27 CONECT 17 16 18 CONECT 18 17 19 CONECT 19 18 20 25 CONECT 20 19 21 CONECT 21 20 22 23 CONECT 22 21 CONECT 23 21 24 CONECT 24 23 25 CONECT 25 24 19 26 27 CONECT 26 25 CONECT 27 25 16 28 CONECT 28 27 29 CONECT 29 28 30 31 CONECT 30 29 CONECT 31 29 12 15 32 CONECT 32 31 CONECT 33 4 34 CONECT 34 33 MASTER 0 0 0 0 0 0 0 0 34 0 74 0 END 3D PDB for #<Metabolite:0x00007fece403d120>COMPND HMDB0242415 HETATM 1 C1 UNL 1 2.344 -3.857 0.171 1.00 0.00 C HETATM 2 C2 UNL 1 1.691 -2.572 0.716 1.00 0.00 C HETATM 3 C3 UNL 1 2.759 -1.703 1.182 1.00 0.00 C HETATM 4 C4 UNL 1 3.811 -1.259 0.228 1.00 0.00 C HETATM 5 C5 UNL 1 4.831 -0.384 0.858 1.00 0.00 C HETATM 6 O1 UNL 1 4.690 -0.089 2.068 1.00 0.00 O HETATM 7 N1 UNL 1 5.947 0.131 0.165 1.00 0.00 N HETATM 8 C6 UNL 1 6.944 0.982 0.768 1.00 0.00 C HETATM 9 C7 UNL 1 6.961 2.297 0.038 1.00 0.00 C HETATM 10 S1 UNL 1 8.173 3.453 0.701 1.00 0.00 S HETATM 11 C8 UNL 1 8.269 0.314 0.677 1.00 0.00 C HETATM 12 O2 UNL 1 8.417 -0.819 0.158 1.00 0.00 O HETATM 13 O3 UNL 1 9.427 0.928 1.173 1.00 0.00 O HETATM 14 C9 UNL 1 0.581 -2.210 -0.115 1.00 0.00 C HETATM 15 C10 UNL 1 0.695 -1.900 -1.541 1.00 0.00 C HETATM 16 C11 UNL 1 -0.637 -1.209 -1.898 1.00 0.00 C HETATM 17 C12 UNL 1 -1.467 -1.496 -0.712 1.00 0.00 C HETATM 18 C13 UNL 1 -2.722 -0.750 -0.529 1.00 0.00 C HETATM 19 C14 UNL 1 -3.502 -0.773 -1.823 1.00 0.00 C HETATM 20 C15 UNL 1 -4.857 -0.201 -1.585 1.00 0.00 C HETATM 21 C16 UNL 1 -4.896 1.063 -0.795 1.00 0.00 C HETATM 22 C17 UNL 1 -5.648 0.879 0.531 1.00 0.00 C HETATM 23 C18 UNL 1 -6.200 2.225 0.919 1.00 0.00 C HETATM 24 O4 UNL 1 -7.342 2.451 0.146 1.00 0.00 O HETATM 25 C19 UNL 1 -5.153 3.263 0.552 1.00 0.00 C HETATM 26 C20 UNL 1 -3.754 2.703 0.582 1.00 0.00 C HETATM 27 C21 UNL 1 -3.523 1.644 -0.495 1.00 0.00 C HETATM 28 C22 UNL 1 -2.952 2.356 -1.665 1.00 0.00 C HETATM 29 C23 UNL 1 -2.615 0.590 0.122 1.00 0.00 C HETATM 30 C24 UNL 1 -1.232 1.134 0.230 1.00 0.00 C HETATM 31 C25 UNL 1 -0.141 0.155 0.480 1.00 0.00 C HETATM 32 O5 UNL 1 0.929 0.548 -0.368 1.00 0.00 O HETATM 33 C26 UNL 1 -0.469 -1.267 0.420 1.00 0.00 C HETATM 34 C27 UNL 1 -1.028 -1.745 1.739 1.00 0.00 C HETATM 35 H1 UNL 1 1.530 -4.631 0.070 1.00 0.00 H HETATM 36 H2 UNL 1 3.066 -4.277 0.891 1.00 0.00 H HETATM 37 H3 UNL 1 2.762 -3.724 -0.823 1.00 0.00 H HETATM 38 H4 UNL 1 1.221 -2.999 1.680 1.00 0.00 H HETATM 39 H5 UNL 1 2.399 -0.818 1.790 1.00 0.00 H HETATM 40 H6 UNL 1 3.334 -2.282 1.976 1.00 0.00 H HETATM 41 H7 UNL 1 4.357 -2.073 -0.272 1.00 0.00 H HETATM 42 H8 UNL 1 3.363 -0.650 -0.582 1.00 0.00 H HETATM 43 H9 UNL 1 6.059 -0.118 -0.839 1.00 0.00 H HETATM 44 H10 UNL 1 6.657 1.186 1.822 1.00 0.00 H HETATM 45 H11 UNL 1 7.151 2.202 -1.049 1.00 0.00 H HETATM 46 H12 UNL 1 5.952 2.774 0.142 1.00 0.00 H HETATM 47 H13 UNL 1 9.482 3.175 0.291 1.00 0.00 H HETATM 48 H14 UNL 1 9.971 0.475 1.898 1.00 0.00 H HETATM 49 H15 UNL 1 -0.045 -3.186 -0.132 1.00 0.00 H HETATM 50 H16 UNL 1 0.728 -2.829 -2.192 1.00 0.00 H HETATM 51 H17 UNL 1 1.543 -1.316 -1.902 1.00 0.00 H HETATM 52 H18 UNL 1 -1.110 -1.682 -2.789 1.00 0.00 H HETATM 53 H19 UNL 1 -0.481 -0.161 -2.148 1.00 0.00 H HETATM 54 H20 UNL 1 -1.674 -2.605 -0.715 1.00 0.00 H HETATM 55 H21 UNL 1 -3.350 -1.408 0.150 1.00 0.00 H HETATM 56 H22 UNL 1 -2.978 -0.414 -2.697 1.00 0.00 H HETATM 57 H23 UNL 1 -3.667 -1.878 -2.024 1.00 0.00 H HETATM 58 H24 UNL 1 -5.449 -0.100 -2.544 1.00 0.00 H HETATM 59 H25 UNL 1 -5.449 -0.972 -1.008 1.00 0.00 H HETATM 60 H26 UNL 1 -5.444 1.833 -1.385 1.00 0.00 H HETATM 61 H27 UNL 1 -6.469 0.150 0.282 1.00 0.00 H HETATM 62 H28 UNL 1 -5.035 0.407 1.297 1.00 0.00 H HETATM 63 H29 UNL 1 -6.457 2.281 2.006 1.00 0.00 H HETATM 64 H30 UNL 1 -7.307 3.295 -0.355 1.00 0.00 H HETATM 65 H31 UNL 1 -5.341 3.653 -0.468 1.00 0.00 H HETATM 66 H32 UNL 1 -5.175 4.120 1.256 1.00 0.00 H HETATM 67 H33 UNL 1 -3.058 3.561 0.492 1.00 0.00 H HETATM 68 H34 UNL 1 -3.543 2.250 1.587 1.00 0.00 H HETATM 69 H35 UNL 1 -2.271 1.827 -2.314 1.00 0.00 H HETATM 70 H36 UNL 1 -2.424 3.313 -1.380 1.00 0.00 H HETATM 71 H37 UNL 1 -3.804 2.723 -2.302 1.00 0.00 H HETATM 72 H38 UNL 1 -3.002 0.531 1.190 1.00 0.00 H HETATM 73 H39 UNL 1 -1.060 1.762 -0.687 1.00 0.00 H HETATM 74 H40 UNL 1 -1.242 1.922 1.045 1.00 0.00 H HETATM 75 H41 UNL 1 0.283 0.349 1.516 1.00 0.00 H HETATM 76 H42 UNL 1 1.115 1.504 -0.148 1.00 0.00 H HETATM 77 H43 UNL 1 -0.613 -1.086 2.528 1.00 0.00 H HETATM 78 H44 UNL 1 -2.116 -1.596 1.748 1.00 0.00 H HETATM 79 H45 UNL 1 -0.745 -2.783 1.999 1.00 0.00 H CONECT 1 2 35 36 37 CONECT 2 3 14 38 CONECT 3 4 39 40 CONECT 4 5 41 42 CONECT 5 6 6 7 CONECT 7 8 43 CONECT 8 9 11 44 CONECT 9 10 45 46 CONECT 10 47 CONECT 11 12 12 13 CONECT 13 48 CONECT 14 15 33 49 CONECT 15 16 50 51 CONECT 16 17 52 53 CONECT 17 18 33 54 CONECT 18 19 29 55 CONECT 19 20 56 57 CONECT 20 21 58 59 CONECT 21 22 27 60 CONECT 22 23 61 62 CONECT 23 24 25 63 CONECT 24 64 CONECT 25 26 65 66 CONECT 26 27 67 68 CONECT 27 28 29 CONECT 28 69 70 71 CONECT 29 30 72 CONECT 30 31 73 74 CONECT 31 32 33 75 CONECT 32 76 CONECT 33 34 CONECT 34 77 78 79 END SMILES for #<Metabolite:0x00007fece403d120>CC(CCC(=O)NC(CS)C(O)=O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C INCHI for #<Metabolite:0x00007fece403d120>InChI=1S/C27H45NO5S/c1-15(4-9-24(31)28-22(14-34)25(32)33)19-7-8-20-18-6-5-16-12-17(29)10-11-26(16,2)21(18)13-23(30)27(19,20)3/h15-23,29-30,34H,4-14H2,1-3H3,(H,28,31)(H,32,33) 3D Structure for #<Metabolite:0x00007fece403d120> | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Formula | C27H45NO5S | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 495.72 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 495.301844727 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2-(4-{5,16-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)-3-sulfanylpropanoic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2-(4-{5,16-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)-3-sulfanylpropanoic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC(CCC(=O)NC(CS)C(O)=O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C27H45NO5S/c1-15(4-9-24(31)28-22(14-34)25(32)33)19-7-8-20-18-6-5-16-12-17(29)10-11-26(16,2)21(18)13-23(30)27(19,20)3/h15-23,29-30,34H,4-14H2,1-3H3,(H,28,31)(H,32,33) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | CBETXCRGHYBMPS-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Functional Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Proteins and Enzymes | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Human Pathways | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolic Reactions | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Health Effects and Bioactivity | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Microbial Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Exposure Sources | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Host Biospecimen and Location | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0242415 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|