MMDBr0012903 | Pyruvic acid | L-Alanine | Hypotaurine/taurine--pyruvate aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0012916 | D-Glyceraldehyde 3-phosphate | aldehydo-D-ribose 5-phosphate | Transketolase | Transfer of ketol group | RHEA | 34755880 |
MMDBr0012971 | beta-D-Fructose 1,6-bisphosphate | beta-D-Fructose 6-phosphate | Fructose-1,6-bisphosphatase/inositol-1-monophosphatase | Aldol addition (or reverse); Dephosphorylation | RHEA | 34755880 |
MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012996 | (S)-Ureidoglycolic acid | glyoxylate | Ureidoglycolate lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013163 | Glycine | 5-Aminolevulinic acid | 5-aminolevulinate synthase, mitochondrial | Synthesis | RHEA | 34755880 |
MMDBr0013207 | Water | Formaldehyde | Monomeric sarcosine oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013213 | 2-C-methyl-D-erythritol 4-phosphate | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase | Transfer of a cytidylyl group | RHEA | 34755880 |
MMDBr0013269 | Adenosine triphosphate | ADP | Magnesium-chelatase 60 kDa subunit | Chelation | RHEA | 34755880 |
MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013550 | (S)-malyl-CoA | Acetyl-CoA | Apparent malate synthase | Non-hydrolytic bond cleavage (or its reversal); Synthesis | RHEA | 34755880 |
MMDBr0013672 | Farnesyl pyrophosphate | (2E,6E,10E)-geranylgeranyl diphosphate | Variediene synthase | Synthesis; Reverse C-prenylation of phenalenone; Transfer of a prenyl group | RHEA | 34755880 |
MMDBr0013708 | diphosphate | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of phosphoribosyl group; Synthesis | RHEA | 34755880 |
MMDBr0013709 | Phosphoribosyl pyrophosphate | diphosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013717 | alpha-Ketoglutarate | L-Glutamic acid | Acetylornithine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013851 | Adenosine triphosphate | ADP | Cytochrome c biogenesis ATP-binding export protein CcmA | Transport | RHEA | 34755880 |
MMDBr0013905 | (E)-4-coumarate | (E)-4-coumaroyl-CoA | 4-coumarate--CoA ligase | Ligation | RHEA | 34755880 |
MMDBr0014117 | N-Acetyl-L-glutamate 5-semialdehyde | Hydrogen Ion | Protein ARG5,6, mitochondrial | Reduction | RHEA | 34755880 |
MMDBr0014135 | Water | Deoxyadenosine | Adenosylhomocysteinase | Reversible hydrolysis | RHEA | 34755880 |
MMDBr0014165 | Precorrin 4 | Precorrin 5 | Precorrin-4 C(11)-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
MMDBr0014256 | 1-(5-phosphoribosyl)-ATP | 1-(5-phosphoribosyl)-5'-AMP | Phosphoribosyl-ATP pyrophosphatase | Dephosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0014295 | (2R)-3-phosphoglyceric acid | Carbon dioxide | Ribulose bisphosphate carboxylase large chain | Carboxylation | RHEA | 34755880 |
MMDBr0014299 | Acetic acid | Acetyl-CoA | Acetyl-coenzyme A synthetase 1 | Ligation; Synthesis | RHEA | 34755880 |
MMDBr0014311 | Isopentenyl pyrophosphate | Dimethylallylpyrophosphate | Isopentenyl-diphosphate Delta-isomerase | Isomerization | RHEA | 34755880 |
MMDBr0014328 | NADP(+) | Hydrogen Ion | Precorrin-6A reductase | Reduction | RHEA | 34755880 |
MMDBr0014340 | 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | Indole-3-glycerol phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Reversible cyclization | RHEA | 34755880 |
MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
MMDBr0014423 | Acetyl phosphate | Phosphate | Sulfoacetaldehyde acetyltransferase | N-Acetylation | RHEA | 34755880 |
MMDBr0014556 | diphosphate | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0014557 | Phosphoribosyl pyrophosphate | diphosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0014629 | NADP(+) | 2-trans,6-trans,10-trans-Geranylgeranyl diphosphate | Geranylgeranyl diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0014669 | FMNH2 | 5,6-Dimethylbenzimidazole | 5,6-dimethylbenzimidazole synthase | Synthesis | RHEA | 34755880 |
MMDBr0014768 | Phosphate | CoA | Phosphate propanoyltransferase | N-Acetylation | RHEA | 34755880 |
MMDBr0015020 | demethylspheroidene | Hydrogen Ion | Demethylspheroidene O-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0015058 | rhodopin | Lycopene | Acyclic carotenoid 1,2-hydratase | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0015059 | 1,1'-dihydroxy-1,1',2,2'-tetrahydrolycopene | Water | Acyclic carotenoid 1,2-hydratase | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0015120 | (6R)-NADHX | (6S)-NADHX | Bifunctional NAD(P)H-hydrate repair enzyme Nnr | Epimerization | RHEA | 34755880 |
MMDBr0015125 | (6R)-NADPHX | (6S)-NADPHX | Bifunctional NAD(P)H-hydrate repair enzyme Nnr | Epimerization | RHEA | 34755880 |
MMDBr0015518 | D-Ribulose 1,5-bisphosphate | (2R)-3-phosphoglyceric acid | Ribulose bisphosphate carboxylase large chain | Carboxylation | RHEA | 34755880 |
MMDBr0015625 | (2R,3S)-beta-methylmalyl-CoA | glyoxylate | L-malyl-CoA/beta-methylmalyl-CoA lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0017979 | Water | 3,8-divinyl protochlorophyllide a | Anaerobic magnesium-protoporphyrin IX monomethyl ester cyclase | Cycle formation | RHEA | 34755880 |
MMDBr0017849 | Adenosine triphosphate | ADP | Hydrogenobyrinate a,c-diamide synthase | Synthesis | RHEA | 34755880 |
MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | Synthesis | RHEA | 34755880 |
MMDBr0024380 | Iron(3+) | Hydrogen Ion | Ubiquinol-cytochrome c reductase iron-sulfur subunit | Reduction | RHEA | 34755880 |
MMDBr0024546 | Hydrogen Ion | (6S)-5,6,7,8-tetrahydrofolic acid | Methylenetetrahydrofolate--tRNA-(uracil-5-)-methyltransferase TrmFO | Methylation | RHEA | 34755880 |
MMDBr0024686 | Water | Hydrogen Ion | Nitrogenase iron protein | Nitrogen fixation | RHEA | 34755880 |
MMDBr0024747 | NADP(+) | Hydrogen Ion | Probable tRNA-dihydrouridine synthase | Synthesis | RHEA | 34755880 |
MMDBr0024833 | Tetra-mu3-sulfido-tetrairon(2+) | Water | Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein | Reduction | RHEA | 34755880 |
MMDBr0024862 | 15-cis-phytoene | all-trans-neurosporene | Phytoene desaturase (neurosporene-forming) | Desaturation | RHEA | 34755880 |
MMDBr0024867 | rhodopin | (3E)-3,4-didehydrorhodopin | 1-hydroxycarotenoid 3,4-desaturase | Desaturation | RHEA | 34755880 |
MMDBr0024901 | Hydrogen Ion | Water | Spheroidene monooxygenase | Oxygenation | RHEA | 34755880 |
MMDBr0024902 | Hydrogen Ion | Water | Spheroidene monooxygenase | Oxygenation | RHEA | 34755880 |
MMDBr0024903 | Hydrogen Ion | Water | Spheroidene monooxygenase | Oxygenation | RHEA | 34755880 |
MMDBr0024970 | di-mu-Sulfido-diiron(2+) | Water | Chlorophyllide reductase subunit Z | Reduction | RHEA | 34755880 |
MMDBr0025309 | di-mu-Sulfido-diiron(2+) | Water | Chlorophyllide reductase subunit Z | Reduction | RHEA | 34755880 |
MMDBr0025310 | di-mu-Sulfido-diiron(2+) | Water | Chlorophyllide reductase subunit Z | Reduction | RHEA | 34755880 |
MMDBr0025505 | NAD | Hydrogen Ion | Probable tRNA-dihydrouridine synthase | Synthesis | RHEA | 34755880 |
MMDBr0025777 | Hydrogen Ion | (6S)-5,6,7,8-tetrahydrofolic acid | Methylenetetrahydrofolate--tRNA-(uracil-5-)-methyltransferase TrmFO | Methylation | RHEA | 34755880 |