MMDBr0012889 | Pyroglutamic acid | ADP | 5-oxoprolinase | Hydrolysis | RHEA | 34755880 |
MMDBr0012943 | diphosphate | Phosphoribosyl pyrophosphate | Xanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012953 | (R)-Pantoate | Pantothenic acid | Pantothenate synthetase | Ligation; Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013038 | diphosphate | Phosphoribosyl pyrophosphate | Tryptophan biosynthesis protein TrpCD | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013046 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | 3-methyl-2-oxobutanoate hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0013062 | (6R)-6-(l-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4a-hydroxypterin | 4a-Carbinolamine tetrahydrobiopterin | Putative pterin-4-alpha-carbinolamine dehydratase | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0013098 | NADP(+) | Hydrogen Ion | UDP-N-acetylenolpyruvoylglucosamine reductase | Reduction | RHEA | 34755880 |
MMDBr0013173 | diphosphate | Phosphoribosyl pyrophosphate | Bifunctional protein PyrR | Transfer of phosphoribosyl group | RHEA | 34755880 |
MMDBr0013179 | Adenosine triphosphate | ADP | Replicase large subunit | Synthesis of a primer | RHEA | 34755880 |
MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0013295 | (S)-4-Amino-5-oxopentanoate | 5-Aminolevulinic acid | Glutamate-1-semialdehyde 2,1-aminomutase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013333 | Adenosine triphosphate | ADP | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
MMDBr0013339 | aldehydo-D-ribose 5-phosphate | D-Ribulose 5-phosphate | Bifunctional ribokinase/ribose-5-phosphate isomerase A | Isomerization | RHEA | 34755880 |
MMDBr0013357 | (2R)-3-phosphoglyceric acid | (2R)-3-phospho-glyceroyl phosphate | Phosphoglycerate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013470 | (2R)-2-phosphoglyceric acid | (2R)-3-phosphoglyceric acid | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0013495 | Adenosine triphosphate | ADP | ATP-dependent 6-phosphofructokinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013547 | Adenosine triphosphate | ADP | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0013571 | Adenosine triphosphate | ADP | Putative uridine kinase DAS2 | Phosphorylation | RHEA | 34755880 |
MMDBr0013674 | Adenosine triphosphate | ADP | Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial | Ligation | RHEA | 34755880 |
MMDBr0013729 | Adenosine triphosphate | Adenosine phosphosulfate | Sulfate adenylyltransferase subunit 2 | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0013755 | D-Ribose-5-phosphate | Water | Pseudouridine-5'-phosphate glycosidase | Transfer of a glycosyl group | RHEA | 34755880 |
MMDBr0013792 | Adenosine triphosphate | ADP | NAD kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013843 | Adenosine triphosphate | ADP | Thymidine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013895 | L-Glutamic-gamma-semialdehyde | Hydrogen Ion | Gamma-glutamyl phosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0013921 | (R)-4'-phosphopantetheine | 3'-dephospho-CoA | Phosphopantetheine adenylyltransferase | Dephosphorylation | RHEA | 34755880 |
MMDBr0013929 | Hydrogen Ion | Carbon dioxide | Uroporphyrinogen decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013941 | S-Methyl-5-thio-alpha-D-ribose 1-phosphate | 5-Methylthioribulose 1-phosphate | 5-deoxyribose 1-phosphate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013946 | Carbamoylphosphate | Hydrogen Ion | Protein pyrABCN | Transfer of a carbamoyl group | RHEA | 34755880 |
MMDBr0013966 | (6S)-5,6,7,8-tetrahydrofolic acid | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Ligation; Synthesis | RHEA | 34755880 |
MMDBr0014061 | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Chorismate | Chorismate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014083 | Shikimate 3-phosphate | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Pentafunctional AROM polypeptide | Synthesis; Dehydration and isomerisation; Oxidation; Phosphorylation; Transfer of a carboxyvinyl group | RHEA | 34755880 |
MMDBr0014105 | (S)-malate(2-) | Hydrogen Ion | Malate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0014126 | Adenosine triphosphate | ADP | Glycerol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0014227 | (S)-4-hydroxy-2-oxopentanoic acid | Acetaldehyde | 4-hydroxy-2-oxovalerate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0014229 | 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate | (2S)-2-[5-Amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamido]succinic acid | Phosphoribosylaminoimidazole-succinocarboxamide synthase | Synthesis | RHEA | 34755880 |
MMDBr0014236 | dCTP | Deoxyuridine triphosphate | dCTP deaminase | Deamination | RHEA | 34755880 |
MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
MMDBr0014313 | Acetaldehyde | Acetyl-CoA | Acetaldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Reversible cyclization | RHEA | 34755880 |
MMDBr0014407 | Argininosuccinic acid | fumarate | Bifunctional protein ArgHA | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0014417 | Adenosine phosphosulfate | Phosphoadenosine phosphosulfate | Adenylyl-sulfate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014426 | 4-Methyl-5-(2-hydroxyethyl)-thiazole | 4-methyl-5-(2-phosphooxyethyl)-thiazole | Probable thiamine biosynthetic bifunctional enzyme | Phosphorylation | RHEA | 34755880 |
MMDBr0014472 | Adenosine triphosphate | ADP | Cytidine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014486 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014487 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014619 | L-3,4-Dihydroxybutan-2-one 4-phosphate | 6,7-Dimethyl-8-(1-D-ribityl)lumazine | 6,7-dimethyl-8-ribityllumazine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017926 | Adenosine triphosphate | ADP | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0014718 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014719 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transfer of phospho-N-acetylmuramoyl-pentapeptide | RHEA | 34755880 |
MMDBr0014994 | Guanosine triphosphate | diphosphate | Phosphoenolpyruvate guanylyltransferase | Transfer of a GMP | RHEA | 34755880 |
MMDBr0017950 | aldehydo-D-ribose 5-phosphate | Hydrogen Ion | Pyridoxal 5'-phosphate synthase subunit PDX1 | Synthesis | RHEA | 34755880 |
MMDBr0015136 | 3-Isopropylmalate | 2-Isopropylmalic acid | 3-isopropylmalate dehydratase large subunit gloJ | Isomerization | RHEA | 34755880 |
MMDBr0016462 | (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate | Cyclic pyranopterin monophosphate | Cyclic pyranopterin monophosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0016907 | Adenosine triphosphate | ADP | ATP synthase subunit alpha | ATP hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0017834 | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | D-Glyceraldehyde 3-phosphate | Tryptophan synthase | Synthesis | RHEA | 34755880 |
MMDBr0017852 | Adenosine triphosphate | ADP | Glutamate--cysteine ligase EgtA | Ligation | RHEA | 34755880 |
MMDBr0017871 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Serine hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0017874 | Water | L-Glutamic acid | Thermolabile glutaminase | Synthesis | RHEA | 34755880 |
MMDBr0017897 | Adenosine triphosphate | diphosphate | S-adenosylmethionine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017903 | L-Histidine | Ammonium | Histidine ammonia-lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | Synthesis | RHEA | 34755880 |
MMDBr0024371 | Adenosine triphosphate | Hydrogen Ion | Asparagine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024401 | L-Serine | Hydrogen Ion | Holo-[acyl-carrier-protein] synthase | Dehydrogenation; Synthesis | RHEA | 34755880 |
MMDBr0024411 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024415 | (S)-4-Amino-5-oxopentanoate | Hydrogen Ion | Glutamyl-tRNA reductase | Reduction | RHEA | 34755880 |
MMDBr0024449 | Adenosine triphosphate | diphosphate | Methionine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024454 | D-Galactose | Hydrogen Ion | Galactokinase | Phosphorylation | RHEA | 34755880 |
MMDBr0024474 | Adenosine triphosphate | diphosphate | Proline--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024483 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | Amide group addition | RHEA | 34755880 |
MMDBr0024539 | Hydrogen Ion | 5'-Deoxyadenosine | Lipoyl synthase | Synthesis | RHEA | 34755880 |
MMDBr0024568 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | Amide group addition | RHEA | 34755880 |
MMDBr0024590 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0024597 | L-Aspartic acid | diphosphate | Aspartate--tRNA(Asp/Asn) ligase | Ligation | RHEA | 34755880 |
MMDBr0024656 | Adenosine triphosphate | diphosphate | Arginine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | Hydrogen Ion | Methionyl-tRNA formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0024779 | Water | formate | Peptide deformylase 1 | Removal of the N-terminal formyl group | RHEA | 34755880 |
MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | Transfer of a dimethylallyl group | RHEA | 34755880 |
MMDBr0024833 | Tetra-mu3-sulfido-tetrairon(2+) | Water | Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein | Reduction | RHEA | 34755880 |
MMDBr0024851 | L-Dihydroorotic acid | orotate | Dihydroorotate dehydrogenase (quinone) | Dehydrogenation | RHEA | 34755880 |
MMDBr0024967 | S-Adenosylmethionine | Hydrogen Ion | tRNA (guanine(37)-N1)-methyltransferase Trm5b | Methylation | RHEA | 34755880 |
MMDBr0025060 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0025071 | S-Adenosylmethionine | S-Adenosylhomocysteine | tRNA (guanine-N(7)-)-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025105 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase H | Methylation | RHEA | 34755880 |
MMDBr0025163 | ADP | Hydrogen Ion | Putative pyruvate, phosphate dikinase regulatory protein 1 | Phosphorylation | RHEA | 34755880 |
MMDBr0025164 | Hydrogen Ion | diphosphate | Putative pyruvate, phosphate dikinase regulatory protein 1 | Phosphorylation | RHEA | 34755880 |
MMDBr0025193 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0025258 | Adenosine triphosphate | Hydrogen Ion | tRNA-specific 2-thiouridylase MnmA | 2-Thiolation of uridine | RHEA | 34755880 |
MMDBr0025490 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein L11 methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025514 | Acetyl-CoA | Malonyl-CoA | Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha | Carboxylation | RHEA | 34755880 |
MMDBr0025650 | Hydrogen Ion | Hydrogen Ion | NADH-quinone oxidoreductase subunit C/D | Redox reaction | RHEA | 34755880 |
MMDBr0026046 | Uridine 5'-diphosphate | Uridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026047 | Uridine 5'-diphosphate | Cytidine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026048 | Guanosine 3',5'-bis(diphosphate) | Guanosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026085 | Deoxyuridine-5'-diphosphate | Deoxyuridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026086 | 2'-Deoxycytidine 5'-diphosphate | Deoxycytidine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026087 | 2'-Deoxyadenosine 5'-diphosphate | Deoxyadenosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026088 | 2'-Deoxyguanosine 5'-diphosphate | 2'-Deoxyguanosine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |