MMDBr0012860 | (2R)-2-phosphoglyceric acid | Water | Enolase | Enolization | RHEA | 34755880 |
MMDBr0012866 | Adenosine triphosphate | ADP | Sulfate/thiosulfate import ATP-binding protein CysA | Transport | RHEA | 34755880 |
MMDBr0012876 | Deoxyuridine triphosphate | diphosphate | Probable deoxyuridine 5'-triphosphate nucleotidohydrolase | Dephosphorylation; Hydrolysis of bond | RHEA | 34755880 |
MMDBr0012953 | (R)-Pantoate | Pantothenic acid | Pantothenate synthetase | Ligation; Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0012954 | Adenosine triphosphate | Argininosuccinic acid | Argininosuccinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0012970 | D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Imidazoleglycerol-phosphate dehydratase | Hydration/dehydration of C-O bond; Synthesis | RHEA | 34755880 |
MMDBr0012971 | beta-D-Fructose 1,6-bisphosphate | beta-D-Fructose 6-phosphate | Fructose-1,6-bisphosphatase/inositol-1-monophosphatase | Aldol addition (or reverse); Dephosphorylation | RHEA | 34755880 |
MMDBr0012975 | NAD | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(+)] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012976 | NADP(+) | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(P)+] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012989 | Adenosine triphosphate | ADP | D-alanine--D-alanine ligase | Ligation | RHEA | 34755880 |
MMDBr0013014 | Hydrogen Ion | D-1-Aminopropan-2-ol O-phosphate | Threonine-phosphate decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013026 | Hydrogen Ion | Carbon dioxide | Orotidine 5'-phosphate decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013027 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013034 | Water | Hydrogen Ion | Inosine-5'-monophosphate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013038 | diphosphate | Phosphoribosyl pyrophosphate | Tryptophan biosynthesis protein TrpCD | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013045 | Alpha-D-glucose 6-phosphate | beta-D-Fructose 6-phosphate | Glucose-6-phosphate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013046 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | 3-methyl-2-oxobutanoate hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0013053 | Phosphate | Adenine | S-methyl-5'-thioadenosine phosphorylase | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0013098 | NADP(+) | Hydrogen Ion | UDP-N-acetylenolpyruvoylglucosamine reductase | Reduction | RHEA | 34755880 |
MMDBr0013120 | (S)-malate(2-) | fumarate | Fumarate hydratase class I, aerobic | Reversible hydration of fumarate to malate | RHEA | 34755880 |
MMDBr0013134 | D-Glyceraldehyde 3-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose-5-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013143 | Putrescine | Hydrogen Ion | Polyamine aminopropyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0013152 | L-Glutamic acid | D-Glutamate | L-alanine/L-glutamate racemase | Racemization; Synthesis | RHEA | 34755880 |
MMDBr0013170 | Adenosine monophosphate | ADP | Adenylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013179 | Adenosine triphosphate | ADP | Replicase large subunit | Synthesis of a primer | RHEA | 34755880 |
MMDBr0013201 | Guanosine | Ribose-1-phosphate | Purine nucleoside phosphorylase DeoD-type | Phosphorylation | RHEA | 34755880 |
MMDBr0013212 | 7-Aminomethyl-7-carbaguanine | 7-Cyano-7-carbaguanine | NADPH-dependent 7-cyano-7-deazaguanine reductase | Reduction | RHEA | 34755880 |
MMDBr0013213 | 2-C-methyl-D-erythritol 4-phosphate | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase | Transfer of a cytidylyl group | RHEA | 34755880 |
MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0013226 | Adenosine triphosphate | ADP | Putative thymidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013245 | Acetyl-CoA | CoA | L-serine/homoserine O-acetyltransferase | N-Acetylation; Synthesis | RHEA | 34755880 |
MMDBr0013246 | 2-C-methyl-D-erythritol 4-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose 5-phosphate reductoisomerase | Isomerization | RHEA | 34755880 |
MMDBr0013280 | D-Arabinose 5-phosphate | 3-deoxy-alpha-D-manno-2-octulosonate-8-phosphate | 2-dehydro-3-deoxyphosphooctonate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0013286 | 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one | 3-Methylthiopropionic acid | Acireductone dioxygenase | Oxygenation | RHEA | 34755880 |
MMDBr0013295 | (S)-4-Amino-5-oxopentanoate | 5-Aminolevulinic acid | Glutamate-1-semialdehyde 2,1-aminomutase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013303 | alpha-Ketoglutarate | 3-Phosphonatooxypyruvate(3-) | Phosphoserine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013333 | Adenosine triphosphate | ADP | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
MMDBr0013357 | (2R)-3-phosphoglyceric acid | (2R)-3-phospho-glyceroyl phosphate | Phosphoglycerate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013370 | Adenosine triphosphate | ADP | Glutamate 5-kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013395 | Oxygen | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013416 | L-Glutamic acid | Ornithine | Arginine biosynthesis bifunctional protein ArgJ | Acetylation; Synthesis | RHEA | 34755880 |
MMDBr0013422 | LL-2,6-Diaminoheptanedioate | Meso-2,6-Diaminoheptanedioate | Diaminopimelate epimerase | Epimerization; Racemization | RHEA | 34755880 |
MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013437 | 5-Methylthioribulose 1-phosphate | 5-(methylsulfanyl)-2,3-dioxopentyl phosphate | Probable bifunctional methylthioribose-1-phosphate isomerase/methylthioribulose-1-phosphate dehydratase | Dehydration and isomerisation | RHEA | 34755880 |
MMDBr0013444 | Adenosine triphosphate | Phosphoribosyl pyrophosphate | Ribose-phosphate pyrophosphokinase 1 | Phosphorylation | RHEA | 34755880 |
MMDBr0013458 | Guanosine triphosphate | Guanosine diphosphate | Adenylosuccinate synthetase | Synthesis | RHEA | 34755880 |
MMDBr0013464 | (7R,8S)-7,8-diammoniononanoic acid | Dethiobiotin | Biotin biosynthesis bifunctional protein BioCD | Amine group addition; Synthesis | RHEA | 34755880 |
MMDBr0013466 | Water | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013470 | (2R)-2-phosphoglyceric acid | (2R)-3-phosphoglyceric acid | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0013473 | Adenosine triphosphate | ADP | Thiamine-monophosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013478 | Hydrogen Ion | Carbon dioxide | S-adenosylmethionine decarboxylase proenzyme | Decarboxylation | RHEA | 34755880 |
MMDBr0013488 | Phosphate | 2-deoxy-alpha-D-ribose 1-phosphate | Pyrimidine-nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0013489 | adenosylcob(III)inamide-GDP | coenzyme B12 | Adenosylcobinamide-GDP ribazoletransferase | Transfer of ribazole | RHEA | 34755880 |
MMDBr0013508 | Co-precorrin-8X | cob(II)yrinate | Cobalt-precorrin-8 methylmutase | Synthesis | RHEA | 34755880 |
MMDBr0013526 | Pantothenic acid | (R)-4'-phosphopantothenic acid | Bifunctional enzyme BirA/CoaX | Phosphorylation | RHEA | 34755880 |
MMDBr0013529 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoylalanine--D-glutamate ligase | Ligation | RHEA | 34755880 |
MMDBr0013544 | alpha-Ketoglutarate | (R)-3-hydroxy-2-oxo-4-phosphooxybutanoic acid | Phosphoserine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013547 | Adenosine triphosphate | ADP | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0013549 | Adenosine monophosphate | Phosphoribosyl pyrophosphate | Adenine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013564 | Adenosine triphosphate | ADP | Potassium-transporting ATPase ATP-binding subunit | ATP hydrolysis | RHEA | 34755880 |
MMDBr0013565 | Adenosine triphosphate | ADP | Potassium-transporting ATPase ATP-binding subunit | ATP hydrolysis | RHEA | 34755880 |
MMDBr0013611 | D-Glyceraldehyde 3-phosphate | beta-D-Fructose 6-phosphate | Transaldolase | Transfer of aldol group | RHEA | 34755880 |
MMDBr0013655 | 5-Phosphoribosylamine | ADP | Phosphoribosylamine--glycine ligase | Ligation | RHEA | 34755880 |
MMDBr0013659 | Guanosine triphosphate | 7,8-dihydroneopterin 3'-triphosphate | Bifunctional protein FolKE | Hydrolysis | RHEA | 34755880 |
MMDBr0013674 | Adenosine triphosphate | ADP | Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial | Ligation | RHEA | 34755880 |
MMDBr0013681 | NADP(+) | 3-Dehydroshikimic acid | Pentafunctional AROM polypeptide | Dehydrogenation | RHEA | 34755880 |
MMDBr0013703 | Dihydroxyacetone phosphate | BPG | Methylglyoxal synthase | Synthesis | RHEA | 34755880 |
MMDBr0013717 | alpha-Ketoglutarate | L-Glutamic acid | Acetylornithine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013742 | 3'-dephospho-CoA | ADP | Dephospho-CoA kinase CAB5 | Phosphorylation | RHEA | 34755880 |
MMDBr0013768 | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013770 | Water | Phosphoribosyl formamidocarboxamide | Bifunctional purine biosynthesis protein PurH | Hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0013773 | 1-(5-phosphoribosyl)-ATP | Phosphoribosyl pyrophosphate | ATP phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013784 | D-Glyceraldehyde 3-phosphate | Dihydroxyacetone phosphate | Bifunctional PGK/TIM | Isomerization | RHEA | 34755880 |
MMDBr0013790 | Adenosine triphosphate | ADP | Phosphoenolpyruvate carboxykinase (ATP) | Phosphorylation | RHEA | 34755880 |
MMDBr0013831 | Acetyl-CoA | (3R)-citramalic acid | (R)-citramalate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013832 | Acetyl-CoA | (3R)-citramalic acid | (R)-citramalate synthase CimA | Synthesis | RHEA | 34755880 |
MMDBr0013848 | dCTP | diphosphate | dCTP deaminase, dUMP-forming | Deamination | RHEA | 34755880 |
MMDBr0013884 | Hydrogen Ion | beta-Alanine | L-aspartate decarboxylase dtxS4 | Decarboxylation | RHEA | 34755880 |
MMDBr0013886 | Carbamoylphosphate | Hydrogen Ion | Ornithine carbamoyltransferase | Transfer of a carbamoyl group | RHEA | 34755880 |
MMDBr0013895 | L-Glutamic-gamma-semialdehyde | Hydrogen Ion | Gamma-glutamyl phosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0013908 | Guanosine triphosphate | Guanosine diphosphate | GTPase ArgK | Dephosphorylation; Hydrolysis; Nucleic acid synthesis and/or repair | RHEA | 34755880 |
MMDBr0013921 | (R)-4'-phosphopantetheine | 3'-dephospho-CoA | Phosphopantetheine adenylyltransferase | Dephosphorylation | RHEA | 34755880 |
MMDBr0013941 | S-Methyl-5-thio-alpha-D-ribose 1-phosphate | 5-Methylthioribulose 1-phosphate | 5-deoxyribose 1-phosphate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013946 | Carbamoylphosphate | Hydrogen Ion | Protein pyrABCN | Transfer of a carbamoyl group | RHEA | 34755880 |
MMDBr0013952 | 1-(5-phosphoribosyl)-5'-AMP | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | Histidine biosynthesis bifunctional protein HisIE | Hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0013970 | L-Alanine | D-Alanine | L-alanine/L-glutamate racemase | Racemization | RHEA | 34755880 |
MMDBr0014061 | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Chorismate | Chorismate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014083 | Shikimate 3-phosphate | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Pentafunctional AROM polypeptide | Synthesis; Dehydration and isomerisation; Oxidation; Phosphorylation; Transfer of a carboxyvinyl group | RHEA | 34755880 |
MMDBr0014105 | (S)-malate(2-) | Hydrogen Ion | Malate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0014111 | alpha-Ketoisovaleric acid | 2-Isopropylmalic acid | Isopropyl malate synthase AMT7 | Synthesis | RHEA | 34755880 |
MMDBr0014112 | alpha-Ketoisovaleric acid | 2-Isopropylmalic acid | 2-isopropylmalate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014114 | N-(5-Phospho-D-ribosyl)anthranilate | 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate | Phosphoribosyl isomerase A | Isomerization | RHEA | 34755880 |
MMDBr0014117 | N-Acetyl-L-glutamate 5-semialdehyde | Hydrogen Ion | Protein ARG5,6, mitochondrial | Reduction | RHEA | 34755880 |
MMDBr0014134 | 5-(methylsulfanyl)-2,3-dioxopentyl phosphate | 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one | Enolase-phosphatase E1 | Enolization | RHEA | 34755880 |
MMDBr0014135 | Water | Deoxyadenosine | Adenosylhomocysteinase | Reversible hydrolysis | RHEA | 34755880 |
MMDBr0014160 | 3-deoxy-D-arabino-heptulosonate-7-phosphate | 3-Dehydroquinate | Pentafunctional AROM polypeptide | Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0014180 | (6S)-10-formyltetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Bifunctional purine biosynthesis protein PurH | Synthesis | RHEA | 34755880 |
MMDBr0014229 | 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate | (2S)-2-[5-Amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamido]succinic acid | Phosphoribosylaminoimidazole-succinocarboxamide synthase | Synthesis | RHEA | 34755880 |
MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
MMDBr0014256 | 1-(5-phosphoribosyl)-ATP | 1-(5-phosphoribosyl)-5'-AMP | Phosphoribosyl-ATP pyrophosphatase | Dephosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0014257 | Adenosine triphosphate | Nicotinic acid adenine dinucleotide | Probable nicotinate-nucleotide adenylyltransferase | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0014282 | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | 5-Aminoimidazole ribonucleotide | Bifunctional purine biosynthetic protein ADE5,7 | Ligation | RHEA | 34755880 |
MMDBr0014299 | Acetic acid | Acetyl-CoA | Acetyl-coenzyme A synthetase 1 | Ligation; Synthesis | RHEA | 34755880 |
MMDBr0014337 | 3-deoxy-D-manno-2-octulosonate | CMP-3-deoxy-beta-D-manno-octulosonate | 3-deoxy-manno-octulosonate cytidylyltransferase | Transfer of a cytidylyl group | RHEA | 34755880 |
MMDBr0014340 | 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | Indole-3-glycerol phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014353 | adenosylcob(III)inamide-GDP | adenosylcob(III)alamin 5'-phosphate | Adenosylcobinamide-GDP ribazoletransferase | Transfer of ribazole | RHEA | 34755880 |
MMDBr0014366 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase | Ligation | RHEA | 34755880 |
MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Reversible cyclization | RHEA | 34755880 |
MMDBr0014377 | alpha-Ketoglutarate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Histidinol-phosphate aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
MMDBr0014405 | LL-2,6-Diaminoheptanedioate | (S)-2,3,4,5-tetrahydrodipicolinate | LL-diaminopimelate aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0014407 | Argininosuccinic acid | fumarate | Bifunctional protein ArgHA | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0014426 | 4-Methyl-5-(2-hydroxyethyl)-thiazole | 4-methyl-5-(2-phosphooxyethyl)-thiazole | Probable thiamine biosynthetic bifunctional enzyme | Phosphorylation | RHEA | 34755880 |
MMDBr0014435 | L-Aspartate-semialdehyde | 4-Phospho-L-aspartic acid | Aspartate-semialdehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0014436 | Acetyl-CoA | CoA | Amino-acid acetyltransferase | Acetylation; Synthesis | RHEA | 34755880 |
MMDBr0014444 | Phosphate | Ribose-1-phosphate | Pyrimidine-nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0014447 | Adenosine triphosphate | ADP | UMP-CMP kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014459 | 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one | 4-methylsulfanyl-2-oxobutanoic acid | Acireductone dioxygenase | Oxygenation | RHEA | 34755880 |
MMDBr0014461 | diphosphate | Hydrogen Ion | Inorganic pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014486 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014487 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014489 | Adenosine triphosphate | ADP | Formate-dependent phosphoribosylglycinamide formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0014490 | Adenosine triphosphate | ADP | Formate-dependent phosphoribosylglycinamide formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0017917 | 5-Aminoimidazole ribonucleotide | 4-Amino-2-methyl-5-phosphomethylpyrimidine | Phosphomethylpyrimidine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014514 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014596 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014597 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014619 | L-3,4-Dihydroxybutan-2-one 4-phosphate | 6,7-Dimethyl-8-(1-D-ribityl)lumazine | 6,7-dimethyl-8-ribityllumazine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014633 | Co-precorrin-5B | Co-precorrin-6A | Cobalt-precorrin-5B C(1)-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0017923 | Adenosine triphosphate | ADP | Cobyrinate a,c-diamide synthase | Synthesis | RHEA | 34755880 |
MMDBr0017926 | Adenosine triphosphate | ADP | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0014688 | D-Sedoheptulose 7-phosphate | D-glycero-alpha-D-manno-heptose 7-phosphate | Phosphoheptose isomerase | Isomerization | RHEA | 34755880 |
MMDBr0014707 | Phosphate | Ribose-1-phosphate | Pyrimidine/purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0014708 | Deoxyadenosine | Adenine | Purine nucleoside phosphorylase DeoD-type | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014710 | Inosine | Ribose-1-phosphate | Purine nucleoside phosphorylase DeoD-type | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014718 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014719 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014761 | 6-Carboxy-5,6,7,8-tetrahydropterin | 7-Deaza-7-carboxyguanine | 7-carboxy-7-deazaguanine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014763 | 7-Deaza-7-carboxyguanine | 7-Cyano-7-carbaguanine | 7-cyano-7-deazaguanine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014776 | Farnesyl pyrophosphate | diphosphate | Protoheme IX farnesyltransferase, mitochondrial | Farnesylation | RHEA | 34755880 |
MMDBr0014783 | di-trans,octa-cis-undecaprenyl diphosphate | di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-diphosphatase BcrC | Dephosphorylation | RHEA | 34755880 |
MMDBr0014816 | 2'-Deoxyinosine triphosphate | DIMP | Inosine triphosphate pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transfer of phospho-N-acetylmuramoyl-pentapeptide | RHEA | 34755880 |
MMDBr0014846 | Thymidine 5'-triphosphate | diphosphate | dTTP/UTP pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014848 | Water | diphosphate | Inosine triphosphate pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014908 | Water | diphosphate | dTTP/UTP pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014909 | Water | diphosphate | Inosine triphosphate pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014943 | Adenosine triphosphate | ADP | Sulfate/thiosulfate import ATP-binding protein CysA | Transport | RHEA | 34755880 |
MMDBr0015026 | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | di-trans-octa-cis-undecaprenyl diphospho-[N-acetyl-alpha-D-glucosaminyl-(1->4)]-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 1; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 2; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 3 | RHEA | 34755880 |
MMDBr0015133 | 3-Isopropylmalate | Ketoleucine | 3-isopropylmalate dehydrogenase AMT6 | Dehydrogenation | RHEA | 34755880 |
MMDBr0015136 | 3-Isopropylmalate | 2-Isopropylmalic acid | 3-isopropylmalate dehydratase large subunit gloJ | Isomerization | RHEA | 34755880 |
MMDBr0015316 | L-Aspartate-semialdehyde | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0015402 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
MMDBr0015405 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
MMDBr0015916 | 1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (flavodoxin) | Synthesis | RHEA | 34755880 |
MMDBr0016600 | Cytidine | Ribose-1-phosphate | Pyrimidine/purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0016907 | Adenosine triphosphate | ADP | ATP synthase subunit alpha | ATP hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0016915 | diphosphate | Hydrogen Ion | Putative K(+)-stimulated pyrophosphate-energized sodium pump | Proton pump; Sodium pump | RHEA | 34755880 |
MMDBr0017834 | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | D-Glyceraldehyde 3-phosphate | Tryptophan synthase | Synthesis | RHEA | 34755880 |
MMDBr0017843 | Adenosine triphosphate | Adenosine monophosphate | GMP synthase [glutamine-hydrolyzing] | Synthesis | RHEA | 34755880 |
MMDBr0017851 | Fructose 6-phosphate | D-glucosamine 6-phosphate | Glutamine--fructose-6-phosphate aminotransferase [isomerizing] | Amine group addition | RHEA | 34755880 |
MMDBr0017852 | Adenosine triphosphate | ADP | Glutamate--cysteine ligase EgtA | Ligation | RHEA | 34755880 |
MMDBr0017871 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Serine hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0017874 | Water | L-Glutamic acid | Thermolabile glutaminase | Synthesis | RHEA | 34755880 |
MMDBr0017879 | Adenosine triphosphate | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | Phosphoribosylformylglycinamidine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017882 | Adenosine triphosphate | ADP | Carbamoyl-phosphate synthase small chain | Synthesis | RHEA | 34755880 |
MMDBr0017894 | Water | Hydrogen Ion | Histidinol dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0017897 | Adenosine triphosphate | diphosphate | S-adenosylmethionine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | Synthesis | RHEA | 34755880 |
MMDBr0024345 | Adenosine triphosphate | Hydrogen Ion | Tyrosine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024360 | Adenosine triphosphate | diphosphate | Valine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024368 | Adenosine triphosphate | diphosphate | Isoleucine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024371 | Adenosine triphosphate | Hydrogen Ion | Asparagine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024389 | Adenosine triphosphate | diphosphate | Leucine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024401 | L-Serine | Hydrogen Ion | Holo-[acyl-carrier-protein] synthase | Dehydrogenation; Synthesis | RHEA | 34755880 |
MMDBr0024408 | Hydrogen Ion | Carbon dioxide | Multifunctional 2-oxoglutarate metabolism enzyme | Dehydrogenation | RHEA | 34755880 |
MMDBr0024411 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024418 | Adenosine triphosphate | diphosphate | Alanine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024449 | Adenosine triphosphate | diphosphate | Methionine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024474 | Adenosine triphosphate | diphosphate | Proline--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024483 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | Amide group addition | RHEA | 34755880 |
MMDBr0024522 | Adenosine triphosphate | diphosphate | Glycine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024533 | Water | Ammonium | Probable chemoreceptor glutamine deamidase CheD | Deamidation | RHEA | 34755880 |
MMDBr0024539 | Hydrogen Ion | 5'-Deoxyadenosine | Lipoyl synthase | Synthesis | RHEA | 34755880 |
MMDBr0024548 | (6S)-5,6,7,8-tetrahydrofolic acid | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | Probable aminomethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0024559 | Adenosine triphosphate | Hydrogen Ion | Histidine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024568 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | Amide group addition | RHEA | 34755880 |
MMDBr0024578 | Adenosine triphosphate | diphosphate | Cysteine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024590 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0024628 | Adenosine triphosphate | Hydrogen Ion | Phenylalanine--tRNA ligase beta subunit | Ligation | RHEA | 34755880 |
MMDBr0024629 | S-Adenosylmethionine | Hydrogen Ion | tRNA 5-methylaminomethyl-2-thiouridine biosynthesis bifunctional protein MnmC | Synthesis | RHEA | 34755880 |
MMDBr0024632 | L-Aspartic acid | diphosphate | Aspartate--tRNA(Asp) ligase | Ligation | RHEA | 34755880 |
MMDBr0024636 | Phosphate | Ribose-1-phosphate | Probable 6-oxopurine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0024656 | Adenosine triphosphate | diphosphate | Arginine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024666 | Adenosine triphosphate | diphosphate | Lysine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024707 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Biotin synthase | Synthesis | RHEA | 34755880 |
MMDBr0024736 | Water | L-Cysteine | Vitamin B12-dependent ribonucleoside-diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0024745 | L-Glutamic acid | diphosphate | Glutamate--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024765 | 7-Aminomethyl-7-carbaguanine | Guanine | Putative queuine tRNA-ribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0024768 | Water | L-Cysteine | Peptide methionine sulfoxide reductase MsrB | Reduction | RHEA | 34755880 |
MMDBr0024774 | Hydrogen Ion | Carbon dioxide | Probable glycine dehydrogenase (decarboxylating) subunit 1 | Dehydrogenation | RHEA | 34755880 |
MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | Hydrogen Ion | Methionyl-tRNA formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0024779 | Water | formate | Peptide deformylase 1 | Removal of the N-terminal formyl group | RHEA | 34755880 |
MMDBr0024782 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0024787 | Adenosine triphosphate | Hydrogen Ion | Threonine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024789 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | Transfer of a dimethylallyl group | RHEA | 34755880 |
MMDBr0024925 | Glycerol 3-phosphate | Phosphate | Glycerol-3-phosphate acyltransferase | Acylation | RHEA | 34755880 |
MMDBr0024967 | S-Adenosylmethionine | Hydrogen Ion | tRNA (guanine(37)-N1)-methyltransferase Trm5b | Methylation | RHEA | 34755880 |
MMDBr0024971 | L-Threonylcarbamoyladenylate | Hydrogen Ion | tRNA N6-adenosine threonylcarbamoyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0024974 | S-Adenosylmethionine | Hydrogen Ion | tRNA-2-methylthio-N(6)-dimethylallyladenosine synthase | Synthesis | RHEA | 34755880 |
MMDBr0024977 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein S12 methylthiotransferase RimO | Methylthiolation | RHEA | 34755880 |
MMDBr0025060 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0025066 | S-Adenosylmethionine | Hydrogen Ion | Demethylmenaquinone methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025071 | S-Adenosylmethionine | S-Adenosylhomocysteine | tRNA (guanine-N(7)-)-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025097 | L-Glutamine | Hydrogen Ion | Release factor glutamine methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025102 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Ribosomal RNA large subunit methyltransferase N | Methylation | RHEA | 34755880 |
MMDBr0025105 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase H | Methylation | RHEA | 34755880 |
MMDBr0025145 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Probable dual-specificity RNA methyltransferase RlmN | Methylation | RHEA | 34755880 |
MMDBr0025154 | Water | Niacinamide | NAD-dependent protein deacetylase | Deacetylation | RHEA | 34755880 |
MMDBr0025167 | Adenosine triphosphate | Hydrogen Ion | tRNA(Ile)-lysidine synthase | Synthesis | RHEA | 34755880 |
MMDBr0025193 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0025235 | L-Serine | Hydrogen Ion | HPr kinase/phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0025236 | Hydrogen Ion | L-Serine | HPr kinase/phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0025258 | Adenosine triphosphate | Hydrogen Ion | tRNA-specific 2-thiouridylase MnmA | 2-Thiolation of uridine | RHEA | 34755880 |
MMDBr0025273 | Water | Niacinamide | NAD-dependent protein deacylase | Deacylation | RHEA | 34755880 |
MMDBr0025490 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein L11 methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025620 | L-Cysteine | Hydrogen Ion | Phosphatidylglycerol--prolipoprotein diacylglyceryl transferase | Transfer of the diacylglyceryl group | RHEA | 34755880 |
MMDBr0025650 | Hydrogen Ion | Hydrogen Ion | NADH-quinone oxidoreductase subunit C/D | Redox reaction | RHEA | 34755880 |
MMDBr0025786 | L-Cysteine | Water | Peroxiredoxin | Oxidation | RHEA | 34755880 |
MMDBr0026022 | Adenosine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026023 | Cytidine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026024 | Uridine 5'-monophosphate | Uridine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026025 | Guanosine monophosphate | Guanosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026046 | Uridine 5'-diphosphate | Uridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026047 | Uridine 5'-diphosphate | Cytidine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026048 | Guanosine 3',5'-bis(diphosphate) | Guanosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026057 | L-Cystine | L-Cysteine | Vitamin B12-dependent ribonucleoside-diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0026058 | L-Cystine | L-Cysteine | Vitamin B12-dependent ribonucleoside-diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0026059 | 2'-Deoxyadenosine 5'-diphosphate | L-Cysteine | Vitamin B12-dependent ribonucleoside-diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0026060 | L-Cystine | L-Cysteine | Vitamin B12-dependent ribonucleoside-diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0026085 | Deoxyuridine-5'-diphosphate | Deoxyuridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026086 | 2'-Deoxycytidine 5'-diphosphate | Deoxycytidine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026087 | 2'-Deoxyadenosine 5'-diphosphate | Deoxyadenosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026088 | 2'-Deoxyguanosine 5'-diphosphate | 2'-Deoxyguanosine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |