Showing metabocard for Isochorismate (MMDBc0030071)
| Record Information | |
|---|---|
| Version | 1.0 |
| Status | Detected and Quantified |
| Creation Date | 2021-11-17 23:52:49 UTC |
| Update Date | 2024-10-11 04:01:41 UTC |
| Metabolite ID | MMDBc0030071 |
| Metabolite Identification | |
| Common Name | Isochorismate |
| Description | Isochorismate is a member of the chemical class known as Beta Hydroxy Acids and Derivatives. These are compounds containing a carboxylic acid substituted with a hydroxyl group on the C3 carbon atom. In Escherichia coli, isochorismate is a common precursor for the biosynthesis of the siderophore enterobactin and menaquinone (vitamin K2). Isochorismate is formed by the shikimate pathway from chorismate by the enzyme isochorismate synthase encoded by the entC gene. (PMID 8655506 ) |
| Structure |  |
| Synonyms | Not Available |
| Molecular Formula | C10H8O6 |
| Average Mass | 224.169 |
| Monoisotopic Mass | 224.033185137 |
| IUPAC Name | Not Available |
| Traditional Name | Not Available |
| CAS Registry Number | 22642-82-6 |
| SMILES | Not Available |
| InChI Identifier | InChI=1S/C10H10O6/c1-5(9(12)13)16-7-4-2-3-6(8(7)11)10(14)15/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/p-2/t7-,8-/m0/s1 |
| InChI Key | NTGWPRCCOQCMGE-YUMQZZPRSA-L |
| Chemical Taxonomy | |
| Functional Ontology | |
| Physical Properties | |
| Spectra | |
| Biological Properties | |
| Human Proteins and Enzymes | |
| Human Pathways | |
| Metabolic Reactions | |
| Health Effects and Bioactivity | |
| Microbial Sources | |
| Exposure Sources | |
| Host Biospecimen and Location | |
| External Links | |
| References | |
