MMDBr0012860 | (2R)-2-phosphoglyceric acid | Water | Enolase | Enolization | RHEA | 34755880 |
MMDBr0012876 | Deoxyuridine triphosphate | diphosphate | Probable deoxyuridine 5'-triphosphate nucleotidohydrolase | Dephosphorylation; Hydrolysis of bond | RHEA | 34755880 |
MMDBr0012889 | Pyroglutamic acid | ADP | 5-oxoprolinase | Hydrolysis | RHEA | 34755880 |
MMDBr0012895 | diphosphate | Phosphoribosyl pyrophosphate | Orotate phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012953 | (R)-Pantoate | Pantothenic acid | Pantothenate synthetase | Ligation; Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0012954 | Adenosine triphosphate | Argininosuccinic acid | Argininosuccinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0012970 | D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Imidazoleglycerol-phosphate dehydratase | Hydration/dehydration of C-O bond; Synthesis | RHEA | 34755880 |
MMDBr0012975 | NAD | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(+)] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012976 | NADP(+) | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(P)+] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012978 | Cyanate | Carbon dioxide | Cyanate hydratase | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012989 | Adenosine triphosphate | ADP | D-alanine--D-alanine ligase | Ligation | RHEA | 34755880 |
MMDBr0013001 | Acetic acid | Acetyl phosphate | Acetate kinase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0013026 | Hydrogen Ion | Carbon dioxide | Orotidine 5'-phosphate decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013027 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013045 | Alpha-D-glucose 6-phosphate | beta-D-Fructose 6-phosphate | Glucose-6-phosphate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013046 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | 3-methyl-2-oxobutanoate hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0013062 | (6R)-6-(l-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4a-hydroxypterin | 4a-Carbinolamine tetrahydrobiopterin | Putative pterin-4-alpha-carbinolamine dehydratase | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0013081 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 7,8-dihydrofolate monoglutamate | Bifunctional dihydrofolate reductase-thymidylate synthase | Reduction; Synthesis | RHEA | 34755880 |
MMDBr0013098 | NADP(+) | Hydrogen Ion | UDP-N-acetylenolpyruvoylglucosamine reductase | Reduction | RHEA | 34755880 |
MMDBr0013134 | D-Glyceraldehyde 3-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose-5-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013152 | L-Glutamic acid | D-Glutamate | L-alanine/L-glutamate racemase | Racemization; Synthesis | RHEA | 34755880 |
MMDBr0013173 | diphosphate | Phosphoribosyl pyrophosphate | Bifunctional protein PyrR | Transfer of phosphoribosyl group | RHEA | 34755880 |
MMDBr0013179 | Adenosine triphosphate | ADP | Replicase large subunit | Synthesis of a primer | RHEA | 34755880 |
MMDBr0013187 | Adenosine triphosphate | Shikimate 3-phosphate | Pentafunctional AROM polypeptide | Phosphorylation | RHEA | 34755880 |
MMDBr0013194 | Water | Hydroxymethylbilane | Porphobilinogen deaminase | Deamination | RHEA | 34755880 |
MMDBr0013198 | Water | Hydrogen Ion | Succinate-semialdehyde dehydrogenase [NADP(+)] | Dehydrogenation | RHEA | 34755880 |
MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0013224 | Hydrogen Ion | diphosphate | Bifunctional protein GlmU | N-Acetylation; Phosphorylation; Isomerization | RHEA | 34755880 |
MMDBr0013245 | Acetyl-CoA | CoA | L-serine/homoserine O-acetyltransferase | N-Acetylation; Synthesis | RHEA | 34755880 |
MMDBr0013246 | 2-C-methyl-D-erythritol 4-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose 5-phosphate reductoisomerase | Isomerization | RHEA | 34755880 |
MMDBr0013248 | Acetyl-CoA | CoA | Bifunctional protein GlmU | N-Acetylation | RHEA | 34755880 |
MMDBr0013295 | (S)-4-Amino-5-oxopentanoate | 5-Aminolevulinic acid | Glutamate-1-semialdehyde 2,1-aminomutase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013303 | alpha-Ketoglutarate | 3-Phosphonatooxypyruvate(3-) | Phosphoserine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013328 | aldehydo-D-glucose 6-phosphate | alpha,alpha-Trehalose 6-phosphate | Trehalose-6-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013333 | Adenosine triphosphate | ADP | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
MMDBr0013357 | (2R)-3-phosphoglyceric acid | (2R)-3-phospho-glyceroyl phosphate | Phosphoglycerate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013370 | Adenosine triphosphate | ADP | Glutamate 5-kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013376 | S-Adenosylmethionine | (E)-3-(Methoxycarbonyl)pent-2-enedioate | Trans-aconitate 2-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0013395 | Oxygen | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013422 | LL-2,6-Diaminoheptanedioate | Meso-2,6-Diaminoheptanedioate | Diaminopimelate epimerase | Epimerization; Racemization | RHEA | 34755880 |
MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013449 | Hydrogen Ion | Carbon dioxide | 4-hydroxy-4-methyl-2-oxoglutarate aldolase/4-carboxy-4-hydroxy-2-oxoadipate aldolase | Aldol addition (or reverse); Decarboxylation; Redox reaction | RHEA | 34755880 |
MMDBr0013458 | Guanosine triphosphate | Guanosine diphosphate | Adenylosuccinate synthetase | Synthesis | RHEA | 34755880 |
MMDBr0013464 | (7R,8S)-7,8-diammoniononanoic acid | Dethiobiotin | Biotin biosynthesis bifunctional protein BioCD | Amine group addition; Synthesis | RHEA | 34755880 |
MMDBr0013466 | Water | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013470 | (2R)-2-phosphoglyceric acid | (2R)-3-phosphoglyceric acid | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0013489 | adenosylcob(III)inamide-GDP | coenzyme B12 | Adenosylcobinamide-GDP ribazoletransferase | Transfer of ribazole | RHEA | 34755880 |
MMDBr0013526 | Pantothenic acid | (R)-4'-phosphopantothenic acid | Bifunctional enzyme BirA/CoaX | Phosphorylation | RHEA | 34755880 |
MMDBr0013529 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoylalanine--D-glutamate ligase | Ligation | RHEA | 34755880 |
MMDBr0013544 | alpha-Ketoglutarate | (R)-3-hydroxy-2-oxo-4-phosphooxybutanoic acid | Phosphoserine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013547 | Adenosine triphosphate | ADP | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0013549 | Adenosine monophosphate | Phosphoribosyl pyrophosphate | Adenine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013659 | Guanosine triphosphate | 7,8-dihydroneopterin 3'-triphosphate | Bifunctional protein FolKE | Hydrolysis | RHEA | 34755880 |
MMDBr0013674 | Adenosine triphosphate | ADP | Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial | Ligation | RHEA | 34755880 |
MMDBr0013735 | Acetyl-CoA | (S)-malate(2-) | Malate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013768 | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013771 | D-Ribulose 5-phosphate | L-3,4-Dihydroxybutan-2-one 4-phosphate | 3,4-dihydroxy-2-butanone 4-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013773 | 1-(5-phosphoribosyl)-ATP | Phosphoribosyl pyrophosphate | ATP phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013784 | D-Glyceraldehyde 3-phosphate | Dihydroxyacetone phosphate | Bifunctional PGK/TIM | Isomerization | RHEA | 34755880 |
MMDBr0013819 | aldehydo-D-glucose 6-phosphate | alpha,alpha-Trehalose 6-phosphate | Trehalose-6-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013848 | dCTP | diphosphate | dCTP deaminase, dUMP-forming | Deamination | RHEA | 34755880 |
MMDBr0013884 | Hydrogen Ion | beta-Alanine | L-aspartate decarboxylase dtxS4 | Decarboxylation | RHEA | 34755880 |
MMDBr0013886 | Carbamoylphosphate | Hydrogen Ion | Ornithine carbamoyltransferase | Transfer of a carbamoyl group | RHEA | 34755880 |
MMDBr0013896 | Polyphosphate | Polyphosphate | ADP-polyphosphate phosphotransferase | Transfer of phosphate group | RHEA | 34755880 |
MMDBr0013901 | Water | Citrulline | Arginine deiminase | Hydrolysis of l-arginine to citrulline and ammonium ion | RHEA | 34755880 |
MMDBr0013921 | (R)-4'-phosphopantetheine | 3'-dephospho-CoA | Phosphopantetheine adenylyltransferase | Dephosphorylation | RHEA | 34755880 |
MMDBr0013929 | Hydrogen Ion | Carbon dioxide | Uroporphyrinogen decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013946 | Carbamoylphosphate | Hydrogen Ion | Protein pyrABCN | Transfer of a carbamoyl group | RHEA | 34755880 |
MMDBr0013952 | 1-(5-phosphoribosyl)-5'-AMP | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | Histidine biosynthesis bifunctional protein HisIE | Hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0013970 | L-Alanine | D-Alanine | L-alanine/L-glutamate racemase | Racemization | RHEA | 34755880 |
MMDBr0013978 | Hydrogen peroxide | Water | Bromoperoxidase-catalase | Synthesis | RHEA | 34755880 |
MMDBr0014061 | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Chorismate | Chorismate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014068 | 3-Dehydroquinate | 3-Dehydroshikimic acid | Catabolic 3-dehydroquinase | Hydration/dehydration of C-O bond; Synthesis | RHEA | 34755880 |
MMDBr0014105 | (S)-malate(2-) | Hydrogen Ion | Malate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0014114 | N-(5-Phospho-D-ribosyl)anthranilate | 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate | Phosphoribosyl isomerase A | Isomerization | RHEA | 34755880 |
MMDBr0014117 | N-Acetyl-L-glutamate 5-semialdehyde | Hydrogen Ion | Protein ARG5,6, mitochondrial | Reduction | RHEA | 34755880 |
MMDBr0014128 | Hydrogen Ion | 3-phenylpyruvic acid | Bifunctional chorismate mutase/prephenate dehydratase | Dehydration and isomerisation | RHEA | 34755880 |
MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0014193 | 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate | diphosphate | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
MMDBr0014227 | (S)-4-hydroxy-2-oxopentanoic acid | Acetaldehyde | 4-hydroxy-2-oxovalerate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0014244 | 4-hydroxy-4-methyl-2-oxoglutarate | Pyruvic acid | 4-hydroxy-4-methyl-2-oxoglutarate aldolase cghB | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
MMDBr0014256 | 1-(5-phosphoribosyl)-ATP | 1-(5-phosphoribosyl)-5'-AMP | Phosphoribosyl-ATP pyrophosphatase | Dephosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0014257 | Adenosine triphosphate | Nicotinic acid adenine dinucleotide | Probable nicotinate-nucleotide adenylyltransferase | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0014313 | Acetaldehyde | Acetyl-CoA | Acetaldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0014323 | Adenosine triphosphate | ADP | Bifunctional enzyme MurC/Ddl | Ligation | RHEA | 34755880 |
MMDBr0014331 | alpha,alpha-Trehalose 6-phosphate | Trehalose | Trehalose-6-phosphate phosphatase | Dephosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0014333 | alpha-D-Glucosamine 1-phosphate | D-glucosamine 6-phosphate | Phosphoglucosamine mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0014340 | 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | Indole-3-glycerol phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014353 | adenosylcob(III)inamide-GDP | adenosylcob(III)alamin 5'-phosphate | Adenosylcobinamide-GDP ribazoletransferase | Transfer of ribazole | RHEA | 34755880 |
MMDBr0014366 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase | Ligation | RHEA | 34755880 |
MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Reversible cyclization | RHEA | 34755880 |
MMDBr0014377 | alpha-Ketoglutarate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Histidinol-phosphate aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
MMDBr0014407 | Argininosuccinic acid | fumarate | Bifunctional protein ArgHA | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0014447 | Adenosine triphosphate | ADP | UMP-CMP kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014449 | Deoxyadenosine | Inosine | Adenosine deaminase | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014450 | Deoxyadenosine | Inosine | Adenosine deaminase | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014484 | 3-(3-Hydroxyphenyl)propionate | 3-(2,3-Dihydroxyphenyl)propanoate | 3-(3-hydroxy-phenyl)propionate/3-hydroxycinnamic acid hydroxylase | Hydroxylation | RHEA | 34755880 |
MMDBr0014486 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014487 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0017917 | 5-Aminoimidazole ribonucleotide | 4-Amino-2-methyl-5-phosphomethylpyrimidine | Phosphomethylpyrimidine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014497 | Water | D-Serine | Sugar-phosphatase AraL | Dephosphorylation | RHEA | 34755880 |
MMDBr0014514 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014566 | alpha-Ketoglutarate | 5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylic acid | 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014596 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014597 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014619 | L-3,4-Dihydroxybutan-2-one 4-phosphate | 6,7-Dimethyl-8-(1-D-ribityl)lumazine | 6,7-dimethyl-8-ribityllumazine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014621 | 1D-myo-inositol 2-(L-cysteinylamino)-2-deoxy-alpha-D-glucopyranoside | CoA | Mycothiol acetyltransferase | N-Acetylation | RHEA | 34755880 |
MMDBr0017922 | X-14847 | 1D-myo-inositol 2-(L-cysteinylamino)-2-deoxy-alpha-D-glucopyranoside | L-cysteine:1D-myo-inositol 2-amino-2-deoxy-alpha-D-glucopyranoside ligase | Ligation | RHEA | 34755880 |
MMDBr0014622 | 1D-myo-inositol 2-acetamido-2-deoxy-alpha-D-glucopyranoside | X-14847 | 1D-myo-inositol 2-acetamido-2-deoxy-alpha-D-glucopyranoside deacetylase | Deacetylation | RHEA | 34755880 |
MMDBr0014623 | 1D-myo-inositol 3-phosphate | 1D-myo-inositol 2-acetamido-2-deoxy-alpha-D-glucopyranoside 3-phosphate | D-inositol 3-phosphate glycosyltransferase | Glycosylation | RHEA | 34755880 |
MMDBr0017926 | Adenosine triphosphate | ADP | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0014690 | 7,8-didemethyl-8-hydroxy-5-deazariboflavin | dehydro coenzyme F420-0 | Phosphoenolpyruvate transferase | Transfer of phosphoenolpyruvate | RHEA | 34755880 |
MMDBr0014718 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014719 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014742 | 3-Hydroxycinnamic acid | (2E)-3-(2,3-dihydroxyphenyl)prop-2-enoic acid | 3-(3-hydroxy-phenyl)propionate/3-hydroxycinnamic acid hydroxylase | Hydroxylation | RHEA | 34755880 |
MMDBr0014776 | Farnesyl pyrophosphate | diphosphate | Protoheme IX farnesyltransferase, mitochondrial | Farnesylation | RHEA | 34755880 |
MMDBr0014783 | di-trans,octa-cis-undecaprenyl diphosphate | di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-diphosphatase BcrC | Dephosphorylation | RHEA | 34755880 |
MMDBr0014821 | Oxalacetic acid | Hydrogen carbonate | Phosphoenolpyruvate carboxylase | Carboxylation | RHEA | 34755880 |
MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transfer of phospho-N-acetylmuramoyl-pentapeptide | RHEA | 34755880 |
MMDBr0014891 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Flavin-dependent thymidylate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014995 | Guanosine triphosphate | Guanosine diphosphate | Coenzyme F420:L-glutamate ligase | Ligation | RHEA | 34755880 |
MMDBr0014997 | Guanosine triphosphate | Guanosine diphosphate | Coenzyme F420:L-glutamate ligase | Ligation | RHEA | 34755880 |
MMDBr0015026 | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | di-trans-octa-cis-undecaprenyl diphospho-[N-acetyl-alpha-D-glucosaminyl-(1->4)]-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 1; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 2; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 3 | RHEA | 34755880 |
MMDBr0017950 | aldehydo-D-ribose 5-phosphate | Hydrogen Ion | Pyridoxal 5'-phosphate synthase subunit PDX1 | Synthesis | RHEA | 34755880 |
MMDBr0015097 | Adenosine triphosphate | ADP | Maltokinase | Phosphorylation | RHEA | 34755880 |
MMDBr0015133 | 3-Isopropylmalate | Ketoleucine | 3-isopropylmalate dehydrogenase AMT6 | Dehydrogenation | RHEA | 34755880 |
MMDBr0015136 | 3-Isopropylmalate | 2-Isopropylmalic acid | 3-isopropylmalate dehydratase large subunit gloJ | Isomerization | RHEA | 34755880 |
MMDBr0015325 | Guanosine triphosphate | diphosphate | Molybdenum cofactor guanylyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0015425 | Adenosine triphosphate | 3',3'-c-di-AMP | Cyclic di-AMP synthase CdaA | Cycle formation; Synthesis | RHEA | 34755880 |
MMDBr0016358 | 2-[(2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate | Carbon dioxide | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
MMDBr0016359 | 2-(2-Carboxy-4-methylthiazol-5-yl)ethyl phosphate | Carbon dioxide | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
MMDBr0016460 | Fe-coproporphyrin III | Coproporphyrin III | Coproporphyrin III ferrochelatase | Chelation; Synthesis | RHEA | 34755880 |
MMDBr0016461 | Coproporphyrin III | Fe-coproporphyrin III | Coproporphyrin III ferrochelatase | Chelation; Synthesis | RHEA | 34755880 |
MMDBr0016718 | ADP-alpha-D-glucose | ADP | Trehalose-6-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0016719 | CDPglucose | alpha,alpha-Trehalose 6-phosphate | Trehalose-6-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0016720 | aldehydo-D-glucose 6-phosphate | alpha,alpha-Trehalose 6-phosphate | Trehalose-6-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0016907 | Adenosine triphosphate | ADP | ATP synthase subunit alpha | ATP hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0017057 | Flavin mononucleotide | dehydro coenzyme F420-0 | Bifunctional F420 biosynthesis protein FbiB | Synthesis | RHEA | 34755880 |
MMDBr0017345 | Peroxynitrite | Nitrate | Peroxynitrite isomerase | Isomerization | RHEA | 34755880 |
MMDBr0017346 | Peroxynitrite | Nitrate | Peroxynitrite isomerase | Isomerization | RHEA | 34755880 |
MMDBr0017834 | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | D-Glyceraldehyde 3-phosphate | Tryptophan synthase | Synthesis | RHEA | 34755880 |
MMDBr0017852 | Adenosine triphosphate | ADP | Glutamate--cysteine ligase EgtA | Ligation | RHEA | 34755880 |
MMDBr0017871 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Serine hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0017874 | Water | L-Glutamic acid | Thermolabile glutaminase | Synthesis | RHEA | 34755880 |
MMDBr0017879 | Adenosine triphosphate | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | Phosphoribosylformylglycinamidine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017897 | Adenosine triphosphate | diphosphate | S-adenosylmethionine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017898 | 5-methyltetrahydropteroyltri-L-glutamate | L-Methionine | 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0017900 | Water | L-Serine | Phosphoserine phosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | Synthesis | RHEA | 34755880 |
MMDBr0024389 | Adenosine triphosphate | diphosphate | Leucine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024403 | Hydrogen Ion | Carbon dioxide | 3-oxoacyl-[acyl-carrier-protein] synthase 3 | Synthesis | RHEA | 34755880 |
MMDBr0024411 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024415 | (S)-4-Amino-5-oxopentanoate | Hydrogen Ion | Glutamyl-tRNA reductase | Reduction | RHEA | 34755880 |
MMDBr0024418 | Adenosine triphosphate | diphosphate | Alanine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024435 | Deoxyribose 5-phosphate | Acetaldehyde | Deoxyribose-phosphate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0024474 | Adenosine triphosphate | diphosphate | Proline--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024483 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | Amide group addition | RHEA | 34755880 |
MMDBr0024539 | Hydrogen Ion | 5'-Deoxyadenosine | Lipoyl synthase | Synthesis | RHEA | 34755880 |
MMDBr0024548 | (6S)-5,6,7,8-tetrahydrofolic acid | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | Probable aminomethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0024568 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | Amide group addition | RHEA | 34755880 |
MMDBr0024578 | Adenosine triphosphate | diphosphate | Cysteine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024590 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0024597 | L-Aspartic acid | diphosphate | Aspartate--tRNA(Asp/Asn) ligase | Ligation | RHEA | 34755880 |
MMDBr0024602 | Adenosine triphosphate | diphosphate | Bifunctional glutamine synthetase adenylyltransferase/adenylyl-removing enzyme | Synthesis | RHEA | 34755880 |
MMDBr0024616 | NAD | Hydrogen Ion | Type VI secretion system spike protein VgrG1 | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0024628 | Adenosine triphosphate | Hydrogen Ion | Phenylalanine--tRNA ligase beta subunit | Ligation | RHEA | 34755880 |
MMDBr0024630 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase A | Methylation | RHEA | 34755880 |
MMDBr0024666 | Adenosine triphosphate | diphosphate | Lysine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024707 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Biotin synthase | Synthesis | RHEA | 34755880 |
MMDBr0024750 | Water | Hydrogen Ion | GTP cyclohydrolase-2 | Hydrolysis of bond; Synthesis | RHEA | 34755880 |
MMDBr0024774 | Hydrogen Ion | Carbon dioxide | Probable glycine dehydrogenase (decarboxylating) subunit 1 | Dehydrogenation | RHEA | 34755880 |
MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | Hydrogen Ion | Methionyl-tRNA formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0024787 | Adenosine triphosphate | Hydrogen Ion | Threonine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024808 | 1-Deoxy-D-xylulose 5-phosphate | Water | Thiazole synthase | Synthesis | RHEA | 34755880 |
MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | Transfer of a dimethylallyl group | RHEA | 34755880 |
MMDBr0024817 | Hydrogen Ion | 6-Phosphonoglucono-D-lactone | F420-dependent glucose-6-phosphate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0024831 | Water | Ammonium | Adenosine deaminase | Hydrolytic deamination | RHEA | 34755880 |
MMDBr0024832 | Water | Ammonium | Adenosine deaminase | Hydrolytic deamination | RHEA | 34755880 |
MMDBr0024971 | L-Threonylcarbamoyladenylate | Hydrogen Ion | tRNA N6-adenosine threonylcarbamoyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0024974 | S-Adenosylmethionine | Hydrogen Ion | tRNA-2-methylthio-N(6)-dimethylallyladenosine synthase | Synthesis | RHEA | 34755880 |
MMDBr0025050 | Hydrogen Ion | Carbon dioxide | Putative 8-amino-7-oxononanoate synthase | Ligation; Synthesis | RHEA | 34755880 |
MMDBr0025060 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0025071 | S-Adenosylmethionine | S-Adenosylhomocysteine | tRNA (guanine-N(7)-)-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025105 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase H | Methylation | RHEA | 34755880 |
MMDBr0025154 | Water | Niacinamide | NAD-dependent protein deacetylase | Deacetylation | RHEA | 34755880 |
MMDBr0025165 | Phosphate | L-Tyrosine | Bifunctional glutamine synthetase adenylyltransferase/adenylyl-removing enzyme | Synthesis | RHEA | 34755880 |
MMDBr0025193 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0025258 | Adenosine triphosphate | Hydrogen Ion | tRNA-specific 2-thiouridylase MnmA | 2-Thiolation of uridine | RHEA | 34755880 |
MMDBr0025273 | Water | Niacinamide | NAD-dependent protein deacylase | Deacylation | RHEA | 34755880 |
MMDBr0025388 | L-Glutamic acid | Hydrogen Ion | Bifunctional F420 biosynthesis protein FbiB | Synthesis | RHEA | 34755880 |
MMDBr0025620 | L-Cysteine | Hydrogen Ion | Phosphatidylglycerol--prolipoprotein diacylglyceryl transferase | Transfer of the diacylglyceryl group | RHEA | 34755880 |
MMDBr0025650 | Hydrogen Ion | Hydrogen Ion | NADH-quinone oxidoreductase subunit C/D | Redox reaction | RHEA | 34755880 |
MMDBr0026014 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026015 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026016 | Phosphate | Guanosine 3',5'-bis(diphosphate) | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026017 | Phosphate | Adenosine diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026046 | Uridine 5'-diphosphate | Uridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026047 | Uridine 5'-diphosphate | Cytidine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026048 | Guanosine 3',5'-bis(diphosphate) | Guanosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026085 | Deoxyuridine-5'-diphosphate | Deoxyuridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026086 | 2'-Deoxycytidine 5'-diphosphate | Deoxycytidine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026087 | 2'-Deoxyadenosine 5'-diphosphate | Deoxyadenosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026088 | 2'-Deoxyguanosine 5'-diphosphate | 2'-Deoxyguanosine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |