MMDBr0012860 | (2R)-2-phosphoglyceric acid | Phosphoenolpyruvic acid | Enolase | Enolization | RHEA | 34755880 |
MMDBr0012867 | (1R,6R)-6-Hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate | 2-Succinylbenzoate | o-succinylbenzoate synthase | Racemization; Synthesis | RHEA | 34755880 |
MMDBr0012872 | Pyridoxal | Pyridoxal 5'-phosphate | Putative pyridoxal kinase BUD16 | Phosphorylation | RHEA | 34755880 |
MMDBr0012876 | Deoxyuridine triphosphate | dUMP | Probable deoxyuridine 5'-triphosphate nucleotidohydrolase | Dephosphorylation; Hydrolysis of bond | RHEA | 34755880 |
MMDBr0012878 | 2-Dehydro-3-deoxy-D-glucarate | 2-Hydroxy-3-oxopropanoate | 5-keto-4-deoxy-D-glucarate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0012889 | Pyroglutamic acid | L-Glutamic acid | 5-oxoprolinase | Hydrolysis | RHEA | 34755880 |
MMDBr0012895 | Orotidylic acid | Phosphoribosyl pyrophosphate | Orotate phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012943 | Xanthylic acid | Phosphoribosyl pyrophosphate | Xanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012944 | Phosphoribosyl pyrophosphate | Xanthylic acid | Xanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012946 | N2-Succinyl-L-glutamic acid 5-semialdehyde | N-Succinyl-L-glutamate | N-succinylglutamate 5-semialdehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0012953 | (R)-Pantoate | Pantothenic acid | Pantothenate synthetase | Ligation; Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0012954 | L-Aspartic acid | Argininosuccinic acid | Argininosuccinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0012961 | Glycolic acid | glyoxylate | Glyoxylate/hydroxypyruvate reductase A | Reduction | RHEA | 34755880 |
MMDBr0012975 | Glycerol 3-phosphate | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(+)] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012976 | Glycerol 3-phosphate | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(P)+] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012992 | D-Cysteine | Hydrogen sulfide | D-cysteine desulfhydrase | alpha,beta-Elimination | RHEA | 34755880 |
MMDBr0012996 | (S)-Ureidoglycolic acid | glyoxylate | Ureidoglycolate lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013026 | Orotidylic acid | Uridine 5'-monophosphate | Orotidine 5'-phosphate decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013027 | CMP | CDP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013045 | Alpha-D-glucose 6-phosphate | beta-D-Fructose 6-phosphate | Glucose-6-phosphate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013046 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | 3-methyl-2-oxobutanoate hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0013071 | Thiamine | thiamine phosphate | Thiamine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013075 | D-Erythrose 4-phosphate | 4-Phospho-D-erythronate | D-erythrose-4-phosphate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013081 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 7,8-dihydrofolate monoglutamate | Bifunctional dihydrofolate reductase-thymidylate synthase | Reduction; Synthesis | RHEA | 34755880 |
MMDBr0013083 | Glucose 1-phosphate | ADP-alpha-D-glucose | Glucose-1-phosphate adenylyltransferase | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0013088 | Glucosamine 6-phosphate | beta-D-Fructose 6-phosphate | D-galactosamine-6-phosphate deaminase AgaS | Deamination; Isomerization | RHEA | 34755880 |
MMDBr0013101 | alpha-Ketoglutarate | 1-Pyrroline | Putrescine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013102 | alpha-Ketoglutarate | 1-Pyrroline | Putrescine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013130 | 6-Phosphonoglucono-D-lactone | 6-Phosphogluconic acid | 6-phosphogluconolactonase | Hydrolysis | RHEA | 34755880 |
MMDBr0013134 | D-Glyceraldehyde 3-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose-5-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013143 | Putrescine | 5'-Methylthioadenosine | Polyamine aminopropyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0013152 | L-Glutamic acid | D-Glutamate | L-alanine/L-glutamate racemase | Racemization; Synthesis | RHEA | 34755880 |
MMDBr0013162 | Nitrate | Nitrite | Periplasmic nitrate reductase | Reduction | RHEA | 34755880 |
MMDBr0013173 | Uridine 5'-monophosphate | Phosphoribosyl pyrophosphate | Bifunctional protein PyrR | Transfer of phosphoribosyl group | RHEA | 34755880 |
MMDBr0013178 | D-Glucuronic acid | D-Fructofuranuronic acid | Uronate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013183 | Guanosine 3'-diphosphate 5'-triphosphate | Guanosine 3',5'-bis(diphosphate) | Guanosine-5'-triphosphate,3'-diphosphate pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0013187 | Shikimate | Shikimate 3-phosphate | Pentafunctional AROM polypeptide | Phosphorylation | RHEA | 34755880 |
MMDBr0013194 | Porphobilinogen | Hydroxymethylbilane | Porphobilinogen deaminase | Deamination | RHEA | 34755880 |
MMDBr0013201 | Guanosine | Ribose-1-phosphate | Purine nucleoside phosphorylase DeoD-type | Phosphorylation | RHEA | 34755880 |
MMDBr0013212 | 7-Aminomethyl-7-carbaguanine | 7-Cyano-7-carbaguanine | NADPH-dependent 7-cyano-7-deazaguanine reductase | Reduction | RHEA | 34755880 |
MMDBr0013213 | 2-C-methyl-D-erythritol 4-phosphate | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase | Transfer of a cytidylyl group | RHEA | 34755880 |
MMDBr0013214 | Deoxycytidine | 2'-Deoxyuridine | Cytidine deaminase | Deamination | RHEA | 34755880 |
MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0013224 | N-acetyl-alpha-D-glucosamine 1-phosphate | Uridine diphosphate-N-acetylglucosamine | Bifunctional protein GlmU | N-Acetylation; Phosphorylation; Isomerization | RHEA | 34755880 |
MMDBr0013226 | 5-Thymidylic acid | dTDP | Putative thymidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013236 | 5'-Methylthioadenosine | 5-Methylthioribose | Aminodeoxyfutalosine nucleosidase | Hydrolysis of a nucleotide | RHEA | 34755880 |
MMDBr0013248 | alpha-D-Glucosamine 1-phosphate | N-acetyl-alpha-D-glucosamine 1-phosphate | Bifunctional protein GlmU | N-Acetylation | RHEA | 34755880 |
MMDBr0013253 | alpha-Ketoglutarate | L-2-Hydroxyglutaric acid | Glutarate 2-hydroxylase | Hydroxylation | RHEA | 34755880 |
MMDBr0013254 | alpha-Ketoglutarate | L-2-Hydroxyglutaric acid | Glutarate 2-hydroxylase | Hydroxylation | RHEA | 34755880 |
MMDBr0013264 | Agmatine | Putrescine | Agmatinase | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0013274 | L-Homoserine | O-Phosphohomoserine | Homoserine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013280 | D-Arabinose 5-phosphate | 3-deoxy-alpha-D-manno-2-octulosonate-8-phosphate | 2-dehydro-3-deoxyphosphooctonate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0013295 | (S)-4-Amino-5-oxopentanoate | 5-Aminolevulinic acid | Glutamate-1-semialdehyde 2,1-aminomutase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013303 | alpha-Ketoglutarate | 3-Phosphonatooxypyruvate(3-) | Phosphoserine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013305 | 3-Dehydro-L-gulonate 6-phosphate | L-Xylulose 5-phosphate | 3-keto-L-gulonate-6-phosphate decarboxylase SgbH | Decarboxylation | RHEA | 34755880 |
MMDBr0013333 | N-Acetylglutamic acid | N-Acetyl-L-glutamyl 5-phosphate | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
MMDBr0013339 | aldehydo-D-ribose 5-phosphate | D-Ribulose 5-phosphate | Bifunctional ribokinase/ribose-5-phosphate isomerase A | Isomerization | RHEA | 34755880 |
MMDBr0013362 | L-Arabinose | L-Ribulose | L-arabinose isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013370 | L-Glutamic acid | gamma-L-Glutamyl 5-phosphate | Glutamate 5-kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013376 | S-Adenosylmethionine | (E)-3-(Methoxycarbonyl)pent-2-enedioate | Trans-aconitate 2-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0013390 | 3'-dephospho-CoA | 2'-(5''-triphospho-alpha-D-ribosyl)-3'-dephospho-CoA | Probable 2-(5''-triphosphoribosyl)-3'-dephosphocoenzyme-A synthase | Synthesis | RHEA | 34755880 |
MMDBr0013395 | Pyridoxine 5'-phosphate | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013397 | N-Succinyl-L-glutamate | L-Glutamic acid | Succinylglutamate desuccinylase | Hydrolysis of carbon-nitrogen bond | RHEA | 34755880 |
MMDBr0013399 | L-Arginine | N2-succinyl-L-arginine | Arginine N-succinyltransferase | Transfer of succinyl moiety | RHEA | 34755880 |
MMDBr0013401 | dGTP | Deoxyguanosine | Deoxyguanosinetriphosphate triphosphohydrolase | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0013413 | Ethanolamine | Acetaldehyde | Ethanolamine ammonia-lyase large subunit | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013422 | LL-2,6-Diaminoheptanedioate | Meso-2,6-Diaminoheptanedioate | Diaminopimelate epimerase | Epimerization; Racemization | RHEA | 34755880 |
MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013445 | Precorrin-2 | Sirohydrochlorin | Siroheme synthase | Dehydrogenation; Synthesis | RHEA | 34755880 |
MMDBr0013458 | Guanosine triphosphate | Guanosine diphosphate | Adenylosuccinate synthetase | Synthesis | RHEA | 34755880 |
MMDBr0013466 | Pyridoxamine 5'-phosphate | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013470 | (2R)-2-phosphoglyceric acid | (2R)-3-phosphoglyceric acid | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0013475 | N2-Acetylornithine | Acetic acid | N-acetyl-L-citrulline deacetylase | Deacetylation | RHEA | 34755880 |
MMDBr0013478 | S-Adenosylmethionine | Decarboxy-SAM | S-adenosylmethionine decarboxylase proenzyme | Decarboxylation | RHEA | 34755880 |
MMDBr0013488 | Thymidine | 2-deoxy-alpha-D-ribose 1-phosphate | Pyrimidine-nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0013489 | adenosylcob(III)inamide-GDP | coenzyme B12 | Adenosylcobinamide-GDP ribazoletransferase | Transfer of ribazole | RHEA | 34755880 |
MMDBr0013493 | Cytidine | Uridine | Cytidine deaminase | Deamination | RHEA | 34755880 |
MMDBr0013495 | beta-D-Fructose 6-phosphate | beta-D-Fructose 1,6-bisphosphate | ATP-dependent 6-phosphofructokinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013526 | Pantothenic acid | (R)-4'-phosphopantothenic acid | Bifunctional enzyme BirA/CoaX | Phosphorylation | RHEA | 34755880 |
MMDBr0013536 | Chorismate | 4-Hydroxybenzoic acid | Chorismate pyruvate-lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013542 | Formyl-CoA | formate | Formyl-CoA:oxalate CoA-transferase | Transfer of CoA moiety | RHEA | 34755880 |
MMDBr0013544 | alpha-Ketoglutarate | (R)-3-hydroxy-2-oxo-4-phosphooxybutanoic acid | Phosphoserine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013547 | Uridine triphosphate | Cytidine triphosphate | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0013564 | Potassium | Potassium | Potassium-transporting ATPase ATP-binding subunit | ATP hydrolysis | RHEA | 34755880 |
MMDBr0013565 | Potassium | Potassium | Potassium-transporting ATPase ATP-binding subunit | ATP hydrolysis | RHEA | 34755880 |
MMDBr0013584 | Hydrogen cyanide | Thiocyanate | Thiosulfate sulfurtransferase GlpE | Sulfuration | RHEA | 34755880 |
MMDBr0013590 | alpha-Ketoglutarate | L-Glutamic acid | Succinylornithine transaminase/acetylornithine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013607 | (S)(+)-Allantoin | Allantoic acid | Allantoinase | Carbon-nitrogen bond hydrolysis | RHEA | 34755880 |
MMDBr0013627 | Inosinic acid | GMP | GMP reductase | Reduction | RHEA | 34755880 |
MMDBr0013632 | L-Fucose | L-Fuculose | L-fucose isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013642 | (S)-2,3,4,5-tetrahydrodipicolinate | (S)-2-succinylamino-6-oxoheptanedioic acid | 2,3,4,5-tetrahydropyridine-2,6-dicarboxylate N-succinyltransferase | Transfer of succinyl moiety | RHEA | 34755880 |
MMDBr0013652 | N-Acetyl-D-glucosamine | N-Acetyl-D-Glucosamine 6-Phosphate | N-acetylgalactosamine kinase AgaK | Phosphorylation | RHEA | 34755880 |
MMDBr0013659 | Guanosine triphosphate | 7,8-dihydroneopterin 3'-triphosphate | Bifunctional protein FolKE | Hydrolysis | RHEA | 34755880 |
MMDBr0013664 | ADP-D-glycero-beta-D-manno-heptose | ADP-L-glycero-beta-D-manno-heptose | ADP-L-glycero-D-manno-heptose-6-epimerase | Epimerization | RHEA | 34755880 |
MMDBr0013665 | D-Ribulose | D-Ribulose 5-phosphate | Ribulokinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013674 | Succinic acid | Succinyl-CoA | Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial | Ligation | RHEA | 34755880 |
MMDBr0013681 | Shikimate | 3-Dehydroshikimic acid | Pentafunctional AROM polypeptide | Dehydrogenation | RHEA | 34755880 |
MMDBr0013682 | Shikimate | 3-Dehydroshikimic acid | Quinate/shikimate dehydrogenase (NAD(+)) | Dehydrogenation | RHEA | 34755880 |
MMDBr0013683 | S-Ribosyl-L-homocysteine | (4S)-4,5-Dihydroxypentan-2,3-dione | S-ribosylhomocysteine lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013686 | S-Adenosylhomocysteine | Adenine | Aminodeoxyfutalosine nucleosidase | Hydrolysis of a nucleotide | RHEA | 34755880 |
MMDBr0013689 | D-Altronate | D-Tagaturonate | Altronate oxidoreductase | Redox reaction | RHEA | 34755880 |
MMDBr0013690 | D-Glucose | aldehydo-D-glucose 6-phosphate | Putative glucokinase-2 | Phosphorylation | RHEA | 34755880 |
MMDBr0013699 | Glyceric acid | 3-hydroxypyruvic acid | Glycerate dehydrogenase | Dehydrogenation; Reduction | RHEA | 34755880 |
MMDBr0013703 | Dihydroxyacetone phosphate | BPG | Methylglyoxal synthase | Synthesis | RHEA | 34755880 |
MMDBr0013708 | Inosinic acid | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of phosphoribosyl group; Synthesis | RHEA | 34755880 |
MMDBr0013709 | Phosphoribosyl pyrophosphate | Inosinic acid | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013745 | Coproporphyrinogen III | Protoporphyrinogen IX | Oxygen-dependent coproporphyrinogen-III oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013767 | Quinate | 3-Dehydroquinate | Quinate/shikimate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013768 | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013770 | Inosinic acid | Phosphoribosyl formamidocarboxamide | Bifunctional purine biosynthesis protein PurH | Hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0013771 | D-Ribulose 5-phosphate | L-3,4-Dihydroxybutan-2-one 4-phosphate | 3,4-dihydroxy-2-butanone 4-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013773 | 1-(5-phosphoribosyl)-ATP | Phosphoribosyl pyrophosphate | ATP phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013774 | L-Ribulose 5-phosphate | L-Xylulose 5-phosphate | Putative L-ribulose-5-phosphate 3-epimerase SgbU | Epimerization | RHEA | 34755880 |
MMDBr0013790 | Oxalacetic acid | Phosphoenolpyruvic acid | Phosphoenolpyruvate carboxykinase (ATP) | Phosphorylation | RHEA | 34755880 |
MMDBr0013796 | D-Galactonate | 2-Keto-3-deoxy-D-gluconic acid | L-arabinonate dehydratase | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0013798 | Glyceric acid | 3-hydroxypyruvic acid | Glyoxylate/hydroxypyruvate reductase A | Reduction | RHEA | 34755880 |
MMDBr0013801 | Phosphoenolpyruvic acid | UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine | UDP-N-acetylglucosamine 1-carboxyvinyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0013809 | Ribose-1-phosphate | D-Ribose-5-phosphate | Phosphopentomutase | Transfers of a phosphate group; Isomerization; Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0013811 | 4-Phospho-D-erythronate | (R)-3-hydroxy-2-oxo-4-phosphooxybutanoic acid | Erythronate-4-phosphate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013841 | 4-Aminobutyraldehyde | gamma-Aminobutyric acid | Gamma-aminobutyraldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013842 | 4-Aminobutyraldehyde | gamma-Aminobutyric acid | Gamma-aminobutyraldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013852 | 2-O-(alpha-D-mannosyl)-3-phosphoglyceric acid | (2R)-2-O-(alpha-D-mannosyl)-glyceric acid | Glucosyl-3-phosphoglycerate phosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0013884 | L-Aspartic acid | beta-Alanine | L-aspartate decarboxylase dtxS4 | Decarboxylation | RHEA | 34755880 |
MMDBr0013892 | N2-succinyl-L-arginine | N2-Succinyl-L-ornithine | N-succinylarginine dihydrolase | Hydrolysis | RHEA | 34755880 |
MMDBr0013895 | L-Glutamic-gamma-semialdehyde | gamma-L-Glutamyl 5-phosphate | Gamma-glutamyl phosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0013906 | Mannitol 1-phosphate | beta-D-Fructose 6-phosphate | Mannitol-1-phosphate 5-dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013908 | Guanosine triphosphate | Guanosine diphosphate | GTPase ArgK | Dephosphorylation; Hydrolysis; Nucleic acid synthesis and/or repair | RHEA | 34755880 |
MMDBr0013910 | L-Rhamnulose 1-phosphate | Limonene | Rhamnulose-1-phosphate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0013921 | (R)-4'-phosphopantetheine | 3'-dephospho-CoA | Phosphopantetheine adenylyltransferase | Dephosphorylation | RHEA | 34755880 |
MMDBr0013929 | Uroporphyrinogen III | Coproporphyrinogen III | Uroporphyrinogen decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013946 | Carbamoylphosphate | N-carbamoyl-L-aspartate | Protein pyrABCN | Transfer of a carbamoyl group | RHEA | 34755880 |
MMDBr0013956 | D-Mannonate | 2-Dehydro-3-deoxy-D-gluconate | D-galactonate dehydratase family member ManD | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0013960 | L-Rhamnulose | L-Rhamnulose 1-phosphate | Bifunctional enzyme RhaA/RhaB | Phosphorylation | RHEA | 34755880 |
MMDBr0013982 | 3-phenylpropanoic acid | Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol | 3-phenylpropionate/cinnamic acid dioxygenase subunit alpha | Oxygenation | RHEA | 34755880 |
MMDBr0014061 | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Chorismate | Chorismate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014068 | 3-Dehydroquinate | 3-Dehydroshikimic acid | Catabolic 3-dehydroquinase | Hydration/dehydration of C-O bond; Synthesis | RHEA | 34755880 |
MMDBr0014083 | Shikimate 3-phosphate | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Pentafunctional AROM polypeptide | Synthesis; Dehydration and isomerisation; Oxidation; Phosphorylation; Transfer of a carboxyvinyl group | RHEA | 34755880 |
MMDBr0014105 | (S)-malate(2-) | Oxalacetic acid | Malate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0014111 | alpha-Ketoisovaleric acid | 2-Isopropylmalic acid | Isopropyl malate synthase AMT7 | Synthesis | RHEA | 34755880 |
MMDBr0014113 | Polyphosphate | Polyphosphate | Endopolyphosphatase | Dephosphorylation; Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0014122 | FMNH2 | Flavin mononucleotide | NAD(P)H-dependent FMN reductase atnL | Reduction | RHEA | 34755880 |
MMDBr0014126 | Glycerol | Glycerol 3-phosphate | Glycerol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014141 | (S)-3-Hydroxybutanoyl-CoA | (3R)-3-hydroxybutanoyl-CoA | Fatty acid oxidation complex subunit alpha | Aerobic and anaerobic degradation of long-chain fatty acids | RHEA | 34755880 |
MMDBr0014154 | 3-Dehydro-L-gulonate | 2,3-Diketo-L-gulonate | 2,3-diketo-L-gulonate reductase | Reduction | RHEA | 34755880 |
MMDBr0014155 | 3-Dehydro-L-gulonate | 2,3-Diketo-L-gulonate | 2,3-diketo-L-gulonate reductase | Reduction | RHEA | 34755880 |
MMDBr0014160 | 3-deoxy-D-arabino-heptulosonate-7-phosphate | 3-Dehydroquinate | Pentafunctional AROM polypeptide | Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0014164 | L-Homoserine | O-Succinyl-L-homoserine | Homoserine O-succinyltransferase | Transfer of succinyl moiety | RHEA | 34755880 |
MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0014169 | L-Ribulose | L-Ribulose 5-phosphate | Ribulokinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014180 | (6S)-10-formyltetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Bifunctional purine biosynthesis protein PurH | Synthesis | RHEA | 34755880 |
MMDBr0014197 | Quinate | 3-Dehydroquinate | Quinate/shikimate dehydrogenase (NAD(+)) | Dehydrogenation | RHEA | 34755880 |
MMDBr0014198 | L-Ribulose 5-phosphate | Xylulose 5-phosphate | L-ribulose-5-phosphate 4-epimerase | Epimerization | RHEA | 34755880 |
MMDBr0014221 | heme b | Protoporphyrin IX | Deferrochelatase/peroxidase EfeB | Chelation | RHEA | 34755880 |
MMDBr0014225 | N-succinyl-(2S,6S)-2,6-diaminoheptanedioic acid | LL-2,6-Diaminoheptanedioate | Succinyl-diaminopimelate desuccinylase | Hydrolysis of carbon-nitrogen bond | RHEA | 34755880 |
MMDBr0014229 | 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate | (2S)-2-[5-Amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamido]succinic acid | Phosphoribosylaminoimidazole-succinocarboxamide synthase | Synthesis | RHEA | 34755880 |
MMDBr0014231 | dCTP | dCMP | CTP pyrophosphohydrolase | Dephosphorylation; Hydrolysis of bond | RHEA | 34755880 |
MMDBr0014234 | 2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-alpha-D-glucosaminyl 1-phosphate | lipid A disaccharide (E. coli) | Lipid-A-disaccharide synthase | Synthesis | RHEA | 34755880 |
MMDBr0014236 | dCTP | Deoxyuridine triphosphate | dCTP deaminase | Deamination | RHEA | 34755880 |
MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
MMDBr0014254 | D-Xylose | D-Xylulose | Xylose isomerase | Isomerization | RHEA | 34755880 |
MMDBr0014276 | D-Tagatose 1,6-bisphosphate | D-Glyceraldehyde 3-phosphate | D-tagatose-1,6-bisphosphate aldolase subunit GatY | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0014282 | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | 5-Aminoimidazole ribonucleotide | Bifunctional purine biosynthetic protein ADE5,7 | Ligation | RHEA | 34755880 |
MMDBr0014285 | L-Rhamnonate | 2-Dehydro-3-deoxy-L-rhamnonate | L-rhamnonate dehydratase | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014298 | Rhamnose | L-Rhamnulose | L-rhamnose isomerase | Isomerization | RHEA | 34755880 |
MMDBr0014311 | Isopentenyl pyrophosphate | Dimethylallylpyrophosphate | Isopentenyl-diphosphate Delta-isomerase | Isomerization | RHEA | 34755880 |
MMDBr0014316 | N-acetylneuraminate | N-acetyl-D-mannosamine | N-acetylneuraminate lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0014323 | L-Alanine | UDP-N-acetyl-alpha-D-muramoyl-L-alanine | Bifunctional enzyme MurC/Ddl | Ligation | RHEA | 34755880 |
MMDBr0014333 | alpha-D-Glucosamine 1-phosphate | D-glucosamine 6-phosphate | Phosphoglucosamine mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0014337 | 3-deoxy-D-manno-2-octulosonate | CMP-3-deoxy-beta-D-manno-octulosonate | 3-deoxy-manno-octulosonate cytidylyltransferase | Transfer of a cytidylyl group | RHEA | 34755880 |
MMDBr0014353 | adenosylcob(III)inamide-GDP | adenosylcob(III)alamin 5'-phosphate | Adenosylcobinamide-GDP ribazoletransferase | Transfer of ribazole | RHEA | 34755880 |
MMDBr0014367 | Adenine | Hypoxanthine | Adenine deaminase | Deamination | RHEA | 34755880 |
MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Reversible cyclization | RHEA | 34755880 |
MMDBr0014377 | alpha-Ketoglutarate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Histidinol-phosphate aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
MMDBr0014393 | 5-Dehydro-4-deoxy-D-glucuronate | (4S)-4,6-Dihydroxy-2,5-dioxohexanoate | 4-deoxy-L-threo-5-hexosulose-uronate ketol-isomerase | Isomerization | RHEA | 34755880 |
MMDBr0014407 | Argininosuccinic acid | fumarate | Bifunctional protein ArgHA | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0014417 | Adenosine phosphosulfate | Phosphoadenosine phosphosulfate | Adenylyl-sulfate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014426 | 4-Methyl-5-(2-hydroxyethyl)-thiazole | 4-methyl-5-(2-phosphooxyethyl)-thiazole | Probable thiamine biosynthetic bifunctional enzyme | Phosphorylation | RHEA | 34755880 |
MMDBr0014437 | L-Dihydroorotic acid | N-carbamoyl-L-aspartate | Dihydroorotase | Hydrolysis | RHEA | 34755880 |
MMDBr0014442 | Siroheme | Sirohydrochlorin | Sirohydrochlorin cobaltochelatase CbiKC | Synthesis | RHEA | 34755880 |
MMDBr0014444 | Uridine | Ribose-1-phosphate | Pyrimidine-nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0014449 | Deoxyadenosine | Inosine | Adenosine deaminase | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014450 | Deoxyadenosine | Inosine | Adenosine deaminase | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014477 | UDP-Glucuronic acid | UDP-β-L-threo-pentapyranos-4-ulose | Bifunctional polymyxin resistance protein ArnA | Oxidative decarboxylation | RHEA | 34755880 |
MMDBr0014479 | (6S)-10-formyltetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Bifunctional polymyxin resistance protein ArnA | Oxidative decarboxylation | RHEA | 34755880 |
MMDBr0014481 | alpha-Ketoglutarate | L-Glutamic acid | UDP-4-amino-4-deoxy-L-arabinose--oxoglutarate aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0014486 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014487 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014489 | formate | N(2)-formyl-N(1)-(5-phospho-beta-D-ribosyl)glycinamide | Formate-dependent phosphoribosylglycinamide formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0014490 | formate | N(2)-formyl-N(1)-(5-phospho-beta-D-ribosyl)glycinamide | Formate-dependent phosphoribosylglycinamide formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0017917 | 5-Aminoimidazole ribonucleotide | 4-Amino-2-methyl-5-phosphomethylpyrimidine | Phosphomethylpyrimidine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014502 | 1,6-Anhydro-N-acetyl-beta-muramate | N-acetyl-D-muramate 6-phosphate | Anhydro-N-acetylmuramic acid kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014510 | trans-Cinnamic acid | cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol | 3-phenylpropionate/cinnamic acid dioxygenase subunit alpha | Oxygenation | RHEA | 34755880 |
MMDBr0014511 | Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol | 3-(2,3-Dihydroxyphenyl)propanoate | 3-phenylpropionate-dihydrodiol/cinnamic acid-dihydrodiol dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0014512 | cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol | (2E)-3-(2,3-dihydroxyphenyl)prop-2-enoic acid | 3-phenylpropionate-dihydrodiol/cinnamic acid-dihydrodiol dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0014514 | dCMP | dCDP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014515 | Pyridoxamine | Pyridoxamine 5'-phosphate | Pyridoxine/pyridoxal/pyridoxamine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014516 | Pyridoxine | Pyridoxine 5'-phosphate | Pyridoxine/pyridoxal/pyridoxamine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014523 | UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine | 2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-alpha-D-glucosaminyl 1-phosphate | UDP-2,3-diacylglucosamine hydrolase | Dephosphorylation; Hydrolysis of bond | RHEA | 34755880 |
MMDBr0014556 | GMP | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0014557 | Phosphoribosyl pyrophosphate | GMP | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0014559 | beta-D-Ribopyranose | beta-D-ribofuranose | L-fucose mutarotase | Mutarotation | RHEA | 34755880 |
MMDBr0014565 | alpha-L-Rhamnose | beta-L-Rhamnose | L-rhamnose mutarotase | Mutarotation | RHEA | 34755880 |
MMDBr0014566 | alpha-Ketoglutarate | 5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylic acid | 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014567 | 5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylic acid | (1R,6R)-6-Hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate | Putative 2-succinyl-6-hydroxy-2,4-cyclohexadiene-1-carboxylate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014579 | 2-Dehydro-3-deoxy-L-rhamnonate | Limonene | 2-keto-3-deoxy-L-rhamnonate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0014596 | Dihydroxyacetone phosphate | Quinolinic acid | Quinolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014597 | Dihydroxyacetone phosphate | Quinolinic acid | Quinolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014619 | L-3,4-Dihydroxybutan-2-one 4-phosphate | 6,7-Dimethyl-8-(1-D-ribityl)lumazine | 6,7-dimethyl-8-ribityllumazine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014642 | N-acetyl-D-muramate 6-phosphate | D-Lactic acid | N-acetylmuramic acid 6-phosphate etherase | Bond cleavage | RHEA | 34755880 |
MMDBr0017926 | L-Glutamine | Cytidine triphosphate | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0014644 | 3-hydroxypropanoic acid | Malonic semialdehyde | Probable malonic semialdehyde reductase RutE | Dehydrogenation; Reduction | RHEA | 34755880 |
MMDBr0014685 | Chitobiose | Acetic acid | Chitooligosaccharide deacetylase | Deacetylation | RHEA | 34755880 |
MMDBr0014686 | D-glycero-beta-D-manno-heptose 7-phosphate | D-glycero-beta-D-manno-heptose 1,7-bisphosphate | D-beta-D-heptose 7-phosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014688 | D-Sedoheptulose 7-phosphate | D-glycero-alpha-D-manno-heptose 7-phosphate | Phosphoheptose isomerase | Isomerization | RHEA | 34755880 |
MMDBr0014707 | Xanthosine | Ribose-1-phosphate | Pyrimidine/purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0014708 | Deoxyadenosine | Adenine | Purine nucleoside phosphorylase DeoD-type | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014710 | Inosine | Ribose-1-phosphate | Purine nucleoside phosphorylase DeoD-type | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014718 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014719 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014720 | D-Galacturonate | D-Tagaturonate | Uronate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0014725 | di-trans,octa-cis-undecaprenyl phosphate | 4-deoxy-4-formamido-alpha-L-arabinopyranosyl di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-phosphate 4-deoxy-4-formamido-L-arabinose transferase | Transfer of 4-deoxy-4-formamido-L-arabinose from UDP to undecaprenyl phosphate | RHEA | 34755880 |
MMDBr0014726 | 5-Dehydro-4-deoxy-D-glucarate | 2-Hydroxy-3-oxopropanoate | 5-keto-4-deoxy-D-glucarate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0014732 | 4-Hydroxybenzoic acid | 3-Octaprenyl-4-hydroxybenzoate | 4-hydroxybenzoate octaprenyltransferase | Synthesis; Reverse C-prenylation of phenalenone | RHEA | 34755880 |
MMDBr0014751 | 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate | 4-Amino-2-methyl-5-phosphomethylpyrimidine | HMP-PP phosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014763 | 7-Deaza-7-carboxyguanine | 7-Cyano-7-carbaguanine | 7-cyano-7-deazaguanine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017930 | N-Methyltryptophan | Formaldehyde | N-methyl-L-tryptophan oxidase | Oxidation | RHEA | 34755880 |
MMDBr0014783 | di-trans,octa-cis-undecaprenyl diphosphate | di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-diphosphatase BcrC | Dephosphorylation | RHEA | 34755880 |
MMDBr0014813 | Inosine triphosphate | IDP | Bifunctional phosphopantetheine adenylyltransferase/NTP phosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014820 | N-acetyl-alpha-D-glucosaminyl-di-trans,octa-cis-undecaprenyl diphosphate | beta-D-ManNAcA-(1->4)-alpha-D-GlcNAc-di-trans,octa-cis-undecaprenyl diphosphate | UDP-N-acetyl-D-mannosaminuronic acid transferase | Transfer of UDP-N-acetyl-D-mannosaminuronic acid | RHEA | 34755880 |
MMDBr0014821 | Oxalacetic acid | Hydrogen carbonate | Phosphoenolpyruvate carboxylase | Carboxylation | RHEA | 34755880 |
MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transfer of phospho-N-acetylmuramoyl-pentapeptide | RHEA | 34755880 |
MMDBr0014829 | Xanthosine 5-triphosphate | XDP | Bifunctional phosphopantetheine adenylyltransferase/NTP phosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014832 | (R)-Carnitine | (R)-carnitinyl-CoA | L-carnitine CoA-transferase | Transfer of CoA moiety | RHEA | 34755880 |
MMDBr0014843 | (R)-Carnitine | (R)-carnitinyl-CoA | Crotonobetaine/carnitine--CoA ligase | Ligation | RHEA | 34755880 |
MMDBr0014844 | (R)-Carnitine | (R)-carnitinyl-CoA | L-carnitine CoA-transferase | Transfer of CoA moiety | RHEA | 34755880 |
MMDBr0014846 | Thymidine 5'-triphosphate | 5-Thymidylic acid | dTTP/UTP pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014855 | beta-D-ManNAcA-(1->4)-alpha-D-GlcNAc-di-trans,octa-cis-undecaprenyl diphosphate | Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose | TDP-N-acetylfucosamine:lipid II N-acetylfucosaminyltransferase | Transfer of TDP-N-acetylfucosamine:lipid II N-acetylfucosaminyl group | RHEA | 34755880 |
MMDBr0014858 | L-Ascorbate 6-phosphate | 3-Dehydro-L-gulonate 6-phosphate | Probable L-ascorbate-6-phosphate lactonase UlaG | Hydrolysis | RHEA | 34755880 |
MMDBr0014893 | Inosine | Inosine | Purine ribonucleoside efflux pump NepI | Efflux of purine ribonucleosides | RHEA | 34755880 |
MMDBr0014894 | Inosine | Inosine | Purine ribonucleoside efflux pump NepI | Efflux of purine ribonucleosides | RHEA | 34755880 |
MMDBr0014911 | (R)-Carnitine | (R)-Carnitine | L-carnitine/gamma-butyrobetaine antiporter | Transport | RHEA | 34755880 |
MMDBr0014918 | Potassium | Potassium | K(+)/H(+) antiporter NhaP2 | Transport | RHEA | 34755880 |
MMDBr0014919 | Potassium | Potassium | K(+)/H(+) antiporter NhaP2 | Transport | RHEA | 34755880 |
MMDBr0014922 | Guanosine | Guanosine | Purine ribonucleoside efflux pump NepI | Efflux of purine ribonucleosides | RHEA | 34755880 |
MMDBr0014923 | Guanosine | Guanosine | Purine ribonucleoside efflux pump NepI | Efflux of purine ribonucleosides | RHEA | 34755880 |
MMDBr0014941 | 5'-Deoxyadenosine | 5'-Deoxyribose | Aminodeoxyfutalosine nucleosidase | Hydrolysis of a nucleotide | RHEA | 34755880 |
MMDBr0014942 | 5'-Deoxyadenosine | 5'-Deoxyribose | 5'-methylthioadenosine/S-adenosylhomocysteine nucleosidase | Hydrolysis of a nucleotide | RHEA | 34755880 |
MMDBr0014961 | Crotonobetaine | Crotonobetainyl-CoA | Crotonobetaine/carnitine--CoA ligase | Ligation | RHEA | 34755880 |
MMDBr0015026 | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | di-trans-octa-cis-undecaprenyl diphospho-[N-acetyl-alpha-D-glucosaminyl-(1->4)]-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 1; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 2; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 3 | RHEA | 34755880 |
MMDBr0015055 | FMNH2 | (Z)-3-Ureidoacrylate | Pyrimidine monooxygenase RutA | Oxygenation | RHEA | 34755880 |
MMDBr0015056 | FMNH2 | (Z)-2-methylureidoacrylic acid | Pyrimidine monooxygenase RutA | Oxygenation | RHEA | 34755880 |
MMDBr0015057 | (Z)-3-Ureidoacrylate | 3-Aminoacrylate | Ureidoacrylate amidohydrolase RutB | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0015135 | 4-(phosphooxy)-L-threonine | 3-Amino-2-oxopropyl phosphate | 4-hydroxythreonine-4-phosphate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0015136 | 3-Isopropylmalate | 2-Isopropylmalic acid | 3-isopropylmalate dehydratase large subunit gloJ | Isomerization | RHEA | 34755880 |
MMDBr0015149 | S-Adenosylmethionine | Precorrin-2 | Siroheme synthase | Methylation; Synthesis | RHEA | 34755880 |
MMDBr0015384 | 3-Aminoacrylate | Malonic semialdehyde | Putative aminoacrylate peracid reductase RutC | Reduction | RHEA | 34755880 |
MMDBr0015391 | Diacetylchitobiose-6-phosphate | Acetic acid | Chitooligosaccharide deacetylase | Deacetylation | RHEA | 34755880 |
MMDBr0015402 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
MMDBr0015405 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
MMDBr0015480 | Phosphoribosyl pyrophosphate | nicotinate beta-D-ribonucleotide | Probable nicotinate phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0015860 | (Z)-2-methylureidoacrylic acid | (Z)-2-methylaminoacrylic acid | Ureidoacrylate amidohydrolase RutB | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0015861 | (Z)-3-Ureidoacrylate | 3-Aminoacrylate | Ureidoacrylate amidohydrolase RutB | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0015916 | 1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (flavodoxin) | Synthesis | RHEA | 34755880 |
MMDBr0016462 | (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate | Cyclic pyranopterin monophosphate | Cyclic pyranopterin monophosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0016554 | gamma-Butyrobetainyl-CoA | Crotonobetainyl-CoA | Crotonobetainyl-CoA reductase | Reduction | RHEA | 34755880 |
MMDBr0016558 | D-5-phenylhydantoin | N-carbamoyl-D-phenylglycine | D-phenylhydantoinase | Stereospecific hydrolysis | RHEA | 34755880 |
MMDBr0017981 | Prephenate | 3-phenylpyruvic acid | Carboxy-S-adenosyl-L-methionine synthase | Synthesis | RHEA | 34755880 |
MMDBr0016600 | Cytidine | Ribose-1-phosphate | Pyrimidine/purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0016815 | 4-Trimethylammoniobutanoic acid | gamma-Butyrobetainyl-CoA | Crotonobetaine/carnitine--CoA ligase | Ligation | RHEA | 34755880 |
MMDBr0016872 | N(2)-(1-hydroxy-2-oxopropyl)-dGTP | dGTP | Protein/nucleic acid deglycase HchA | Hydrolysis | RHEA | 34755880 |
MMDBr0016873 | N(2)-(1-hydroxy-2-oxoethyl)-dGTP | dGTP | Protein/nucleic acid deglycase HchA | Hydrolysis | RHEA | 34755880 |
MMDBr0016874 | N(2)-(1-hydroxy-2-oxoethyl)-GTP | Glycolic acid | Protein/nucleic acid deglycase HchA | Hydrolysis | RHEA | 34755880 |
MMDBr0016875 | N(2)-(1-hydroxy-2-oxopropyl)-GTP | Guanosine triphosphate | Protein/nucleic acid deglycase HchA | Hydrolysis | RHEA | 34755880 |
MMDBr0016876 | N(2)-(1-hydroxy-2-oxopropyl)-GDP | Guanosine diphosphate | Protein/nucleic acid deglycase HchA | Hydrolysis | RHEA | 34755880 |
MMDBr0016877 | N(2)-(1-hydroxy-2-oxoethyl)-GDP | Guanosine diphosphate | Protein/nucleic acid deglycase HchA | Hydrolysis | RHEA | 34755880 |
MMDBr0016878 | N(2)-(1-hydroxy-2-oxopropyl)-GMP | GMP | Protein/nucleic acid deglycase HchA | Hydrolysis | RHEA | 34755880 |
MMDBr0016879 | N(2)-(1-hydroxy-2-oxoethyl)-GMP | Glycolic acid | Protein/nucleic acid deglycase HchA | Hydrolysis | RHEA | 34755880 |
MMDBr0017136 | alpha-Ketoglutarate | 5-Aminopentanal | Putrescine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0017137 | alpha-Ketoglutarate | 5-Aminopentanal | Putrescine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0017138 | 5-Aminopentanal | 5-Aminopentanoic acid | Gamma-aminobutyraldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0017139 | 5-Aminopentanal | 5-Aminopentanoic acid | Gamma-aminobutyraldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0017322 | N(4)-acetylcytidine | Acetic acid | N(4)-acetylcytidine amidohydrolase | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0017323 | N(4)-acetyl-2'-deoxycytidine | Deoxycytidine | N(4)-acetylcytidine amidohydrolase | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0017324 | N(4)-acetylcytosine | Acetic acid | N(4)-acetylcytidine amidohydrolase | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0017834 | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | D-Glyceraldehyde 3-phosphate | Tryptophan synthase | Synthesis | RHEA | 34755880 |
MMDBr0017839 | L-Aspartic acid | L-Asparagine | Aspartate--ammonia ligase | Ligation | RHEA | 34755880 |
MMDBr0017843 | L-Glutamine | GMP | GMP synthase [glutamine-hydrolyzing] | Synthesis | RHEA | 34755880 |
MMDBr0017850 | L-Threonine | L-2-Amino-3-oxobutanoic acid | L-threonine 3-dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0017852 | L-Cysteine | gamma-Glutamylcysteine | Glutamate--cysteine ligase EgtA | Ligation | RHEA | 34755880 |
MMDBr0017871 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Serine hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0017874 | L-Glutamine | L-Glutamic acid | Thermolabile glutaminase | Synthesis | RHEA | 34755880 |
MMDBr0017886 | L-Tryptophan | Indole | Probable tryptophanase | Non-hydrolytic bond cleavage | RHEA | 34755880 |
MMDBr0017897 | L-Methionine | S-Adenosylmethionine | S-adenosylmethionine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | Synthesis | RHEA | 34755880 |
MMDBr0024345 | L-Tyrosine | Hydrogen Ion | Tyrosine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024368 | L-Isoleucine | diphosphate | Isoleucine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024386 | Selenocysteine | hydrogenselenide | Cysteine desulfurase | Desulfuration | RHEA | 34755880 |
MMDBr0024389 | L-Leucine | diphosphate | Leucine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024392 | L-Cystine | L-Cysteine | Phosphoadenosine 5'-phosphosulfate reductase | Reduction | RHEA | 34755880 |
MMDBr0024401 | L-Serine | Adenosine 3',5'-diphosphate | Holo-[acyl-carrier-protein] synthase | Dehydrogenation; Synthesis | RHEA | 34755880 |
MMDBr0024411 | L-Serine | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024415 | (S)-4-Amino-5-oxopentanoate | Hydrogen Ion | Glutamyl-tRNA reductase | Reduction | RHEA | 34755880 |
MMDBr0024424 | S-Adenosylmethionine | S-Adenosylhomocysteine | Protein-L-isoaspartate O-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0024435 | Deoxyribose 5-phosphate | Acetaldehyde | Deoxyribose-phosphate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0024449 | L-Methionine | diphosphate | Methionine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024454 | D-Galactose | Galactose 1-phosphate | Galactokinase | Phosphorylation | RHEA | 34755880 |
MMDBr0024459 | Uridine triphosphate | diphosphate | Bifunctional uridylyltransferase/uridylyl-removing enzyme | Transfer of an uridylyl group | RHEA | 34755880 |
MMDBr0024469 | Geranyl diphosphate | diphosphate | tRNA 2-selenouridine synthase | Synthesis | RHEA | 34755880 |
MMDBr0024470 | Geranyl diphosphate | diphosphate | tRNA 2-selenouridine synthase | Synthesis | RHEA | 34755880 |
MMDBr0024471 | L-Methionine | L-Cysteine | Peptide methionine sulfoxide reductase MsrA | Reduction | RHEA | 34755880 |
MMDBr0024474 | L-Proline | diphosphate | Proline--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024477 | Cytidine triphosphate | diphosphate | CCA-adding enzyme | Synthesis and repair of 3'-terminal CCA sequence of tRNA | RHEA | 34755880 |
MMDBr0024500 | Glycerol 3-phosphate | CoA | Glycerol-3-phosphate acyltransferase | Acylation | RHEA | 34755880 |
MMDBr0024522 | Glycine | diphosphate | Glycine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024530 | L-Serine | diphosphate | Apo-citrate lyase phosphoribosyl-dephospho-CoA transferase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0024535 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA large subunit methyltransferase F | Methylation | RHEA | 34755880 |
MMDBr0024537 | di-mu-Sulfido-diiron(1+) | di-mu-Sulfido-diiron(2+) | Toluene 1,2-dioxygenase system ferredoxin--NAD(+) reductase component | Reduction | RHEA | 34755880 |
MMDBr0024539 | Tetra-mu3-sulfido-tetrairon(2+) | 5'-Deoxyadenosine | Lipoyl synthase | Synthesis | RHEA | 34755880 |
MMDBr0024548 | (6S)-5,6,7,8-tetrahydrofolic acid | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | Probable aminomethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0024559 | Adenosine triphosphate | Hydrogen Ion | Histidine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024578 | Adenosine triphosphate | diphosphate | Cysteine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024581 | Water | Hydrogen Ion | Cobalamin import ATP-binding protein BtuD | Transport | RHEA | 34755880 |
MMDBr0024590 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0024593 | ADP-alpha-D-glucose | Hydrogen Ion | Probable glycogen synthase | Synthesis | RHEA | 34755880 |
MMDBr0024595 | alpha-Ketoglutarate | L-Glutamic acid | Putrescine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0024596 | alpha-Ketoglutarate | L-Glutamic acid | Putrescine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0024602 | L-Tyrosine | diphosphate | Bifunctional glutamine synthetase adenylyltransferase/adenylyl-removing enzyme | Synthesis | RHEA | 34755880 |
MMDBr0024612 | Glycerol 3-phosphate | Dihydroxyacetone phosphate | Probable anaerobic glycerol-3-phosphate dehydrogenase subunit B | Dehydrogenation | RHEA | 34755880 |
MMDBr0024628 | L-Phenylalanine | Hydrogen Ion | Phenylalanine--tRNA ligase beta subunit | Ligation | RHEA | 34755880 |
MMDBr0024630 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase A | Methylation | RHEA | 34755880 |
MMDBr0024632 | L-Aspartic acid | diphosphate | Aspartate--tRNA(Asp) ligase | Ligation | RHEA | 34755880 |
MMDBr0024636 | Phosphate | Ribose-1-phosphate | Probable 6-oxopurine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0024644 | L-Cystine | L-Cysteine | Peptide methionine sulfoxide reductase MsrA | Reduction | RHEA | 34755880 |
MMDBr0024649 | L-Glutamine | diphosphate | Glutamine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024656 | L-Arginine | diphosphate | Arginine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024688 | Acetyl-CoA | CoA | 3-ketoacyl-CoA thiolase | Carbon–carbon-bond formation | RHEA | 34755880 |
MMDBr0024706 | Water | Hydroxylamine | Hydroxylamine reductase | Reduction | RHEA | 34755880 |
MMDBr0024716 | NAD | Hydrogen Ion | Fatty acid oxidation complex subunit alpha | Dehydrogenation | RHEA | 34755880 |
MMDBr0024721 | Selenophosphate | Phosphate | L-seryl-tRNA(Sec) selenium transferase | Transfer of L-seryl-tRNA(Sec) selenium | RHEA | 34755880 |
MMDBr0024731 | FMNH2 | Flavin mononucleotide | Alkanesulfonate monooxygenase | Oxygenation | RHEA | 34755880 |
MMDBr0024750 | Guanosine triphosphate | formate | GTP cyclohydrolase-2 | Hydrolysis of bond; Synthesis | RHEA | 34755880 |
MMDBr0024751 | lipid II(3−) | di-trans,octa-cis-undecaprenyl diphosphate | Penicillin-binding protein 2a | Glycan chain elongation | RHEA | 34755880 |
MMDBr0024755 | Adenosine triphosphate | Hydrogen Ion | N-acetylmannosamine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0024759 | Adenosine triphosphate | diphosphate | RNA 3'-terminal phosphate cyclase | Cycle formation | RHEA | 34755880 |
MMDBr0024765 | 7-Aminomethyl-7-carbaguanine | Guanine | Putative queuine tRNA-ribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0024768 | L-Methionine | L-Cysteine | Peptide methionine sulfoxide reductase MsrB | Reduction | RHEA | 34755880 |
MMDBr0024770 | di-mu-Sulfido-diiron(1+) | L-Cysteine | Probable tRNA sulfurtransferase | Sulfuration | RHEA | 34755880 |
MMDBr0024774 | Glycine | Carbon dioxide | Probable glycine dehydrogenase (decarboxylating) subunit 1 | Dehydrogenation | RHEA | 34755880 |
MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Methionyl-tRNA formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0024779 | N-Formyl-L-methionine | formate | Peptide deformylase 1 | Removal of the N-terminal formyl group | RHEA | 34755880 |
MMDBr0024782 | di-mu-Sulfido-diiron(2+) | di-mu-Sulfido-diiron(1+) | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0024787 | L-Threonine | Hydrogen Ion | Threonine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024789 | di-mu-Sulfido-diiron(2+) | di-mu-Sulfido-diiron(1+) | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0024796 | L-Fucose | beta-L-Fucopyranose | L-fucose mutarotase | Mutarotation | RHEA | 34755880 |
MMDBr0024808 | 1-Deoxy-D-xylulose 5-phosphate | 2-[(2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate | Thiazole synthase | Synthesis | RHEA | 34755880 |
MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | Transfer of a dimethylallyl group | RHEA | 34755880 |
MMDBr0024825 | Hydrogen Ion | ADP-D-glycero-beta-D-manno-heptose | Bifunctional protein HldE | Phosphorylation | RHEA | 34755880 |
MMDBr0024826 | 2-deoxy-alpha-D-ribose 1-phosphate | Deoxyribose 5-phosphate | Phosphopentomutase | Transfers of a phosphate group; Isomerization; Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0024831 | Deoxyadenosine | Deoxyinosine | Adenosine deaminase | Hydrolytic deamination | RHEA | 34755880 |
MMDBr0024832 | Deoxyadenosine | Deoxyinosine | Adenosine deaminase | Hydrolytic deamination | RHEA | 34755880 |
MMDBr0024834 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ubiquinone/menaquinone biosynthesis C-methyltransferase UbiE | Methylation | RHEA | 34755880 |
MMDBr0024842 | N-Acetylneuraminic acid | N-Acetylneuraminic acid | Sialic acid transporter NanT | Transport | RHEA | 34755880 |
MMDBr0024851 | L-Dihydroorotic acid | orotate | Dihydroorotate dehydrogenase (quinone) | Dehydrogenation | RHEA | 34755880 |
MMDBr0024875 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ubiquinone biosynthesis O-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0024883 | S-Adenosylmethionine | Adenine | S-adenosylmethionine:tRNA ribosyltransferase-isomerase | Isomerization | RHEA | 34755880 |
MMDBr0024892 | Trehalose | D-Glucose | Trehalase 1 | Hydrolysis | RHEA | 34755880 |
MMDBr0024957 | Phosphate | 2-deoxy-alpha-D-ribose 1-phosphate | Purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0024967 | S-Adenosylmethionine | S-Adenosylhomocysteine | tRNA (guanine(37)-N1)-methyltransferase Trm5b | Methylation | RHEA | 34755880 |
MMDBr0024971 | L-Threonylcarbamoyladenylate | Hydrogen Ion | tRNA N6-adenosine threonylcarbamoyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0025060 | L-Serine | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0025063 | S-Adenosylmethionine | S-Adenosylhomocysteine | 23S rRNA (uracil(747)-C(5))-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025066 | S-Adenosylmethionine | S-Adenosylhomocysteine | Demethylmenaquinone methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025072 | S-Adenosylmethionine | S-Adenosylhomocysteine | tRNA (uracil(54)-C(5))-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025073 | Selenophosphate | (2E)-thiogeraniol | tRNA 2-selenouridine synthase | Synthesis | RHEA | 34755880 |
MMDBr0025074 | Selenophosphate | (2E)-thiogeraniol | tRNA 2-selenouridine synthase | Synthesis | RHEA | 34755880 |
MMDBr0025075 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA large subunit methyltransferase E | Methylation | RHEA | 34755880 |
MMDBr0025078 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase G | Methylation | RHEA | 34755880 |
MMDBr0025084 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase B | Methylation | RHEA | 34755880 |
MMDBr0025085 | S-Adenosylmethionine | S-Adenosylhomocysteine | Putative ribosomal RNA large subunit methyltransferase H | Methylation | RHEA | 34755880 |
MMDBr0025086 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase F | Methylation | RHEA | 34755880 |
MMDBr0025092 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA large subunit methyltransferase M | Methylation | RHEA | 34755880 |
MMDBr0025101 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA large subunit methyltransferase I | Methylation | RHEA | 34755880 |
MMDBr0025102 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Ribosomal RNA large subunit methyltransferase N | Methylation | RHEA | 34755880 |
MMDBr0025105 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase H | Methylation | RHEA | 34755880 |
MMDBr0025129 | S-Adenosylmethionine | S-Adenosylhomocysteine | tRNA1(Val) (adenine(37)-N6)-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025144 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase J | Methylation | RHEA | 34755880 |
MMDBr0025145 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Probable dual-specificity RNA methyltransferase RlmN | Methylation | RHEA | 34755880 |
MMDBr0025149 | L-Serine | Hydrogen Ion | Isocitrate dehydrogenase kinase/phosphatase | Dehydrogenation; Phosphorylation | RHEA | 34755880 |
MMDBr0025152 | S-Adenosylmethionine | S-Adenosylhomocysteine | tRNA/tmRNA (uracil-C(5))-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025165 | Phosphate | L-Tyrosine | Bifunctional glutamine synthetase adenylyltransferase/adenylyl-removing enzyme | Synthesis | RHEA | 34755880 |
MMDBr0025190 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ubiquinone biosynthesis O-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025193 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0025198 | Adenosine triphosphate | diphosphate | Medium/long-chain-fatty-acid--[acyl-carrier-protein] ligase MbtM | Ligation | RHEA | 34755880 |
MMDBr0025205 | L-Lactic acid | Pyruvic acid | L-lactate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0025214 | (S)-malate(2-) | Oxalacetic acid | Probable malate:quinone oxidoreductase | Redox reaction | RHEA | 34755880 |
MMDBr0025215 | ADP | Hydrogen Ion | Putative phosphoenolpyruvate synthase regulatory protein | Synthesis | RHEA | 34755880 |
MMDBr0025216 | Hydrogen Ion | NAD | NAD(P)H dehydrogenase (quinone) | Dehydrogenation; Redox reaction; Reduction | RHEA | 34755880 |
MMDBr0025217 | Hydrogen Ion | NADP(+) | NAD(P)H dehydrogenase (quinone) | Dehydrogenation; Redox reaction; Reduction | RHEA | 34755880 |
MMDBr0025300 | Hydrogen Ion | diphosphate | Putative phosphoenolpyruvate synthase regulatory protein | Synthesis | RHEA | 34755880 |
MMDBr0025320 | (R)-Lipoic acid | Hydrogen Ion | Lipoate-protein ligase A subunit 1 | Ligation | RHEA | 34755880 |
MMDBr0025326 | Guanosine triphosphate | 5'-Deoxyadenosine | Probable GTP 3',8-cyclase | Cycle formation | RHEA | 34755880 |
MMDBr0025389 | L-Methionine | Methionine sulfoxide | Protein-methionine-sulfoxide reductase catalytic subunit MsrP | Reduction | RHEA | 34755880 |
MMDBr0025432 | carboxy-S-adenosyl-L-methionine | S-Adenosylhomocysteine | tRNA U34 carboxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025490 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal protein L11 methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025493 | L-Tyrosine | diphosphate | Protein adenylyltransferase MntA | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025494 | L-Tyrosine | diphosphate | Protein adenylyltransferase SelO | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025495 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025496 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025514 | Acetyl-CoA | Malonyl-CoA | Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha | Carboxylation | RHEA | 34755880 |
MMDBr0025620 | L-Cysteine | Sn-Glycerol-1-phosphate | Phosphatidylglycerol--prolipoprotein diacylglyceryl transferase | Transfer of the diacylglyceryl group | RHEA | 34755880 |
MMDBr0025638 | Adenosine triphosphate | L-Cysteine | tRNA-cytidine(32) 2-sulfurtransferase | Sulfuration | RHEA | 34755880 |
MMDBr0025639 | Adenosine triphosphate | L-Cysteine | tRNA-cytidine(32) 2-sulfurtransferase | Sulfuration | RHEA | 34755880 |
MMDBr0025650 | Hydrogen Ion | Hydrogen Ion | NADH-quinone oxidoreductase subunit C/D | Redox reaction | RHEA | 34755880 |
MMDBr0025654 | L-Serine | diphosphate | Protein adenylyltransferase SelO | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025655 | L-Serine | diphosphate | Protein adenylyltransferase SelO | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025716 | Selenophosphate | (2E)-thiogeraniol | tRNA 2-selenouridine synthase | Synthesis | RHEA | 34755880 |
MMDBr0025717 | Selenophosphate | (2E)-thiogeraniol | tRNA 2-selenouridine synthase | Synthesis | RHEA | 34755880 |
MMDBr0026010 | Cytidine 3'-monophosphate | Cytidine | 5'/3'-nucleotidase SurE | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026011 | Guanosine 3'-phosphate | Guanosine | 5'/3'-nucleotidase SurE | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026012 | Uridine 3'-phosphate | Uridine | 5'/3'-nucleotidase SurE | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026013 | Adenosine 3'-phosphate | Adenosine | 5'/3'-nucleotidase SurE | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026014 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026015 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026016 | Phosphate | Guanosine 3',5'-bis(diphosphate) | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026017 | Phosphate | Adenosine diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026022 | Adenosine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026023 | Cytidine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026024 | Uridine 5'-monophosphate | Uridine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026025 | Guanosine monophosphate | Guanosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026046 | Uridine 5'-diphosphate | Uridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026047 | Uridine 5'-diphosphate | Cytidine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026048 | Guanosine 3',5'-bis(diphosphate) | Guanosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026065 | Cytidine triphosphate | Cytidine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
MMDBr0026066 | Uridine triphosphate | Uridine 5'-monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
MMDBr0026067 | Adenosine triphosphate | Adenosine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
MMDBr0026068 | Guanosine triphosphate | Guanosine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
MMDBr0026073 | Deoxyadenosine monophosphate | Deoxyadenosine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026074 | 2'-Deoxyguanosine 5'-monophosphate | Deoxyguanosine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026075 | 2'-Deoxyuridine 5'-phosphate | 2'-Deoxyuridine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026076 | 2'-Deoxycytidine 5'-phosphate | Deoxycytidine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026085 | Deoxyuridine-5'-diphosphate | Deoxyuridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026086 | 2'-Deoxycytidine 5'-diphosphate | Deoxycytidine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026087 | 2'-Deoxyadenosine 5'-diphosphate | Deoxyadenosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026088 | 2'-Deoxyguanosine 5'-diphosphate | 2'-Deoxyguanosine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026089 | Deoxyuridine triphosphate | 2'-Deoxyuridine 5'-phosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
MMDBr0026090 | Deoxycytidine 5'-triphosphate | 2'-Deoxycytidine 5'-phosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
MMDBr0026091 | Deoxyadenosine triphosphate | Deoxyadenosine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
MMDBr0026092 | 2'-Deoxyguanosine 5'-triphosphate | 2'-Deoxyguanosine 5'-monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |