MMDBr0012860 | (2R)-2-phosphoglyceric acid | Water | Enolase | Enolization | RHEA | 34755880 |
MMDBr0012872 | Adenosine triphosphate | ADP | Putative pyridoxal kinase BUD16 | Phosphorylation | RHEA | 34755880 |
MMDBr0012889 | Pyroglutamic acid | ADP | 5-oxoprolinase | Hydrolysis | RHEA | 34755880 |
MMDBr0012895 | diphosphate | Phosphoribosyl pyrophosphate | Orotate phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012916 | D-Glyceraldehyde 3-phosphate | aldehydo-D-ribose 5-phosphate | Transketolase | Transfer of ketol group | RHEA | 34755880 |
MMDBr0012943 | diphosphate | Phosphoribosyl pyrophosphate | Xanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012944 | Phosphoribosyl pyrophosphate | diphosphate | Xanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012946 | Water | Hydrogen Ion | N-succinylglutamate 5-semialdehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0012953 | (R)-Pantoate | Pantothenic acid | Pantothenate synthetase | Ligation; Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0012954 | Adenosine triphosphate | Argininosuccinic acid | Argininosuccinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0012970 | D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Imidazoleglycerol-phosphate dehydratase | Hydration/dehydration of C-O bond; Synthesis | RHEA | 34755880 |
MMDBr0012971 | beta-D-Fructose 1,6-bisphosphate | beta-D-Fructose 6-phosphate | Fructose-1,6-bisphosphatase/inositol-1-monophosphatase | Aldol addition (or reverse); Dephosphorylation | RHEA | 34755880 |
MMDBr0012975 | NAD | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(+)] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012976 | NADP(+) | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(P)+] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012989 | Adenosine triphosphate | ADP | D-alanine--D-alanine ligase | Ligation | RHEA | 34755880 |
MMDBr0013001 | Acetic acid | Acetyl phosphate | Acetate kinase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0013026 | Hydrogen Ion | Carbon dioxide | Orotidine 5'-phosphate decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013027 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013032 | NAD | NADH | Soluble pyridine nucleotide transhydrogenase | Hydrogenation | RHEA | 34755880 |
MMDBr0013038 | diphosphate | Phosphoribosyl pyrophosphate | Tryptophan biosynthesis protein TrpCD | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013045 | Alpha-D-glucose 6-phosphate | beta-D-Fructose 6-phosphate | Glucose-6-phosphate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013046 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | 3-methyl-2-oxobutanoate hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0013062 | (6R)-6-(l-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4a-hydroxypterin | 4a-Carbinolamine tetrahydrobiopterin | Putative pterin-4-alpha-carbinolamine dehydratase | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0013075 | D-Erythrose 4-phosphate | 4-Phospho-D-erythronate | D-erythrose-4-phosphate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013081 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 7,8-dihydrofolate monoglutamate | Bifunctional dihydrofolate reductase-thymidylate synthase | Reduction; Synthesis | RHEA | 34755880 |
MMDBr0013083 | Glucose 1-phosphate | ADP-alpha-D-glucose | Glucose-1-phosphate adenylyltransferase | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0013088 | Glucosamine 6-phosphate | beta-D-Fructose 6-phosphate | D-galactosamine-6-phosphate deaminase AgaS | Deamination; Isomerization | RHEA | 34755880 |
MMDBr0013098 | NADP(+) | Hydrogen Ion | UDP-N-acetylenolpyruvoylglucosamine reductase | Reduction | RHEA | 34755880 |
MMDBr0013134 | D-Glyceraldehyde 3-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose-5-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013140 | (S)-malate(2-) | Carbon dioxide | NAD-dependent malic enzyme | Redox reaction | RHEA | 34755880 |
MMDBr0013143 | Putrescine | Hydrogen Ion | Polyamine aminopropyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0013152 | L-Glutamic acid | D-Glutamate | L-alanine/L-glutamate racemase | Racemization; Synthesis | RHEA | 34755880 |
MMDBr0013162 | Fe2+ | Iron(3+) | Periplasmic nitrate reductase | Reduction | RHEA | 34755880 |
MMDBr0013170 | Adenosine monophosphate | ADP | Adenylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013173 | diphosphate | Phosphoribosyl pyrophosphate | Bifunctional protein PyrR | Transfer of phosphoribosyl group | RHEA | 34755880 |
MMDBr0013178 | D-Glucuronic acid | D-Fructofuranuronic acid | Uronate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013179 | Adenosine triphosphate | ADP | Replicase large subunit | Synthesis of a primer | RHEA | 34755880 |
MMDBr0013183 | Guanosine 3'-diphosphate 5'-triphosphate | Guanosine 3',5'-bis(diphosphate) | Guanosine-5'-triphosphate,3'-diphosphate pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0013185 | Iron(3+) | Fe2+ | Cytochrome c-552 | Reduction | RHEA | 34755880 |
MMDBr0013186 | 4-Imidazolone-5-propionic acid | Water | Urocanate hydratase | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0013187 | Adenosine triphosphate | Shikimate 3-phosphate | Pentafunctional AROM polypeptide | Phosphorylation | RHEA | 34755880 |
MMDBr0013194 | Water | Hydroxymethylbilane | Porphobilinogen deaminase | Deamination | RHEA | 34755880 |
MMDBr0013196 | 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole | 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate | N5-carboxyaminoimidazole ribonucleotide mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0013201 | Guanosine | Ribose-1-phosphate | Purine nucleoside phosphorylase DeoD-type | Phosphorylation | RHEA | 34755880 |
MMDBr0013212 | 7-Aminomethyl-7-carbaguanine | 7-Cyano-7-carbaguanine | NADPH-dependent 7-cyano-7-deazaguanine reductase | Reduction | RHEA | 34755880 |
MMDBr0013213 | 2-C-methyl-D-erythritol 4-phosphate | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase | Transfer of a cytidylyl group | RHEA | 34755880 |
MMDBr0013214 | Deoxycytidine | 2'-Deoxyuridine | Cytidine deaminase | Deamination | RHEA | 34755880 |
MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0013224 | Hydrogen Ion | diphosphate | Bifunctional protein GlmU | N-Acetylation; Phosphorylation; Isomerization | RHEA | 34755880 |
MMDBr0013226 | Adenosine triphosphate | ADP | Putative thymidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013231 | Adenosine triphosphate | ADP | Glutathione biosynthesis bifunctional protein GshAB | Synthesis | RHEA | 34755880 |
MMDBr0013236 | Water | 5-Methylthioribose | Aminodeoxyfutalosine nucleosidase | Hydrolysis of a nucleotide | RHEA | 34755880 |
MMDBr0013246 | 2-C-methyl-D-erythritol 4-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose 5-phosphate reductoisomerase | Isomerization | RHEA | 34755880 |
MMDBr0013248 | Acetyl-CoA | CoA | Bifunctional protein GlmU | N-Acetylation | RHEA | 34755880 |
MMDBr0013251 | Water | Hydrogen Ion | Sulfite reductase [NADPH] hemoprotein beta-component | Reduction | RHEA | 34755880 |
MMDBr0013274 | Adenosine triphosphate | ADP | Homoserine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013280 | D-Arabinose 5-phosphate | 3-deoxy-alpha-D-manno-2-octulosonate-8-phosphate | 2-dehydro-3-deoxyphosphooctonate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0013295 | (S)-4-Amino-5-oxopentanoate | 5-Aminolevulinic acid | Glutamate-1-semialdehyde 2,1-aminomutase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013303 | alpha-Ketoglutarate | 3-Phosphonatooxypyruvate(3-) | Phosphoserine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013309 | Phosphoglycolic acid | Glycolic acid | Phosphoglycolate phosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0013316 | Water | L-Histidinol | Histidine biosynthesis bifunctional protein HisB | Dephosphorylation | RHEA | 34755880 |
MMDBr0013333 | Adenosine triphosphate | ADP | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
MMDBr0013339 | aldehydo-D-ribose 5-phosphate | D-Ribulose 5-phosphate | Bifunctional ribokinase/ribose-5-phosphate isomerase A | Isomerization | RHEA | 34755880 |
MMDBr0013357 | (2R)-3-phosphoglyceric acid | (2R)-3-phospho-glyceroyl phosphate | Phosphoglycerate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013370 | Adenosine triphosphate | ADP | Glutamate 5-kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013395 | Oxygen | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013397 | Water | L-Glutamic acid | Succinylglutamate desuccinylase | Hydrolysis of carbon-nitrogen bond | RHEA | 34755880 |
MMDBr0013408 | 1-Deoxy-D-xylulose 5-phosphate | Hydrogen Ion | Pyridoxine 5'-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013411 | Betaine aldehyde | Glycine betaine | Probable betaine aldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013412 | Betaine aldehyde | Glycine betaine | Betaine aldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013422 | LL-2,6-Diaminoheptanedioate | Meso-2,6-Diaminoheptanedioate | Diaminopimelate epimerase | Epimerization; Racemization | RHEA | 34755880 |
MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013444 | Adenosine triphosphate | Phosphoribosyl pyrophosphate | Ribose-phosphate pyrophosphokinase 1 | Phosphorylation | RHEA | 34755880 |
MMDBr0013449 | Hydrogen Ion | Carbon dioxide | 4-hydroxy-4-methyl-2-oxoglutarate aldolase/4-carboxy-4-hydroxy-2-oxoadipate aldolase | Aldol addition (or reverse); Decarboxylation; Redox reaction | RHEA | 34755880 |
MMDBr0013458 | Guanosine triphosphate | Guanosine diphosphate | Adenylosuccinate synthetase | Synthesis | RHEA | 34755880 |
MMDBr0013464 | (7R,8S)-7,8-diammoniononanoic acid | Dethiobiotin | Biotin biosynthesis bifunctional protein BioCD | Amine group addition; Synthesis | RHEA | 34755880 |
MMDBr0013466 | Water | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013470 | (2R)-2-phosphoglyceric acid | (2R)-3-phosphoglyceric acid | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0013475 | Water | Acetic acid | N-acetyl-L-citrulline deacetylase | Deacetylation | RHEA | 34755880 |
MMDBr0013488 | Phosphate | 2-deoxy-alpha-D-ribose 1-phosphate | Pyrimidine-nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0013489 | adenosylcob(III)inamide-GDP | coenzyme B12 | Adenosylcobinamide-GDP ribazoletransferase | Transfer of ribazole | RHEA | 34755880 |
MMDBr0013493 | Cytidine | Ammonium | Cytidine deaminase | Deamination | RHEA | 34755880 |
MMDBr0013495 | Adenosine triphosphate | ADP | ATP-dependent 6-phosphofructokinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013526 | Pantothenic acid | (R)-4'-phosphopantothenic acid | Bifunctional enzyme BirA/CoaX | Phosphorylation | RHEA | 34755880 |
MMDBr0013529 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoylalanine--D-glutamate ligase | Ligation | RHEA | 34755880 |
MMDBr0013536 | Chorismate | 4-Hydroxybenzoic acid | Chorismate pyruvate-lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013544 | alpha-Ketoglutarate | (R)-3-hydroxy-2-oxo-4-phosphooxybutanoic acid | Phosphoserine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013547 | Adenosine triphosphate | ADP | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0013549 | Adenosine monophosphate | Phosphoribosyl pyrophosphate | Adenine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013566 | Hydrogen Ion | (R)-4'-phosphopantetheine | Coenzyme A biosynthesis bifunctional protein CoaBC | Decarboxylation | RHEA | 34755880 |
MMDBr0013571 | Adenosine triphosphate | ADP | Putative uridine kinase DAS2 | Phosphorylation | RHEA | 34755880 |
MMDBr0013584 | Hydrogen cyanide | Hydrogen Ion | Thiosulfate sulfurtransferase GlpE | Sulfuration | RHEA | 34755880 |
MMDBr0013605 | Ciliatine | L-Alanine | 2-aminoethylphosphonate--pyruvate transaminase | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0013611 | D-Glyceraldehyde 3-phosphate | beta-D-Fructose 6-phosphate | Transaldolase | Transfer of aldol group | RHEA | 34755880 |
MMDBr0013627 | Inosinic acid | GMP | GMP reductase | Reduction | RHEA | 34755880 |
MMDBr0013632 | L-Fucose | L-Fuculose | L-fucose isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013652 | Adenosine triphosphate | ADP | N-acetylgalactosamine kinase AgaK | Phosphorylation | RHEA | 34755880 |
MMDBr0013655 | 5-Phosphoribosylamine | ADP | Phosphoribosylamine--glycine ligase | Ligation | RHEA | 34755880 |
MMDBr0013659 | Guanosine triphosphate | 7,8-dihydroneopterin 3'-triphosphate | Bifunctional protein FolKE | Hydrolysis | RHEA | 34755880 |
MMDBr0013664 | ADP-D-glycero-beta-D-manno-heptose | ADP-L-glycero-beta-D-manno-heptose | ADP-L-glycero-D-manno-heptose-6-epimerase | Epimerization | RHEA | 34755880 |
MMDBr0013670 | Hydrogen Ion | Agmatine | Pyruvoyl-dependent arginine decarboxylase AaxB | Decarboxylation | RHEA | 34755880 |
MMDBr0013674 | Adenosine triphosphate | ADP | Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial | Ligation | RHEA | 34755880 |
MMDBr0013681 | NADP(+) | 3-Dehydroshikimic acid | Pentafunctional AROM polypeptide | Dehydrogenation | RHEA | 34755880 |
MMDBr0013683 | S-Ribosyl-L-homocysteine | (4S)-4,5-Dihydroxypentan-2,3-dione | S-ribosylhomocysteine lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013686 | Water | Adenine | Aminodeoxyfutalosine nucleosidase | Hydrolysis of a nucleotide | RHEA | 34755880 |
MMDBr0013703 | Dihydroxyacetone phosphate | BPG | Methylglyoxal synthase | Synthesis | RHEA | 34755880 |
MMDBr0013708 | diphosphate | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of phosphoribosyl group; Synthesis | RHEA | 34755880 |
MMDBr0013709 | Phosphoribosyl pyrophosphate | diphosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013717 | alpha-Ketoglutarate | L-Glutamic acid | Acetylornithine aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013729 | Adenosine triphosphate | Adenosine phosphosulfate | Sulfate adenylyltransferase subunit 2 | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0013742 | 3'-dephospho-CoA | ADP | Dephospho-CoA kinase CAB5 | Phosphorylation | RHEA | 34755880 |
MMDBr0013745 | Coproporphyrinogen III | Carbon dioxide | Oxygen-dependent coproporphyrinogen-III oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013768 | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013770 | Water | Phosphoribosyl formamidocarboxamide | Bifunctional purine biosynthesis protein PurH | Hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0013771 | D-Ribulose 5-phosphate | L-3,4-Dihydroxybutan-2-one 4-phosphate | 3,4-dihydroxy-2-butanone 4-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013773 | 1-(5-phosphoribosyl)-ATP | Phosphoribosyl pyrophosphate | ATP phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013784 | D-Glyceraldehyde 3-phosphate | Dihydroxyacetone phosphate | Bifunctional PGK/TIM | Isomerization | RHEA | 34755880 |
MMDBr0013790 | Adenosine triphosphate | ADP | Phosphoenolpyruvate carboxykinase (ATP) | Phosphorylation | RHEA | 34755880 |
MMDBr0013792 | Adenosine triphosphate | ADP | NAD kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013801 | Phosphoenolpyruvic acid | Phosphate | UDP-N-acetylglucosamine 1-carboxyvinyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0013809 | Ribose-1-phosphate | D-Ribose-5-phosphate | Phosphopentomutase | Transfers of a phosphate group; Isomerization; Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0013811 | 4-Phospho-D-erythronate | (R)-3-hydroxy-2-oxo-4-phosphooxybutanoic acid | Erythronate-4-phosphate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013820 | Water | Acetaldehyde | Phosphonoacetaldehyde hydrolase | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0013843 | Adenosine triphosphate | ADP | Thymidine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013851 | Adenosine triphosphate | ADP | Cytochrome c biogenesis ATP-binding export protein CcmA | Transport | RHEA | 34755880 |
MMDBr0013854 | 5-Aminoimidazole ribonucleotide | 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole | N5-carboxyaminoimidazole ribonucleotide synthase | Synthesis | RHEA | 34755880 |
MMDBr0013876 | NADPH | Hydrogen Ion | Flavohemoprotein | NO detoxification | RHEA | 34755880 |
MMDBr0013877 | NADH | Hydrogen Ion | Flavohemoprotein | NO detoxification | RHEA | 34755880 |
MMDBr0013886 | Carbamoylphosphate | Hydrogen Ion | Ornithine carbamoyltransferase | Transfer of a carbamoyl group | RHEA | 34755880 |
MMDBr0013895 | L-Glutamic-gamma-semialdehyde | Hydrogen Ion | Gamma-glutamyl phosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0013896 | Polyphosphate | Polyphosphate | ADP-polyphosphate phosphotransferase | Transfer of phosphate group | RHEA | 34755880 |
MMDBr0013901 | Water | Citrulline | Arginine deiminase | Hydrolysis of l-arginine to citrulline and ammonium ion | RHEA | 34755880 |
MMDBr0013906 | Mannitol 1-phosphate | beta-D-Fructose 6-phosphate | Mannitol-1-phosphate 5-dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0013908 | Guanosine triphosphate | Guanosine diphosphate | GTPase ArgK | Dephosphorylation; Hydrolysis; Nucleic acid synthesis and/or repair | RHEA | 34755880 |
MMDBr0013921 | (R)-4'-phosphopantetheine | 3'-dephospho-CoA | Phosphopantetheine adenylyltransferase | Dephosphorylation | RHEA | 34755880 |
MMDBr0013929 | Hydrogen Ion | Carbon dioxide | Uroporphyrinogen decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013946 | Carbamoylphosphate | Hydrogen Ion | Protein pyrABCN | Transfer of a carbamoyl group | RHEA | 34755880 |
MMDBr0013952 | 1-(5-phosphoribosyl)-5'-AMP | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | Histidine biosynthesis bifunctional protein HisIE | Hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0013956 | D-Mannonate | 2-Dehydro-3-deoxy-D-gluconate | D-galactonate dehydratase family member ManD | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0013966 | (6S)-5,6,7,8-tetrahydrofolic acid | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Ligation; Synthesis | RHEA | 34755880 |
MMDBr0013970 | L-Alanine | D-Alanine | L-alanine/L-glutamate racemase | Racemization | RHEA | 34755880 |
MMDBr0013978 | Hydrogen peroxide | Water | Bromoperoxidase-catalase | Synthesis | RHEA | 34755880 |
MMDBr0014035 | Adenosine triphosphate | ADP | Guanylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014061 | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Chorismate | Chorismate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014068 | 3-Dehydroquinate | 3-Dehydroshikimic acid | Catabolic 3-dehydroquinase | Hydration/dehydration of C-O bond; Synthesis | RHEA | 34755880 |
MMDBr0014080 | Adenosine triphosphate | Adenosine monophosphate | NH(3)-dependent NAD(+) synthetase | Synthesis | RHEA | 34755880 |
MMDBr0014083 | Shikimate 3-phosphate | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Pentafunctional AROM polypeptide | Synthesis; Dehydration and isomerisation; Oxidation; Phosphorylation; Transfer of a carboxyvinyl group | RHEA | 34755880 |
MMDBr0014105 | (S)-malate(2-) | Hydrogen Ion | Malate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0014111 | alpha-Ketoisovaleric acid | 2-Isopropylmalic acid | Isopropyl malate synthase AMT7 | Synthesis | RHEA | 34755880 |
MMDBr0014117 | N-Acetyl-L-glutamate 5-semialdehyde | Hydrogen Ion | Protein ARG5,6, mitochondrial | Reduction | RHEA | 34755880 |
MMDBr0014126 | Adenosine triphosphate | ADP | Glycerol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014133 | Adenosine triphosphate | ADP | sn-glycerol-3-phosphate import ATP-binding protein UgpC | Transport | RHEA | 34755880 |
MMDBr0014141 | (S)-3-Hydroxybutanoyl-CoA | (3R)-3-hydroxybutanoyl-CoA | Fatty acid oxidation complex subunit alpha | Aerobic and anaerobic degradation of long-chain fatty acids | RHEA | 34755880 |
MMDBr0014160 | 3-deoxy-D-arabino-heptulosonate-7-phosphate | 3-Dehydroquinate | Pentafunctional AROM polypeptide | Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0014164 | L-Homoserine | CoA | Homoserine O-succinyltransferase | Transfer of succinyl moiety | RHEA | 34755880 |
MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0014174 | Adenosine triphosphate | ADP | Maltose/maltodextrin import ATP-binding protein MalK | Transport | RHEA | 34755880 |
MMDBr0014180 | (6S)-10-formyltetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Bifunctional purine biosynthesis protein PurH | Synthesis | RHEA | 34755880 |
MMDBr0014217 | Water | Formamide | Formimidoylglutamase | Hydrolysis of carbon-nitrogen bond | RHEA | 34755880 |
MMDBr0014221 | Hydrogen Ion | Fe2+ | Deferrochelatase/peroxidase EfeB | Chelation | RHEA | 34755880 |
MMDBr0014225 | Water | LL-2,6-Diaminoheptanedioate | Succinyl-diaminopimelate desuccinylase | Hydrolysis of carbon-nitrogen bond | RHEA | 34755880 |
MMDBr0014229 | 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate | (2S)-2-[5-Amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamido]succinic acid | Phosphoribosylaminoimidazole-succinocarboxamide synthase | Synthesis | RHEA | 34755880 |
MMDBr0014244 | 4-hydroxy-4-methyl-2-oxoglutarate | Pyruvic acid | 4-hydroxy-4-methyl-2-oxoglutarate aldolase cghB | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
MMDBr0014256 | 1-(5-phosphoribosyl)-ATP | 1-(5-phosphoribosyl)-5'-AMP | Phosphoribosyl-ATP pyrophosphatase | Dephosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0014282 | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | 5-Aminoimidazole ribonucleotide | Bifunctional purine biosynthetic protein ADE5,7 | Ligation | RHEA | 34755880 |
MMDBr0014299 | Acetic acid | Acetyl-CoA | Acetyl-coenzyme A synthetase 1 | Ligation; Synthesis | RHEA | 34755880 |
MMDBr0014323 | Adenosine triphosphate | ADP | Bifunctional enzyme MurC/Ddl | Ligation | RHEA | 34755880 |
MMDBr0014333 | alpha-D-Glucosamine 1-phosphate | D-glucosamine 6-phosphate | Phosphoglucosamine mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0014337 | 3-deoxy-D-manno-2-octulosonate | CMP-3-deoxy-beta-D-manno-octulosonate | 3-deoxy-manno-octulosonate cytidylyltransferase | Transfer of a cytidylyl group | RHEA | 34755880 |
MMDBr0014353 | adenosylcob(III)inamide-GDP | adenosylcob(III)alamin 5'-phosphate | Adenosylcobinamide-GDP ribazoletransferase | Transfer of ribazole | RHEA | 34755880 |
MMDBr0014365 | 4-Imidazolone-5-propionic acid | Formiminoglutamic acid | Imidazolonepropionase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0014366 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase | Ligation | RHEA | 34755880 |
MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Reversible cyclization | RHEA | 34755880 |
MMDBr0014377 | alpha-Ketoglutarate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Histidinol-phosphate aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
MMDBr0014407 | Argininosuccinic acid | fumarate | Bifunctional protein ArgHA | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0014417 | Adenosine phosphosulfate | Phosphoadenosine phosphosulfate | Adenylyl-sulfate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014428 | Iron(3+) | Fe2+ | Dimethyl sulfoxide/trimethylamine N-oxide reductase | Reduction | RHEA | 34755880 |
MMDBr0014431 | Water | ADP | Bis(5'-nucleosyl)-tetraphosphatase, symmetrical | Dephosphorylation; Hydrolysis of bond | RHEA | 34755880 |
MMDBr0014436 | Acetyl-CoA | CoA | Amino-acid acetyltransferase | Acetylation; Synthesis | RHEA | 34755880 |
MMDBr0014437 | L-Dihydroorotic acid | Hydrogen Ion | Dihydroorotase | Hydrolysis | RHEA | 34755880 |
MMDBr0014444 | Phosphate | Ribose-1-phosphate | Pyrimidine-nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0014447 | Adenosine triphosphate | ADP | UMP-CMP kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014449 | Deoxyadenosine | Inosine | Adenosine deaminase | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014450 | Deoxyadenosine | Inosine | Adenosine deaminase | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014454 | Adenosine triphosphate | ADP | Phosphate-import ATP-binding protein PhnC | Transport | RHEA | 34755880 |
MMDBr0014461 | diphosphate | Hydrogen Ion | Inorganic pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014472 | Adenosine triphosphate | ADP | Cytidine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014486 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014487 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014489 | Adenosine triphosphate | ADP | Formate-dependent phosphoribosylglycinamide formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0014490 | Adenosine triphosphate | ADP | Formate-dependent phosphoribosylglycinamide formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0017917 | 5-Aminoimidazole ribonucleotide | 4-Amino-2-methyl-5-phosphomethylpyrimidine | Phosphomethylpyrimidine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014502 | 1,6-Anhydro-N-acetyl-beta-muramate | ADP | Anhydro-N-acetylmuramic acid kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014514 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014523 | Water | 2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-alpha-D-glucosaminyl 1-phosphate | UDP-2,3-diacylglucosamine hydrolase | Dephosphorylation; Hydrolysis of bond | RHEA | 34755880 |
MMDBr0014525 | N-Acetyl-alpha-neuraminate | N-acetyl-beta-neuraminic acid | N-acetylneuraminate epimerase | Epimerization | RHEA | 34755880 |
MMDBr0014556 | diphosphate | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0014557 | Phosphoribosyl pyrophosphate | diphosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0014559 | beta-D-Ribopyranose | beta-D-ribofuranose | L-fucose mutarotase | Mutarotation | RHEA | 34755880 |
MMDBr0014566 | alpha-Ketoglutarate | 5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylic acid | 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014596 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014597 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014619 | L-3,4-Dihydroxybutan-2-one 4-phosphate | 6,7-Dimethyl-8-(1-D-ribityl)lumazine | 6,7-dimethyl-8-ribityllumazine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014642 | Water | D-Lactic acid | N-acetylmuramic acid 6-phosphate etherase | Bond cleavage | RHEA | 34755880 |
MMDBr0017926 | Adenosine triphosphate | ADP | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0014686 | Adenosine triphosphate | ADP | D-beta-D-heptose 7-phosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014696 | Farnesyl pyrophosphate | di-trans,octa-cis-undecaprenyl diphosphate | Ditrans,polycis-undecaprenyl-diphosphate synthase ((2E,6E)-farnesyl-diphosphate specific) | Synthesis | RHEA | 34755880 |
MMDBr0014707 | Phosphate | Ribose-1-phosphate | Pyrimidine/purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0014708 | Deoxyadenosine | Adenine | Purine nucleoside phosphorylase DeoD-type | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014710 | Inosine | Ribose-1-phosphate | Purine nucleoside phosphorylase DeoD-type | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014718 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014719 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014720 | D-Galacturonate | D-Tagaturonate | Uronate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0014732 | 4-Hydroxybenzoic acid | 3-Octaprenyl-4-hydroxybenzoate | 4-hydroxybenzoate octaprenyltransferase | Synthesis; Reverse C-prenylation of phenalenone | RHEA | 34755880 |
MMDBr0014763 | 7-Deaza-7-carboxyguanine | 7-Cyano-7-carbaguanine | 7-cyano-7-deazaguanine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014776 | Farnesyl pyrophosphate | diphosphate | Protoheme IX farnesyltransferase, mitochondrial | Farnesylation | RHEA | 34755880 |
MMDBr0014783 | di-trans,octa-cis-undecaprenyl diphosphate | di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-diphosphatase BcrC | Dephosphorylation | RHEA | 34755880 |
MMDBr0014813 | Water | Hydrogen Ion | Bifunctional phosphopantetheine adenylyltransferase/NTP phosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014816 | 2'-Deoxyinosine triphosphate | DIMP | Inosine triphosphate pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014821 | Oxalacetic acid | Hydrogen carbonate | Phosphoenolpyruvate carboxylase | Carboxylation | RHEA | 34755880 |
MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transfer of phospho-N-acetylmuramoyl-pentapeptide | RHEA | 34755880 |
MMDBr0014829 | Water | Hydrogen Ion | Bifunctional phosphopantetheine adenylyltransferase/NTP phosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014842 | alpha-Kdo-(2->6)-lipid IVA | 4-O-phospho-alpha-Kdo-(2->6)-lipid IVA | 3-deoxy-D-manno-octulosonic acid kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014846 | Thymidine 5'-triphosphate | diphosphate | dTTP/UTP pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014848 | Water | diphosphate | Inosine triphosphate pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014897 | Hydrogen Ion | Hydrogen Ion | Na(+)/H(+) antiporter NhaB | Transport | RHEA | 34755880 |
MMDBr0014898 | Hydrogen Ion | Hydrogen Ion | Na(+)/H(+) antiporter NhaB | Transport | RHEA | 34755880 |
MMDBr0014899 | Hydrogen Ion | Hydrogen Ion | Na(+)/H(+) antiporter NhaA | Transport | RHEA | 34755880 |
MMDBr0014900 | Hydrogen Ion | Hydrogen Ion | Na(+)/H(+) antiporter NhaA | Transport | RHEA | 34755880 |
MMDBr0014908 | Water | diphosphate | dTTP/UTP pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014909 | Water | diphosphate | Inosine triphosphate pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014921 | Chloride ion | Chloride ion | H(+)/Cl(-) exchange transporter ClcA | Transport | RHEA | 34755880 |
MMDBr0017941 | L-Serine | L-Serine | Serine/threonine transporter SstT | Transport | RHEA | 34755880 |
MMDBr0017942 | L-Serine | L-Serine | Serine/threonine transporter SstT | Transport | RHEA | 34755880 |
MMDBr0014935 | Adenosine triphosphate | ADP | Methionine import ATP-binding protein MetN | Transport | RHEA | 34755880 |
MMDBr0017943 | Adenosine triphosphate | ADP | Methionine import ATP-binding protein MetN | Transport | RHEA | 34755880 |
MMDBr0014937 | Adenosine triphosphate | ADP | Zinc import ATP-binding protein ZnuC | ATP hydrolysis | RHEA | 34755880 |
MMDBr0014940 | Adenosine triphosphate | ADP | Thiamine import ATP-binding protein ThiQ | Transport | RHEA | 34755880 |
MMDBr0014941 | 5'-Deoxyadenosine | 5'-Deoxyribose | Aminodeoxyfutalosine nucleosidase | Hydrolysis of a nucleotide | RHEA | 34755880 |
MMDBr0014942 | 5'-Deoxyadenosine | 5'-Deoxyribose | 5'-methylthioadenosine/S-adenosylhomocysteine nucleosidase | Hydrolysis of a nucleotide | RHEA | 34755880 |
MMDBr0014946 | Adenosine triphosphate | ADP | Ribose import ATP-binding protein RbsA | Transport | RHEA | 34755880 |
MMDBr0015026 | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | di-trans-octa-cis-undecaprenyl diphospho-[N-acetyl-alpha-D-glucosaminyl-(1->4)]-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 1; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 2; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 3 | RHEA | 34755880 |
MMDBr0015133 | 3-Isopropylmalate | Ketoleucine | 3-isopropylmalate dehydrogenase AMT6 | Dehydrogenation | RHEA | 34755880 |
MMDBr0015135 | 4-(phosphooxy)-L-threonine | 3-Amino-2-oxopropyl phosphate | 4-hydroxythreonine-4-phosphate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0015136 | 3-Isopropylmalate | 2-Isopropylmalic acid | 3-isopropylmalate dehydratase large subunit gloJ | Isomerization | RHEA | 34755880 |
MMDBr0015316 | L-Aspartate-semialdehyde | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0015325 | Guanosine triphosphate | diphosphate | Molybdenum cofactor guanylyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0015402 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
MMDBr0015405 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
MMDBr0015480 | Phosphoribosyl pyrophosphate | ADP | Probable nicotinate phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0017965 | Adenosine triphosphate | diphosphate | Threonylcarbamoyl-AMP synthase | Synthesis | RHEA | 34755880 |
MMDBr0015880 | Hydrogen Ion | NADH | Nitric oxide reductase FlRd-NAD(+) reductase | Reduction | RHEA | 34755880 |
MMDBr0015916 | 1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (flavodoxin) | Synthesis | RHEA | 34755880 |
MMDBr0016462 | (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate | Cyclic pyranopterin monophosphate | Cyclic pyranopterin monophosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0017981 | Prephenate | 3-phenylpyruvic acid | Carboxy-S-adenosyl-L-methionine synthase | Synthesis | RHEA | 34755880 |
MMDBr0016600 | Cytidine | Ribose-1-phosphate | Pyrimidine/purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0016770 | 5-amino-6-(5-phospho-D-ribosylamino)uracil | 5,6-diaminouracil | N-glycosidase YbiA | Synthesis | RHEA | 34755880 |
MMDBr0016813 | 2-Aminobenzoic acid | 2-(4-dimethylaminophenyl)diazenylbenzoic acid | FMN-dependent NADPH-azoreductase | Reduction | RHEA | 34755880 |
MMDBr0016907 | Adenosine triphosphate | ADP | ATP synthase subunit alpha | ATP hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0016908 | Hydrogen Ion | Carbon dioxide | Oxaloacetate decarboxylase alpha chain | Decarboxylation | RHEA | 34755880 |
MMDBr0016947 | Water | diphosphate | 7-methyl-GTP pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0017047 | Adenosine triphosphate | ADP | Galactose/methyl galactoside import ATP-binding protein MglA | Transport | RHEA | 34755880 |
MMDBr0017322 | Water | Acetic acid | N(4)-acetylcytidine amidohydrolase | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0017323 | Water | Deoxycytidine | N(4)-acetylcytidine amidohydrolase | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0017324 | Water | Acetic acid | N(4)-acetylcytidine amidohydrolase | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0017834 | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | D-Glyceraldehyde 3-phosphate | Tryptophan synthase | Synthesis | RHEA | 34755880 |
MMDBr0017838 | (6S)-5-methyl-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Methionine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017843 | Adenosine triphosphate | Adenosine monophosphate | GMP synthase [glutamine-hydrolyzing] | Synthesis | RHEA | 34755880 |
MMDBr0017850 | L-Threonine | L-2-Amino-3-oxobutanoic acid | L-threonine 3-dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0017851 | Fructose 6-phosphate | D-glucosamine 6-phosphate | Glutamine--fructose-6-phosphate aminotransferase [isomerizing] | Amine group addition | RHEA | 34755880 |
MMDBr0017852 | Adenosine triphosphate | ADP | Glutamate--cysteine ligase EgtA | Ligation | RHEA | 34755880 |
MMDBr0017871 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Serine hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0017874 | Water | L-Glutamic acid | Thermolabile glutaminase | Synthesis | RHEA | 34755880 |
MMDBr0017879 | Adenosine triphosphate | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | Phosphoribosylformylglycinamidine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017882 | Adenosine triphosphate | ADP | Carbamoyl-phosphate synthase small chain | Synthesis | RHEA | 34755880 |
MMDBr0017885 | (R)-4'-phosphopantothenic acid | CMP | Phosphopantothenate--cysteine ligase CAB2 | Ligation | RHEA | 34755880 |
MMDBr0017886 | Water | Indole | Probable tryptophanase | Non-hydrolytic bond cleavage | RHEA | 34755880 |
MMDBr0017894 | Water | Hydrogen Ion | Histidinol dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0017897 | Adenosine triphosphate | diphosphate | S-adenosylmethionine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017898 | 5-methyltetrahydropteroyltri-L-glutamate | L-Methionine | 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0017903 | L-Histidine | Ammonium | Histidine ammonia-lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | Synthesis | RHEA | 34755880 |
MMDBr0024345 | Adenosine triphosphate | Hydrogen Ion | Tyrosine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024346 | NAD | Hydrogen Ion | Enoyl-[acyl-carrier-protein] reductase [NADH] | Reduction; Synthesis | RHEA | 34755880 |
MMDBr0024360 | Adenosine triphosphate | diphosphate | Valine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024368 | Adenosine triphosphate | diphosphate | Isoleucine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024371 | Adenosine triphosphate | Hydrogen Ion | Asparagine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024389 | Adenosine triphosphate | diphosphate | Leucine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024392 | Hydrogen Ion | L-Cysteine | Phosphoadenosine 5'-phosphosulfate reductase | Reduction | RHEA | 34755880 |
MMDBr0024401 | L-Serine | Hydrogen Ion | Holo-[acyl-carrier-protein] synthase | Dehydrogenation; Synthesis | RHEA | 34755880 |
MMDBr0024403 | Hydrogen Ion | Carbon dioxide | 3-oxoacyl-[acyl-carrier-protein] synthase 3 | Synthesis | RHEA | 34755880 |
MMDBr0024411 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024415 | (S)-4-Amino-5-oxopentanoate | Hydrogen Ion | Glutamyl-tRNA reductase | Reduction | RHEA | 34755880 |
MMDBr0024418 | Adenosine triphosphate | diphosphate | Alanine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024424 | S-Adenosylmethionine | S-Adenosylhomocysteine | Protein-L-isoaspartate O-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0024435 | Deoxyribose 5-phosphate | Acetaldehyde | Deoxyribose-phosphate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0024449 | Adenosine triphosphate | diphosphate | Methionine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024454 | D-Galactose | Hydrogen Ion | Galactokinase | Phosphorylation | RHEA | 34755880 |
MMDBr0024459 | Uridine triphosphate | diphosphate | Bifunctional uridylyltransferase/uridylyl-removing enzyme | Transfer of an uridylyl group | RHEA | 34755880 |
MMDBr0024474 | Adenosine triphosphate | diphosphate | Proline--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024477 | Adenosine triphosphate | diphosphate | CCA-adding enzyme | Synthesis and repair of 3'-terminal CCA sequence of tRNA | RHEA | 34755880 |
MMDBr0024500 | Glycerol 3-phosphate | CoA | Glycerol-3-phosphate acyltransferase | Acylation | RHEA | 34755880 |
MMDBr0024522 | Adenosine triphosphate | diphosphate | Glycine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024533 | Water | Ammonium | Probable chemoreceptor glutamine deamidase CheD | Deamidation | RHEA | 34755880 |
MMDBr0024535 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase F | Methylation | RHEA | 34755880 |
MMDBr0024539 | Hydrogen Ion | 5'-Deoxyadenosine | Lipoyl synthase | Synthesis | RHEA | 34755880 |
MMDBr0024559 | Adenosine triphosphate | Hydrogen Ion | Histidine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024565 | Choline | Betaine aldehyde | Oxygen-dependent choline dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0024578 | Adenosine triphosphate | diphosphate | Cysteine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024581 | Water | Hydrogen Ion | Cobalamin import ATP-binding protein BtuD | Transport | RHEA | 34755880 |
MMDBr0024590 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0024593 | ADP-alpha-D-glucose | Hydrogen Ion | Probable glycogen synthase | Synthesis | RHEA | 34755880 |
MMDBr0024602 | Adenosine triphosphate | diphosphate | Bifunctional glutamine synthetase adenylyltransferase/adenylyl-removing enzyme | Synthesis | RHEA | 34755880 |
MMDBr0024605 | L-Cysteine | Hydrogen Ion | Thiol:disulfide interchange protein DsbD | Transfer of electrons from cytoplasmic thioredoxin to the periplasm | RHEA | 34755880 |
MMDBr0024606 | L-Cysteine | Hydrogen Ion | Thiol:disulfide interchange protein DsbD | Transfer of electrons from cytoplasmic thioredoxin to the periplasm | RHEA | 34755880 |
MMDBr0024612 | Glycerol 3-phosphate | Dihydroxyacetone phosphate | Probable anaerobic glycerol-3-phosphate dehydrogenase subunit B | Dehydrogenation | RHEA | 34755880 |
MMDBr0024628 | Adenosine triphosphate | Hydrogen Ion | Phenylalanine--tRNA ligase beta subunit | Ligation | RHEA | 34755880 |
MMDBr0024629 | S-Adenosylmethionine | Hydrogen Ion | tRNA 5-methylaminomethyl-2-thiouridine biosynthesis bifunctional protein MnmC | Synthesis | RHEA | 34755880 |
MMDBr0024630 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase A | Methylation | RHEA | 34755880 |
MMDBr0024632 | L-Aspartic acid | diphosphate | Aspartate--tRNA(Asp) ligase | Ligation | RHEA | 34755880 |
MMDBr0024636 | Phosphate | Ribose-1-phosphate | Probable 6-oxopurine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0024649 | Adenosine triphosphate | diphosphate | Glutamine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024656 | Adenosine triphosphate | diphosphate | Arginine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024666 | Adenosine triphosphate | diphosphate | Lysine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024688 | Acetyl-CoA | CoA | 3-ketoacyl-CoA thiolase | Carbon–carbon-bond formation | RHEA | 34755880 |
MMDBr0024705 | Water | Hydrogen Ion | Molybdenum import ATP-binding protein ModC | Transport | RHEA | 34755880 |
MMDBr0024706 | Water | Hydrogen Ion | Hydroxylamine reductase | Reduction | RHEA | 34755880 |
MMDBr0024707 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Biotin synthase | Synthesis | RHEA | 34755880 |
MMDBr0024716 | NAD | Hydrogen Ion | Fatty acid oxidation complex subunit alpha | Dehydrogenation | RHEA | 34755880 |
MMDBr0024742 | Water | D-Ribose-5-phosphate | N-glycosidase Npun_R5314 | Synthesis | RHEA | 34755880 |
MMDBr0024745 | L-Glutamic acid | diphosphate | Glutamate--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024750 | Water | Hydrogen Ion | GTP cyclohydrolase-2 | Hydrolysis of bond; Synthesis | RHEA | 34755880 |
MMDBr0024751 | lipid II(3−) | Hydrogen Ion | Penicillin-binding protein 2a | Glycan chain elongation | RHEA | 34755880 |
MMDBr0024755 | Adenosine triphosphate | Hydrogen Ion | N-acetylmannosamine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0024763 | Adenosine triphosphate | Hydrogen Ion | Tryptophan--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024765 | 7-Aminomethyl-7-carbaguanine | Guanine | Putative queuine tRNA-ribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0024766 | S-Adenosylmethionine | Hydrogen Ion | 23S rRNA (guanosine-2'-O-)-methyltransferase RlmB | Methylation | RHEA | 34755880 |
MMDBr0024768 | Water | L-Cysteine | Peptide methionine sulfoxide reductase MsrB | Reduction | RHEA | 34755880 |
MMDBr0024770 | Hydrogen Ion | L-Cysteine | Probable tRNA sulfurtransferase | Sulfuration | RHEA | 34755880 |
MMDBr0024774 | Hydrogen Ion | Carbon dioxide | Probable glycine dehydrogenase (decarboxylating) subunit 1 | Dehydrogenation | RHEA | 34755880 |
MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | Hydrogen Ion | Methionyl-tRNA formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0024779 | Water | formate | Peptide deformylase 1 | Removal of the N-terminal formyl group | RHEA | 34755880 |
MMDBr0024782 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0024787 | Adenosine triphosphate | Hydrogen Ion | Threonine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024789 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0024808 | 1-Deoxy-D-xylulose 5-phosphate | Water | Thiazole synthase | Synthesis | RHEA | 34755880 |
MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | Transfer of a dimethylallyl group | RHEA | 34755880 |
MMDBr0024825 | Hydrogen Ion | diphosphate | Bifunctional protein HldE | Phosphorylation | RHEA | 34755880 |
MMDBr0024826 | 2-deoxy-alpha-D-ribose 1-phosphate | Deoxyribose 5-phosphate | Phosphopentomutase | Transfers of a phosphate group; Isomerization; Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0024831 | Water | Ammonium | Adenosine deaminase | Hydrolytic deamination | RHEA | 34755880 |
MMDBr0024832 | Water | Ammonium | Adenosine deaminase | Hydrolytic deamination | RHEA | 34755880 |
MMDBr0024834 | S-Adenosylmethionine | Hydrogen Ion | Ubiquinone/menaquinone biosynthesis C-methyltransferase UbiE | Methylation | RHEA | 34755880 |
MMDBr0024851 | L-Dihydroorotic acid | orotate | Dihydroorotate dehydrogenase (quinone) | Dehydrogenation | RHEA | 34755880 |
MMDBr0024875 | S-Adenosylmethionine | Hydrogen Ion | Ubiquinone biosynthesis O-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0024883 | S-Adenosylmethionine | Hydrogen Ion | S-adenosylmethionine:tRNA ribosyltransferase-isomerase | Isomerization | RHEA | 34755880 |
MMDBr0024912 | N-acetyl-beta-D-muramate | L-Histidine | PTS system N-acetylmuramic acid-specific EIIBC component | Phosphorylation | RHEA | 34755880 |
MMDBr0024925 | Glycerol 3-phosphate | Phosphate | Glycerol-3-phosphate acyltransferase | Acylation | RHEA | 34755880 |
MMDBr0024957 | Phosphate | 2-deoxy-alpha-D-ribose 1-phosphate | Purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0024967 | S-Adenosylmethionine | Hydrogen Ion | tRNA (guanine(37)-N1)-methyltransferase Trm5b | Methylation | RHEA | 34755880 |
MMDBr0024971 | L-Threonylcarbamoyladenylate | Hydrogen Ion | tRNA N6-adenosine threonylcarbamoyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0024974 | S-Adenosylmethionine | Hydrogen Ion | tRNA-2-methylthio-N(6)-dimethylallyladenosine synthase | Synthesis | RHEA | 34755880 |
MMDBr0024977 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein S12 methylthiotransferase RimO | Methylthiolation | RHEA | 34755880 |
MMDBr0025050 | Hydrogen Ion | Carbon dioxide | Putative 8-amino-7-oxononanoate synthase | Ligation; Synthesis | RHEA | 34755880 |
MMDBr0025060 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0025063 | S-Adenosylmethionine | Hydrogen Ion | 23S rRNA (uracil(747)-C(5))-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025066 | S-Adenosylmethionine | Hydrogen Ion | Demethylmenaquinone methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025071 | S-Adenosylmethionine | S-Adenosylhomocysteine | tRNA (guanine-N(7)-)-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025072 | S-Adenosylmethionine | Hydrogen Ion | tRNA (uracil(54)-C(5))-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025075 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase E | Methylation | RHEA | 34755880 |
MMDBr0025078 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase G | Methylation | RHEA | 34755880 |
MMDBr0025079 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase C | Methylation | RHEA | 34755880 |
MMDBr0025081 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase K/L | Methylation | RHEA | 34755880 |
MMDBr0025082 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase G | Methylation | RHEA | 34755880 |
MMDBr0025084 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase B | Methylation | RHEA | 34755880 |
MMDBr0025085 | S-Adenosylmethionine | Hydrogen Ion | Putative ribosomal RNA large subunit methyltransferase H | Methylation | RHEA | 34755880 |
MMDBr0025086 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase F | Methylation | RHEA | 34755880 |
MMDBr0025092 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase M | Methylation | RHEA | 34755880 |
MMDBr0025100 | S-Adenosylmethionine | Hydrogen Ion | 23S rRNA (uracil(1939)-C(5))-methyltransferase RlmD | Methylation | RHEA | 34755880 |
MMDBr0025101 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase I | Methylation | RHEA | 34755880 |
MMDBr0025102 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Ribosomal RNA large subunit methyltransferase N | Methylation | RHEA | 34755880 |
MMDBr0025105 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase H | Methylation | RHEA | 34755880 |
MMDBr0025129 | S-Adenosylmethionine | Hydrogen Ion | tRNA1(Val) (adenine(37)-N6)-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025144 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase J | Methylation | RHEA | 34755880 |
MMDBr0025145 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Probable dual-specificity RNA methyltransferase RlmN | Methylation | RHEA | 34755880 |
MMDBr0025152 | S-Adenosylmethionine | Hydrogen Ion | tRNA/tmRNA (uracil-C(5))-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025154 | Water | Niacinamide | NAD-dependent protein deacetylase | Deacetylation | RHEA | 34755880 |
MMDBr0025165 | Phosphate | L-Tyrosine | Bifunctional glutamine synthetase adenylyltransferase/adenylyl-removing enzyme | Synthesis | RHEA | 34755880 |
MMDBr0025167 | Adenosine triphosphate | Hydrogen Ion | tRNA(Ile)-lysidine synthase | Synthesis | RHEA | 34755880 |
MMDBr0025171 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase K/L | Methylation | RHEA | 34755880 |
MMDBr0025190 | S-Adenosylmethionine | Hydrogen Ion | Ubiquinone biosynthesis O-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025193 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0025215 | ADP | Hydrogen Ion | Putative phosphoenolpyruvate synthase regulatory protein | Synthesis | RHEA | 34755880 |
MMDBr0025258 | Adenosine triphosphate | Hydrogen Ion | tRNA-specific 2-thiouridylase MnmA | 2-Thiolation of uridine | RHEA | 34755880 |
MMDBr0025273 | Water | Niacinamide | NAD-dependent protein deacylase | Deacylation | RHEA | 34755880 |
MMDBr0025280 | Hydrogen Ion | Sodium | Na(+)-translocating NADH-quinone reductase subunit D | Reduction | RHEA | 34755880 |
MMDBr0025300 | Hydrogen Ion | diphosphate | Putative phosphoenolpyruvate synthase regulatory protein | Synthesis | RHEA | 34755880 |
MMDBr0025326 | Guanosine triphosphate | Hydrogen Ion | Probable GTP 3',8-cyclase | Cycle formation | RHEA | 34755880 |
MMDBr0025432 | carboxy-S-adenosyl-L-methionine | Hydrogen Ion | tRNA U34 carboxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025490 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein L11 methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025493 | Adenosine triphosphate | diphosphate | Protein adenylyltransferase MntA | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025494 | Adenosine triphosphate | diphosphate | Protein adenylyltransferase SelO | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025495 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025496 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025514 | Acetyl-CoA | Malonyl-CoA | Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha | Carboxylation | RHEA | 34755880 |
MMDBr0025620 | L-Cysteine | Hydrogen Ion | Phosphatidylglycerol--prolipoprotein diacylglyceryl transferase | Transfer of the diacylglyceryl group | RHEA | 34755880 |
MMDBr0025638 | Adenosine triphosphate | Hydrogen Ion | tRNA-cytidine(32) 2-sulfurtransferase | Sulfuration | RHEA | 34755880 |
MMDBr0025639 | Adenosine triphosphate | Hydrogen Ion | tRNA-cytidine(32) 2-sulfurtransferase | Sulfuration | RHEA | 34755880 |
MMDBr0025654 | L-Serine | diphosphate | Protein adenylyltransferase SelO | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025655 | L-Serine | diphosphate | Protein adenylyltransferase SelO | Reversible transfer of an adenylyl group | RHEA | 34755880 |
MMDBr0025921 | Hydrogen Ion | NAD | FMN-dependent NADH:quinone oxidoreductase | Redox reaction | RHEA | 34755880 |
MMDBr0026014 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026015 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026016 | Phosphate | Guanosine 3',5'-bis(diphosphate) | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026017 | Phosphate | Adenosine diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026022 | Adenosine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026023 | Cytidine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026024 | Uridine 5'-monophosphate | Uridine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026025 | Guanosine monophosphate | Guanosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026046 | Uridine 5'-diphosphate | Uridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026047 | Uridine 5'-diphosphate | Cytidine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026048 | Guanosine 3',5'-bis(diphosphate) | Guanosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026073 | Deoxyadenosine monophosphate | Deoxyadenosine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026074 | 2'-Deoxyguanosine 5'-monophosphate | Deoxyguanosine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026075 | 2'-Deoxyuridine 5'-phosphate | 2'-Deoxyuridine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026076 | 2'-Deoxycytidine 5'-phosphate | Deoxycytidine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
MMDBr0026085 | Deoxyuridine-5'-diphosphate | Deoxyuridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026086 | 2'-Deoxycytidine 5'-diphosphate | Deoxycytidine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026087 | 2'-Deoxyadenosine 5'-diphosphate | Deoxyadenosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026088 | 2'-Deoxyguanosine 5'-diphosphate | 2'-Deoxyguanosine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |